| Name |
Sweroside |
| Formula |
C16H22O9 |
| Mw |
358.1263823 |
| CAS RN |
14215-86-2 |
| C_ID |
C00010794
, 
|
| InChIKey |
VSJGJMKGNMDJCI-WXOBHNDQNA-N |
| InChICode |
InChI=1S/C16H22O9/c1-2-7-8-3-4-22-14(21)9(8)6-23-15(7)25-16-13(20)12(19)11(18)10(5-17)24-16/h2,6-8,10-13,15-20H,1,3-5H2/t7-,8-,10+,11+,12-,13-,15-,16-/m0/s1 |
| SMILES |
C=C[C@H]1[C@H](O[C@@H]2OC(CO)[C@@H](O)C(O)[C@@H]2O)OC=C2C(=O)OCC[C@H]21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera japonica Thunb.  | Ref. |
| Plantae | -- | Lonicera quinquelocularis | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Berberidaceae | Podophyllum hexandrum  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Alangium lamarckii | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Dipsacus asperoides  | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Scabiosa japonica | Ref. |
| Plantae | Gentianaceae | Anthocleista ambesiaca | Ref. |
| Plantae | Gentianaceae | Anthocleista vogelii  | Ref. |
| Plantae | Gentianaceae | Centaurium erythraea  | Ref. |
| Plantae | Gentianaceae | Gentiana algida | Ref. |
| Plantae | Gentianaceae | Gentiana crassicaulis  | Ref. |
| Plantae | Gentianaceae | Gentiana kurroo  | Ref. |
| Plantae | Gentianaceae | Gentiana lawrencei | Ref. |
| Plantae | Gentianaceae | Gentiana loureirii | Ref. |
| Plantae | Gentianaceae | Gentiana lutea  | Ref. |
| Plantae | Gentianaceae | Gentiana macrophylla  | Ref. |
| Plantae | Gentianaceae | Gentiana manshurica  | Ref. |
| Plantae | Gentianaceae | Gentiana officinalis  | Ref. |
| Plantae | Gentianaceae | Gentiana rhodantha | Ref. |
| Plantae | Gentianaceae | Gentiana rigescens  | Ref. |
| Plantae | Gentianaceae | Gentiana scabra  | Ref. |
| Plantae | Gentianaceae | Gentiana straminea  | Ref. |
| Plantae | Gentianaceae | Gentiana verna | Ref. |
| Plantae | Gentianaceae | Swertia angustifolia  | Ref. |
| Plantae | Gentianaceae | Swertia calycina | Ref. |
| Plantae | Gentianaceae | Swertia chinensis | Ref. |
| Plantae | Gentianaceae | Swertia cincta | Ref. |
| Plantae | Gentianaceae | Swertia erythrosticta | Ref. |
| Plantae | Gentianaceae | Swertia fasciculata | Ref. |
| Plantae | Gentianaceae | Swertia franchetiana | Ref. |
| Plantae | Gentianaceae | Swertia japonica  | Ref. |
| Plantae | Gentianaceae | Swertia macrosperma | Ref. |
| Plantae | Gentianaceae | Swertia mileensis | Ref. |
| Plantae | Gentianaceae | Swertia nervosa | Ref. |
| Plantae | Gentianaceae | Swertia pseudochinensis | Ref. |
| Plantae | Gentianaceae | Swertia pubescens | Ref. |
| Plantae | Gentianaceae | Swertia punicea | Ref. |
| Plantae | Gentianaceae | Tripterospermum japonicum | Ref. |
| Plantae | Hydrangeaceae | Hydrangea chinensis | Ref. |
| Plantae | Hydrangeaceae | Pileostegia viburnoides var. glabrescens | Ref. |
| Plantae | Longaniaceae | Strychnos axillaris | Ref. |
| Plantae | Longaniaceae | Strychnos lucida | Ref. |
| Plantae | Longaniaceae | Strychnos spinosa  | Ref. |
| Plantae | Rubiaceae | Adina racemosa | Ref. |
| Plantae | Rubiaceae | Cephaelis acuminata Karsten | Ref. |
| Plantae | Rubiaceae | Chione venosa (sw.) Urban var.venosa | Ref. |
| Plantae | Rubiaceae | Mitragyna africanus WILLD. | Ref. |
| Plantae | Rubiaceae | Mitragyna inermis  | Ref. |
| Plantae | Rubiaceae | Mitragyna speciosa | Ref. |
| Plantae | Rubiaceae | Neonauclea sessilifolia  | Ref. |
| Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
| Plantae | Rubiaceae | Sinoadina racemosa | Ref. |
| - | - | Radix gentianae | Ref. |
| - | - | Sertia mussotii | Ref. |
|
|
zoom in
| Organism | Sinoadina racemosa | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Luo, et al., APS, 27, (1992), 125.
Tan, et al., APS, 28, (1993), 522.
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
OTSUKA, et al., Chem Pharm Bull, 49, (2001), 699.
Kumar, et al., Phytochemistry, 53, (2000), 499.
KITAJIMA, et al., Chem Pharm Bull, 53, (2005), 1355.
Itoh, et al., JNP, 66, (2003), 1212.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Karikome, Wen-ben Yang translated, Phytochemistry, Science Press, Beijing, (1985).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Peng, et al., Chinese J of Pharm Analysis, 30, (2010), 623 |
|---|
|