| Name |
3-O-Caffeoylquinic acid Chlorogenic acid Chlorogenate Heriguard Caffeoylquinic acid |
| Formula |
C16H18O9 |
| Mw |
354.09508217 |
| CAS RN |
327-97-9 |
| C_ID |
C00002724
, 
|
| InChIKey |
CWVRJTMFETXNAD-PCEXOASVNA-N |
| InChICode |
InChI=1S/C16H18O9/c17-9-3-1-8(5-10(9)18)2-4-13(20)25-12-7-16(24,15(22)23)6-11(19)14(12)21/h1-5,11-12,14,17-19,21,24H,6-7H2,(H,22,23)/b4-2+/t11-,12-,14-,16+/m1/s1 |
| SMILES |
O=C(/C=C/c1ccc(O)c(O)c1)O[C@@H]1C[C@](O)(C(=O)O)C[C@@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera confusa  | Ref. |
| Plantae | -- | Lonicera fulvotomentosa | Ref. |
| Plantae | -- | Lonicera hypoglauca  | Ref. |
| Plantae | -- | Lonicera implexa  | Ref. |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | -- | Lonicera similis | Ref. |
| Plantae | Acanthaceae | Andrographis paniculata  | Ref. |
| Plantae | Acanthaceae | Strobilanthes crispus  | Ref. |
| Plantae | Adoxaceae | Sambucus formosana | Ref. |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Alliaceae | Allium obliquum  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Alliaceae | Allium Sativum | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Apiaceae | Angelica furcijuga KITAGAWA | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Chaerophyllum hirsutum | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Falcaria vulgaris | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Glehnia littoralis  | Ref. |
| Plantae | Apocynaceae | Marsdenia cundurango  | Ref. |
| Plantae | Apocynaceae | Nerium oleander  | Ref. |
| Plantae | Apocynaceae | Trachelospermum asiaticum var.intermedium  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Achillea millefolium  | Ref. |
| Plantae | Asteraceae | Anthemis altissima  | Ref. |
| Plantae | Asteraceae | Arctium lappa  | Ref. |
| Plantae | Asteraceae | Arnica montana cv.ARBO  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia capillaris  | Ref. |
| Plantae | Asteraceae | Artemisia herba-alba  | Ref. |
| Plantae | Asteraceae | Artemisia scoparia. | Ref. |
| Plantae | Asteraceae | Aster salignus | Ref. |
| Plantae | Asteraceae | Centaurea gigantea | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Chrysanthemum indicum  | Ref. |
| Plantae | Asteraceae | Chrysanthemum indicum L.  | Ref. |
| Plantae | Asteraceae | Chrysanthemum morifolium  | Ref. |
| Plantae | Asteraceae | Cirsium setosum | Ref. |
| Plantae | Asteraceae | Helianthus annuus L.cv.Peredovick  | Ref. |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Asteraceae | Lactuca indica  | Ref. |
| Plantae | Asteraceae | Leontodon autumnalis | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Onopordum acanthium  | Ref. |
| Plantae | Asteraceae | Pterocaulon virgatum  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Scorzonera divaricata | Ref. |
| Plantae | Asteraceae | Senecio nemorensis | Ref. |
| Plantae | Asteraceae | Solidago altissima L. | Ref. |
| Plantae | Asteraceae | Solidago canadensis | Ref. |
| Plantae | Asteraceae | Taraxacum formosanum | Ref. |
| Plantae | Asteraceae | Taraxacum mongolicum  | Ref. |
| Plantae | Asteraceae | Taraxacum officinale  | Ref. |
| Plantae | Berberidaceae | Epimedium koreanum  | Ref. |
| Plantae | Berberidaceae | Epimedium sagittatum  | Ref. |
| Plantae | Blechnaceae | Blechnum orientale  | Ref. |
| Plantae | Boraginaceae | Cordia macleodii | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia jasminoides | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Convolvulaceae | Erycibe schimidtii | Ref. |
| Plantae | Convolvulaceae | Ipomoea nil  | Ref. |
| Plantae | Convolvulaceae | Ipomoea njil cv. Danjuro | Ref. |
| Plantae | Cruciferae | Brassica oleracea var.capitata  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Citrullus colocynthis  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
| Plantae | Ephedraceae | Ephedra sinica  | Ref. |
| Plantae | Ericaceae | Rhododendron catawbiense | Ref. |
| Plantae | Ericaceae | Rhododendron fortunei | Ref. |
| Plantae | Ericaceae | Rhododendron insigne | Ref. |
| Plantae | Ericaceae | Rhododendron kaempferi | Ref. |
| Plantae | Ericaceae | Rhododendron micranthum | Ref. |
| Plantae | Ericaceae | Rhododendron oreotrephes | Ref. |
| Plantae | Ericaceae | Rhododendron ponticum | Ref. |
| Plantae | Ericaceae | Rhododendron praevernum | Ref. |
| Plantae | Ericaceae | Rhododendron sp. | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides Oliver  | Ref. |
| Plantae | Fabaceae | Acacia nilotica  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Peltophorum africanum  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Trifolium alpestre | Ref. |
| Plantae | Fabaceae | Trifolium medium | Ref. |
| Plantae | Fabaceae | Trifolium pratense L.  | Ref. |
| Plantae | Fumariaceae | Fumaria capreolata  | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Hamamelidaceae | Loropetalum chinense | Ref. |
| Plantae | Hypericaceae | Hypericum perforatum  | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Labiatae | Phlomis brunneogaleata | Ref. |
| Plantae | Labiatae | Salvia albimaculata | Ref. |
| Plantae | Labiatae | Salvia horminum  | Ref. |
| Plantae | Labiatae | Salvia officinalis L.  | Ref. |
| Plantae | Labiatae | Salvia triloba  | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Labiatae | Sideritis catillaris | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus comosus | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Lardizabalaceae | Sargentodoxa cuneata | Ref. |
| Plantae | Longaniaceae | Strychnos colubrina  | Ref. |
| Plantae | Longaniaceae | Strychnos lucida | Ref. |
| Plantae | Longaniaceae | Strychnos nux-vomica  | Ref. |
| Plantae | Lythraceae | Lythrum salicaria  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
| Plantae | Malvaceae | Gossypium barbadense  | Ref. |
| Plantae | Malvaceae | Theobroma cacao  | Ref. |
| Plantae | Meliaceae | Toona ciliata  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Musaceae | Musa acuminata  | Ref. |
| Plantae | Myrtaceae | Eugenia jambolana  | Ref. |
| Plantae | Onocleaceae/Dryopteridaceae | Matteuccia struthiopteris  | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus sellowianus | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Plantaginaceae | Plantago bellardi | Ref. |
| Plantae | Plantaginaceae | Plantago cretica | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Veronica montana | Ref. |
| Plantae | Plantaginaceae | Veronica officinalis  | Ref. |
| Plantae | Plantaginaceae | Veronica orchidea | Ref. |
| Plantae | Plantaginaceae | Veronica polita | Ref. |
| Plantae | Plantaginaceae | Veronica spuria | Ref. |
| Plantae | Plantaginaceae | Veronica teucrium | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Polygonaceae | Calligonum leucocladum | Ref. |
| Plantae | Polygonaceae | Fagopyrum cymosum  | Ref. |
| Plantae | Polygonaceae | Polygonum aviculare  | Ref. |
| Plantae | Polygonaceae | Polygonum bistorta  | Ref. |
| Plantae | Polypodiaceae | Polypodium vulgare  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia davidii  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia drakeana | Ref. |
| Plantae | Polypodiaceae | Pyrrosia gralla | Ref. |
| Plantae | Polypodiaceae | Pyrrosia lingua  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia petiolosa  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia pseudocalvata | Ref. |
| Plantae | Polypodiaceae | Pyrrosia sheareri | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Primulaceae | Primula veris  | Ref. |
| Plantae | Ranunculaceae/Hydrastidaceae | Hydrastis canadensis  | Ref. |
| Plantae | Resedaceae | Reseda muricata C.Presl. | Ref. |
| Plantae | Rosaceae | Cotoneaster simonsii | Ref. |
| Plantae | Rosaceae | Crataegus cuneata  | Ref. |
| Plantae | Rosaceae | Crataegus oxyacantha  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida  | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida var.major  | Ref. |
| Plantae | Rosaceae | Eriobotrya japonica  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus cerasus  | Ref. |
| Plantae | Rosaceae | Prunus mume  | Ref. |
| Plantae | Rubiaceae | Adina racemosa | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Rubiaceae | Galium verum  | Ref. |
| Plantae | Rubiaceae | Mitragyna speciosa | Ref. |
| Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
| Plantae | Rubiaceae | Sinoadina racemosa | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Zanthoxylum ailanthoides | Ref. |
| Plantae | Sapindaceae | Dodonaea viscosa  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Saxifragaceae | Saxifraga azizoon | Ref. |
| Plantae | Solanaceae | Brunfelsia grandiflora D.DON  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum acaule | Ref. |
| Plantae | Solanaceae | Solanum bulbocastanum | Ref. |
| Plantae | Solanaceae | Solanum canasense | Ref. |
| Plantae | Solanaceae | Solanum cardiophyllum | Ref. |
| Plantae | Solanaceae | Solanum chacoense | Ref. |
| Plantae | Solanaceae | Solanum commersonii  | Ref. |
| Plantae | Solanaceae | Solanum fendleri  | Ref. |
| Plantae | Solanaceae | Solanum habrochaites | Ref. |
| Plantae | Solanaceae | Solanum hougasii | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum multidissectum | Ref. |
| Plantae | Solanaceae | Solanum neorickii | Ref. |
| Plantae | Solanaceae | Solanum nigrum  | Ref. |
| Plantae | Solanaceae | Solanum parviflorum | Ref. |
| Plantae | Solanaceae | Solanum pennellii | Ref. |
| Plantae | Solanaceae | Solanum phureja | Ref. |
| Plantae | Solanaceae | Solanum pimpinellifollium | Ref. |
| Plantae | Solanaceae | Solanum pinnacritisectum | Ref. |
| Plantae | Solanaceae | Solanum stoloniferum | Ref. |
| Plantae | Solanaceae | Solanum tarijense | Ref. |
| Plantae | Solanaceae | Solanum tuberosum L.  | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Theaceae | Thea sinensis  | Ref. |
| Plantae | Turneraceae | Turnera ulmifolia  | Ref. |
| Plantae | Urticaceae | Urtica dioica  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana jatamansii  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana prionophylla  | Ref. |
| Plantae | Verbenaceae | Stachytarpheta jamaicensis  | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
| Plantae | Zingiberaceae | Etlingera elatior  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Apiaceae | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Paraburkholderia phymatum | Ref. |
| - | - | Platyphora ligata | Ref. |
| - | - | Stachytapheta jamaicensis | Ref. |
|
|
zoom in
| Organism | Fumaria schleicheri | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|