| Name |
Cycloartenol |
| Formula |
C30H50O |
| Mw |
426.38616622 |
| CAS RN |
469-38-5 |
| C_ID |
C00003650
, 
|
| InChIKey |
ONQRKEUAIJMULO-NWHDAKSQNA-N |
| InChICode |
InChI=1S/C30H50O/c1-20(2)9-8-10-21(3)22-13-15-28(7)24-12-11-23-26(4,5)25(31)14-16-29(23)19-30(24,29)18-17-27(22,28)6/h9,21-25,31H,8,10-19H2,1-7H3/t21-,22-,23-,24+,25+,27-,28+,29-,30+/m1/s1 |
| SMILES |
CC(C)=CCC[C@@H](C)[C@H]1CC[C@@]2(C)[C@@H]3CCC4C(C)(C)[C@@H](O)CC[C@@]45C[C@@]35CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asparagaceae | Asparagus racemosus  | Ref. |
| Plantae | Asteraceae | Santolina rosmarinifolia subsp. canescens  | Ref. |
| Plantae | Betulaceae | Betula platyphylla | Ref. |
| Plantae | Burseraceae | Commiphora wightii  | Ref. |
| Plantae | Chlamydomonadaceae | Chlamydomonas reinhardtii | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Costaceae | Costus speciosus  | Ref. |
| Plantae | Crassulaceae | Kalanchoe daigremontiana | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cucurbitaceae | Cucurbita pepo  | Ref. |
| Plantae | Cucurbitaceae | Luffa cylindrica  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea zingiberensis | Ref. |
| Plantae | Euphorbiaceae | Euphorbia guyoniana | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lathyris  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia neriifolia  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia peplus  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia petiolata | Ref. |
| Plantae | Euphorbiaceae | Euphorbia segetalis  | Ref. |
| Plantae | Euphorbiaceae | Pedilanthus tithymaloides  | Ref. |
| Plantae | Euphorbiaceae | Ricinus communis  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Lotus japonicus | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Gentianaceae | Gentiana straminea  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Linaceae | Linum usitatissimum  | Ref. |
| Plantae | Meliaceae | Swietenia mahogani | Ref. |
| Plantae | Moraceae | Artocarpus integrifolia  | Ref. |
| Plantae | Pinaceae | Abies magnifica | Ref. |
| Plantae | Plantaginaceae | Digitalis lanata Ehrh.  | Ref. |
| Plantae | Poaceae | Avena strigosa  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Pteridaceae | Adiantum capillus-veneris  | Ref. |
| Plantae | Ranunculaceae | Nigella sativa  | Ref. |
| Plantae | Rhizophoraceae | Kandelia candel | Ref. |
| Plantae | Rhizophoraceae | Rhizophora stylosa  | Ref. |
| Plantae | Salicaceae | Populus tremula L.  | Ref. |
| Plantae | Samydaceae | Casearia ilicifolia | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Solanaceae | Nicotiana benthamiana  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| - | - | Polypodiodes niponica  | Ref. |
|
|
zoom in
| Organism | Nigella sativa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|