| Name |
Lupeol Lupenol (+)-Lupenol |
| Formula |
C30H50O |
| Mw |
426.38616622 |
| CAS RN |
545-47-1 |
| C_ID |
C00003749
, 
|
| InChIKey |
MQYXUWHLBZFQQO-ZAEXXZHRNA-N |
| InChICode |
InChI=1S/C30H50O/c1-19(2)20-11-14-27(5)17-18-29(7)21(25(20)27)9-10-23-28(6)15-13-24(31)26(3,4)22(28)12-16-30(23,29)8/h20-25,31H,1,9-18H2,2-8H3/t20-,21+,22-,23+,24-,25+,27+,28-,29+,30+/m0/s1 |
| SMILES |
C=C(C)[C@@H]1CC[C@]2(C)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Bombycidae | Bombyx mori  | Ref. |
| Fungi | Coprinaceae | Coprinus atramentarius  | Ref. |
| Plantae | Acanthaceae | Phlogacanthus curviflorus | Ref. |
| Plantae | Acanthaceae | Rhinacanthus nasutus | Ref. |
| Plantae | Acanthaceae | Strobilanthes cusia BREMEK  | Ref. |
| Plantae | Acanthaceae | Strobilanthes formosanus | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apocynaceae | Alstonia boonei  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Hemidesmus indicus  | Ref. |
| Plantae | Apocynaceae | Periploca aphylla  | Ref. |
| Plantae | Apocynaceae | Thevetia peruviana  | Ref. |
| Plantae | Aquifoliaceae | Ilex cornuta  | Ref. |
| Plantae | Aquifoliaceae | Ilex latifolia  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asteraceae | Brachylaena ramiflora var. ramiflora | Ref. |
| Plantae | Asteraceae | Centipeda minima  | Ref. |
| Plantae | Asteraceae | Chuquiraga ulicina ssp. ulicina | Ref. |
| Plantae | Asteraceae | Cichorium intybus  | Ref. |
| Plantae | Asteraceae | Elephantopus scaber  | Ref. |
| Plantae | Asteraceae | Eupatorium macrocephalum Lee.  | Ref. |
| Plantae | Asteraceae | Launaea arborescens | Ref. |
| Plantae | Asteraceae | Liatris laevigata | Ref. |
| Plantae | Asteraceae | Ligularia dentata Hara | Ref. |
| Plantae | Asteraceae | Ligularia odontomanes | Ref. |
| Plantae | Asteraceae | Ligularia sagitta | Ref. |
| Plantae | Asteraceae | Petasites formosanus  | Ref. |
| Plantae | Asteraceae | Piptocarpha paradoxa | Ref. |
| Plantae | Asteraceae | Saussurea lappa Clarke.  | Ref. |
| Plantae | Asteraceae | Scorzonera cretica | Ref. |
| Plantae | Asteraceae | Senecio chionophilus | Ref. |
| Plantae | Asteraceae | Sonchus arvensis  | Ref. |
| Plantae | Asteraceae | Taraxacum officinale  | Ref. |
| Plantae | Asteraceae | Vernonia erdverbengii | Ref. |
| Plantae | Betulaceae | Betula platyphylla | Ref. |
| Plantae | Boraginaceae | Arnebia hispidissima | Ref. |
| Plantae | Boraginaceae | Arnebia nobilis | Ref. |
| Plantae | Burseraceae | Bursera graveolens | Ref. |
| Plantae | Burseraceae | Commiphora dalzielii | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Celastraceae | Maytenus cuzcoina | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia bancana MIQ  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia vilersiana | Ref. |
| Plantae | Clusiaceae-Guttiferae | Allanblackia monticola Staner L.C | Ref. |
| Plantae | Combretaceae | Pteleopsis hylodendron | Ref. |
| Plantae | Combretaceae | Terminalia brasiliensis | Ref. |
| Plantae | Combretaceae | Terminalia superba  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Crassulaceae | Kalanchoe daigremontiana | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Ebenaceae | Diospyros abyssinica  | Ref. |
| Plantae | Ebenaceae | Diospyros acuta | Ref. |
| Plantae | Ebenaceae | Diospyros argentea | Ref. |
| Plantae | Ebenaceae | Diospyros bipindensis | Ref. |
| Plantae | Ebenaceae | Diospyros buxifolia  | Ref. |
| Plantae | Ebenaceae | Diospyros canaliculata | Ref. |
| Plantae | Ebenaceae | Diospyros candalleana | Ref. |
| Plantae | Ebenaceae | Diospyros castanea | Ref. |
| Plantae | Ebenaceae | Diospyros cauliflora | Ref. |
| Plantae | Ebenaceae | Diospyros chevalieri | Ref. |
| Plantae | Ebenaceae | Diospyros cinnabarina | Ref. |
| Plantae | Ebenaceae | Diospyros consolatae | Ref. |
| Plantae | Ebenaceae | Diospyros cordifolia  | Ref. |
| Plantae | Ebenaceae | Diospyros cornii | Ref. |
| Plantae | Ebenaceae | Diospyros crassiflora | Ref. |
| Plantae | Ebenaceae | Diospyros curranii | Ref. |
| Plantae | Ebenaceae | Diospyros dendo | Ref. |
| Plantae | Ebenaceae | Diospyros diepenhorstii  | Ref. |
| Plantae | Ebenaceae | Diospyros discolor  | Ref. |
| Plantae | Ebenaceae | Diospyros ebenum  | Ref. |
| Plantae | Ebenaceae | Diospyros ehretioides | Ref. |
| Plantae | Ebenaceae | Diospyros elliptifolia | Ref. |
| Plantae | Ebenaceae | Diospyros embryopteris  | Ref. |
| Plantae | Ebenaceae | Diospyros eriantha | Ref. |
| Plantae | Ebenaceae | Diospyros evena | Ref. |
| Plantae | Ebenaceae | Diospyros exsculpta | Ref. |
| Plantae | Ebenaceae | Diospyros fragrans | Ref. |
| Plantae | Ebenaceae | Diospyros gabunensis | Ref. |
| Plantae | Ebenaceae | Diospyros gracilescens | Ref. |
| Plantae | Ebenaceae | Diospyros greeniway | Ref. |
| Plantae | Ebenaceae | Diospyros guianensis  | Ref. |
| Plantae | Ebenaceae | Diospyros hirsuta | Ref. |
| Plantae | Ebenaceae | Diospyros hoyleana | Ref. |
| Plantae | Ebenaceae | Diospyros ismailii | Ref. |
| Plantae | Ebenaceae | Diospyros iturensis | Ref. |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Ebenaceae | Diospyros kaki var.sylvestris  | Ref. |
| Plantae | Ebenaceae | Diospyros kamerunensis | Ref. |
| Plantae | Ebenaceae | Diospyros longiflora | Ref. |
| Plantae | Ebenaceae | Diospyros lotus  | Ref. |
| Plantae | Ebenaceae | Diospyros mafiensis | Ref. |
| Plantae | Ebenaceae | Diospyros maingayi | Ref. |
| Plantae | Ebenaceae | Diospyros mannii | Ref. |
| Plantae | Ebenaceae | Diospyros maritima BLUME  | Ref. |
| Plantae | Ebenaceae | Diospyros melanoxylon  | Ref. |
| Plantae | Ebenaceae | Diospyros mespiliformis  | Ref. |
| Plantae | Ebenaceae | Diospyros monobuttensis | Ref. |
| Plantae | Ebenaceae | Diospyros montana  | Ref. |
| Plantae | Ebenaceae | Diospyros moonii | Ref. |
| Plantae | Ebenaceae | Diospyros morrisiana | Ref. |
| Plantae | Ebenaceae | Diospyros natalensis | Ref. |
| Plantae | Ebenaceae | Diospyros obliquifolia | Ref. |
| Plantae | Ebenaceae | Diospyros oppositifolia | Ref. |
| Plantae | Ebenaceae | Diospyros peregrina  | Ref. |
| Plantae | Ebenaceae | Diospyros pseudo-malabarica | Ref. |
| Plantae | Ebenaceae | Diospyros quaesita | Ref. |
| Plantae | Ebenaceae | Diospyros rheophytica | Ref. |
| Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
| Plantae | Ebenaceae | Diospyros sanza-minika | Ref. |
| Plantae | Ebenaceae | Diospyros siamang | Ref. |
| Plantae | Ebenaceae | Diospyros siamensis | Ref. |
| Plantae | Ebenaceae | Diospyros siderophylla | Ref. |
| Plantae | Ebenaceae | Diospyros singaporensis | Ref. |
| Plantae | Ebenaceae | Diospyros spinescens | Ref. |
| Plantae | Ebenaceae | Diospyros sumatrana | Ref. |
| Plantae | Ebenaceae | Diospyros sylvatica | Ref. |
| Plantae | Ebenaceae | Diospyros thwaitesii | Ref. |
| Plantae | Ebenaceae | Diospyros tomentosa  | Ref. |
| Plantae | Ebenaceae | Diospyros toposia  | Ref. |
| Plantae | Ebenaceae | Diospyros virginiana  | Ref. |
| Plantae | Ebenaceae | Diospyros walkeri | Ref. |
| Plantae | Ebenaceae | Diospyros wallichii | Ref. |
| Plantae | Ebenaceae | Diospyros zenkeri | Ref. |
| Plantae | Ebenaceae | Euclea divinorum  | Ref. |
| Plantae | Ebenaceae | Euclea natalensis  | Ref. |
| Plantae | Ericaceae | Enkianthus cernuus | Ref. |
| Plantae | Ericaceae | Epigaea asiatica | Ref. |
| Plantae | Ericaceae | Erica arborea L.  | Ref. |
| Plantae | Ericaceae | Leucothoe grayana Max. | Ref. |
| Plantae | Ericaceae | Pieris japonica D.Don.  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum ovalifolium | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum passerinum | Ref. |
| Plantae | Euphorbiaceae | Croton zambesicus  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia helioscopia  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia larica | Ref. |
| Plantae | Euphorbiaceae | Euphorbia portlandica | Ref. |
| Plantae | Euphorbiaceae | Euphorbia supina Rafin | Ref. |
| Plantae | Euphorbiaceae | Euphorbia tanquahuete | Ref. |
| Plantae | Euphorbiaceae | Pedilanthus tithymaloides  | Ref. |
| Plantae | Euphorbiaceae | Ricinus communis  | Ref. |
| Plantae | Fabaceae | Acacia mellifera  | Ref. |
| Plantae | Fabaceae | Acacia pennatula | Ref. |
| Plantae | Fabaceae | Acacia trineura | Ref. |
| Plantae | Fabaceae | Albizia gummifera  | Ref. |
| Plantae | Fabaceae | Albizia lebbeck  | Ref. |
| Plantae | Fabaceae | Albizia versicolor  | Ref. |
| Plantae | Fabaceae | Anadenanthera colubrine | Ref. |
| Plantae | Fabaceae | Caesalpinia decapetala  | Ref. |
| Plantae | Fabaceae | Caesalpinia pulcherrima  | Ref. |
| Plantae | Fabaceae | Cassia siamea Lamk.  | Ref. |
| Plantae | Fabaceae | Cassia speciosa | Ref. |
| Plantae | Fabaceae | Crotalaria assamica | Ref. |
| Plantae | Fabaceae | Crotalaria pallida  | Ref. |
| Plantae | Fabaceae | Deguelia hatschbachii | Ref. |
| Plantae | Fabaceae | Derris oblonga | Ref. |
| Plantae | Fabaceae | Entada scandens  | Ref. |
| Plantae | Fabaceae | Eysenhardtia platycarpa | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Lotus japonicus | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Lupinus luteus  | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Fabaceae | Piptadenia macrocarpa | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Pongamia pinnata  | Ref. |
| Plantae | Fabaceae | Pterocarpus santalinus  | Ref. |
| Plantae | Fabaceae | Sophora subprostrata | Ref. |
| Plantae | Fabaceae | Sophora substrata | Ref. |
| Plantae | Fabaceae | Tephrosia purpurea  | Ref. |
| Plantae | Fagaceae | Quercus myrsenaefolia | Ref. |
| Plantae | Fagaceae | Quercus stenophylla Makino. | Ref. |
| Plantae | Gentianaceae | Gentiana lutea  | Ref. |
| Plantae | Gentianaceae | Gentiana scabra  | Ref. |
| Plantae | Hypericaceae | Harungana madagascariensis  | Ref. |
| Plantae | Icacinaceae | Gonocaryum calleryanum  | Ref. |
| Plantae | Labiatae | Marsypianthes chamaedrys  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia roborowskii | Ref. |
| Plantae | Labiatae | Sideritis argosphacelus var. spicata | Ref. |
| Plantae | Labiatae | Sideritis candicans var.eriocephala | Ref. |
| Plantae | Lardizabalaceae | Stauntonia hexahylla | Ref. |
| Plantae | Lauraceae | Beilschmiedia erythrophloia | Ref. |
| Plantae | Lauraceae | Neolitsea konishii | Ref. |
| Plantae | Lauraceae | Neolitsea parvigemma | Ref. |
| Plantae | Longaniaceae | Strychnos potatorum  | Ref. |
| Plantae | Loranthaceae | Loranthus parasiticus | Ref. |
| Plantae | Lythraceae | Lawsonia alba  | Ref. |
| Plantae | Malpighiaceae | Byrsonima microphylla | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Malvaceae | Adansonia digitata  | Ref. |
| Plantae | Malvaceae | Eriolaena hookeriana | Ref. |
| Plantae | Meliaceae | Aglaia forbesii  | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Meliaceae | Dysoxylum malabaricum | Ref. |
| Plantae | Melianthaceae | Bersama swinyi | Ref. |
| Plantae | Moraceae | Dorstenia angusticornis | Ref. |
| Plantae | Moraceae | Ficus carica  | Ref. |
| Plantae | Moraceae | Ficus microcarpa  | Ref. |
| Plantae | Moraceae | Ficus rasemosa | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Myricaceae | Myrica rubra  | Ref. |
| Plantae | Myrtaceae | Rhodomyrtus tomentosa  | Ref. |
| Plantae | Myrtaceae | Syzygium formosanum | Ref. |
| Plantae | Oleaceae | Nyctanthes arbor-tristis Linn.  | Ref. |
| Plantae | Oleaceae | Olea europaea  | Ref. |
| Plantae | Oleaceae | Phillyrea latifolia L.  | Ref. |
| Plantae | Phyllanthaceae | Glochidion eriocarpum  | Ref. |
| Plantae | Phyllanthaceae | Glochidion puberum | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus flexuosus | Ref. |
| Plantae | Plantaginaceae | Scoparia dulcis L.  | Ref. |
| Plantae | Plantaginaceae | Stemodia foliosa | Ref. |
| Plantae | Plumbaginaceae | Plumbago zeylanica  | Ref. |
| Plantae | Polygonaceae | Coccoloba excoriata | Ref. |
| Plantae | Polygonaceae | Rumex nepalensis  | Ref. |
| Plantae | Putranjivaceae | Drypetes tessmanniana | Ref. |
| Plantae | Rhamnaceae | Alphitonia petriei Braid et White.  | Ref. |
| Plantae | Rhamnaceae | Rhamnus wightii  | Ref. |
| Plantae | Rhamnaceae | Ventilago leiocarpa | Ref. |
| Plantae | Rhizophoraceae | Bruguiera gymnorrhiza  | Ref. |
| Plantae | Rhizophoraceae | Bruguiera parviflora  | Ref. |
| Plantae | Rhizophoraceae | Ceriops tagal  | Ref. |
| Plantae | Rubiaceae | Coussarea paniculata | Ref. |
| Plantae | Rubiaceae | Lasianthus gardneri | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Esenbeckia yaxhoob Lundell | Ref. |
| Plantae | Rutaceae | Fagara heitzii | Ref. |
| Plantae | Rutaceae | Fagara tessmannii Engl. | Ref. |
| Plantae | Rutaceae | Flindersia laevicarpa C.T.White et Francis. | Ref. |
| Plantae | Rutaceae | Luvunga sarmentosa (Bl.) Kurz. | Ref. |
| Plantae | Rutaceae | Oricia gabonensis | Ref. |
| Plantae | Rutaceae | Oricia suaveolens | Ref. |
| Plantae | Rutaceae | Vepris punctata | Ref. |
| Plantae | Rutaceae | Zanthoxylum armatum  | Ref. |
| Plantae | Rutaceae | Zanthoxylum culantrillo | Ref. |
| Plantae | Rutaceae | Zanthoxylum dipetalum | Ref. |
| Plantae | Salicaceae | Populus tremula L.  | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Sapindaceae | Schleichera oleosa  | Ref. |
| Plantae | Solanaceae | Lycium chinense  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Stilbaceae | Nuxia sphaerocephala  | Ref. |
| Plantae | Trochodendraceae/Tetracentraceae | Tetracentron sinense  | Ref. |
| Plantae | Verbenaceae | Verbena officinalis L.  | Ref. |
| - | - | Aegopordon berarioides | Ref. |
| - | - | Asteracantha longifolia  | Ref. |
| - | - | Baphicacanthus cusia  | Ref. |
| - | - | Befaria glutinosa | Ref. |
| - | - | Crataeva benthami | Ref. |
| - | - | Crotone hieronymi | Ref. |
| - | - | Hypestes purpurea | Ref. |
| - | - | Laurencia dendroidea | Ref. |
| - | - | Moghania macrophylla | Ref. |
| - | - | Tevenotica persica | Ref. |
| - | - | Zizphus cambodiana | Ref. |
|
|
zoom in
| Organism | Acacia pennatula | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|