| Name |
Hirsutrin Isoquercitrin Quercetin-3-O-glucoside Quercetin 3-O-beta-D-glucoside Isoquercetin Isoquercetrin (-)-Isoquercetrin Quercetin 3-O-beta-D-glucopyranoside Quercetin 3-glucoside Quercetin-3-O-beta-D-glucopyranoside (-)-Quercetin-3-O-beta-D-glucopyranoside Quercetin 3-O-glucoside Quercetin-3-beta-glucopyranoside |
| Formula |
C21H20O12 |
| Mw |
464.09547611 |
| CAS RN |
482-35-9 |
| C_ID |
C00005373
, 
|
| InChIKey |
OVSQVDMCBVZWGM-UNCWLGIWNA-N |
| InChICode |
InChI=1S/C21H20O12/c22-6-13-15(27)17(29)18(30)21(32-13)33-20-16(28)14-11(26)4-8(23)5-12(14)31-19(20)7-1-2-9(24)10(25)3-7/h1-5,13,15,17-18,21-27,29-30H,6H2/t13-,15-,17-,18-,21+/m1/s1 |
| SMILES |
O=c1c(O[C@@H]2O[C@H](CO)[C@@H](O)C(O)C2O)c(-c2ccc(O)c(O)c2)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Acanthus ilicifolius  | Ref. |
| Plantae | Alliaceae | Allium ascalonicum  | Ref. |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Alliaceae | Allium obliquum  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona crassiflora  | Ref. |
| Plantae | Annonaceae | Annona monticola | Ref. |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Annonaceae | Annona tomentosa | Ref. |
| Plantae | Annonaceae | Annona warmingiana | Ref. |
| Plantae | Annonaceae | Bocagea sp.nov. | Ref. |
| Plantae | Annonaceae | Guatteria australis | Ref. |
| Plantae | Annonaceae | Guatteria notabilis | Ref. |
| Plantae | Annonaceae | Guatteria rupestris | Ref. |
| Plantae | Annonaceae | Guatteria villosissima | Ref. |
| Plantae | Annonaceae | Porcelia macrocarpa | Ref. |
| Plantae | Annonaceae | Rollinia dolabripetala | Ref. |
| Plantae | Annonaceae | Xylopia aromatica  | Ref. |
| Plantae | Apiaceae | Angelica furcijuga KITAGAWA | Ref. |
| Plantae | Apiaceae | Bupleurum chinense | Ref. |
| Plantae | Apiaceae | Bupleurum rotundifolia | Ref. |
| Plantae | Apiaceae | Bupleurum rotundifolium L.  | Ref. |
| Plantae | Apiaceae | Carum carvi  | Ref. |
| Plantae | Apiaceae | Chaerophyllum hirsutum | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Glehnia littoralis  | Ref. |
| Plantae | Apiaceae | Levisticum officinale  | Ref. |
| Plantae | Apocynaceae | Apocynum lancifolium | Ref. |
| Plantae | Apocynaceae | Apocynum venetum  | Ref. |
| Plantae | Asteraceae | Anthemis altissima  | Ref. |
| Plantae | Asteraceae | Arnica montana cv.ARBO  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia spp.  | Ref. |
| Plantae | Asteraceae | Calendula officinalis  | Ref. |
| Plantae | Asteraceae | Carthamus tinctorius  | Ref. |
| Plantae | Asteraceae | Centaurea gigantea | Ref. |
| Plantae | Asteraceae | Centaurea solstitialis | Ref. |
| Plantae | Asteraceae | Clibadium spp. | Ref. |
| Plantae | Asteraceae | Conyza filaginoides | Ref. |
| Plantae | Asteraceae | Desmanthodium spp. | Ref. |
| Plantae | Asteraceae | Gaillardia aristata Pursh. | Ref. |
| Plantae | Asteraceae | Gutierrezia wrightii | Ref. |
| Plantae | Asteraceae | Haplopappus foliosus | Ref. |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Asteraceae | Lactuca indica  | Ref. |
| Plantae | Asteraceae | Onopordum acanthium  | Ref. |
| Plantae | Asteraceae | Saussurea medusa | Ref. |
| Plantae | Asteraceae | Silphium perfoliatum L. | Ref. |
| Plantae | Asteraceae | Solidago altissima | Ref. |
| Plantae | Asteraceae | Stevia rebaudiana  | Ref. |
| Plantae | Asteraceae | Zinnia elegans | Ref. |
| Plantae | Berberidaceae | Berberis microphylia | Ref. |
| Plantae | Boraginaceae | Alkanna orientalis | Ref. |
| Plantae | Bromeliaceae | Pitcairnia rubiflora | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Campanula glomerata L. | Ref. |
| Plantae | Canellaceae | Warburgia stuhlmannii  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Casuarinaceae | Casuarina equisetifolia  | Ref. |
| Plantae | Celastraceae | Tripterygium regelii | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
| Plantae | Chloranthaceae | Ascarina lucida | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Commelinaceae | Commelina communis L  | Ref. |
| Plantae | Convallariaceae | Convallaria keiskei  | Ref. |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Costaceae | Costus spicatus  | Ref. |
| Plantae | Crassulaceae | Kalanchoe blossfeldiana | Ref. |
| Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
| Plantae | Crassulaceae | Sedum acre  | Ref. |
| Plantae | Crassulaceae | Sinocrassula indica  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea var. botrytis italica  | Ref. |
| Plantae | Cruciferae | Brassica oleracea var. costata  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Cruciferae | Descurainia sophia  | Ref. |
| Plantae | Cruciferae | Descurainia Sophia | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus  | Ref. |
| Plantae | Cucurbitaceae | Marah oreganus | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Cunoniaceae | Davidsonia pruriens  | Ref. |
| Plantae | Dennstaedtiaceae | Pteridium aquilinum  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea bulbifera  | Ref. |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Ebenaceae | Diospyros rhombifolia | Ref. |
| Plantae | Ephedraceae | Ephedra campylopoda  | Ref. |
| Plantae | Equisetaceae | Equisetum arvense  | Ref. |
| Plantae | Equisetaceae | Equisetum hiemale | Ref. |
| Plantae | Equisetaceae | Equisetum sylvaticum | Ref. |
| Plantae | Ericaceae | Pyrola decorata  | Ref. |
| Plantae | Ericaceae | Pyrola elliptica | Ref. |
| Plantae | Ericaceae | Pyrola spp. | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum rimosum | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides Oliv.  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia chamaesyce | Ref. |
| Plantae | Euphorbiaceae | Euphorbia larica | Ref. |
| Plantae | Euphorbiaceae | Euphorbia magalanta | Ref. |
| Plantae | Euphorbiaceae | Euphorbia virgata | Ref. |
| Plantae | Euphorbiaceae | Pedilanthus tithymaloides  | Ref. |
| Plantae | Euphorbiaceae | Ricinus communis  | Ref. |
| Plantae | Euphorbiaceae | Sapium haematospermum  | Ref. |
| Plantae | Fabaceae | Acacia caven  | Ref. |
| Plantae | Fabaceae | Acacia mangium  | Ref. |
| Plantae | Fabaceae | Acacia nilotica  | Ref. |
| Plantae | Fabaceae | Albizia julibrissin  | Ref. |
| Plantae | Fabaceae | Baptisia spp. | Ref. |
| Plantae | Fabaceae | Bauhinia vahlii L.  | Ref. |
| Plantae | Fabaceae | Cassia grandis  | Ref. |
| Plantae | Fabaceae | Clitoria ternatea  | Ref. |
| Plantae | Fabaceae | Cytisus scoparius  | Ref. |
| Plantae | Fabaceae | Gleditsia japonica Miquel.  | Ref. |
| Plantae | Fabaceae | Gleditsia sinensis Lam.  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra L.  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Hedysarum sericeum | Ref. |
| Plantae | Fabaceae | Indigofera tetrantha | Ref. |
| Plantae | Fabaceae | Lespedeza bicolor  | Ref. |
| Plantae | Fabaceae | Lotus japonicus | Ref. |
| Plantae | Fabaceae | Millettia zechiana | Ref. |
| Plantae | Fabaceae | Onobrychis amoena | Ref. |
| Plantae | Fabaceae | Onobrychis chlorassanica | Ref. |
| Plantae | Fabaceae | Onobrychis echidna | Ref. |
| Plantae | Fabaceae | Onobrychis ferganica | Ref. |
| Plantae | Fabaceae | Onobrychis grandis | Ref. |
| Plantae | Fabaceae | Onobrychis seravschanica | Ref. |
| Plantae | Fabaceae | Peltophorum africanum  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Tachigalia paniculata | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Trifolium subterraneum  | Ref. |
| Plantae | Fabaceae | Vicia sativa  | Ref. |
| Plantae | Fagaceae | Castanea sativa  | Ref. |
| Plantae | Fumariaceae | Fumaria capreolata  | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
| Plantae | Gentianaceae | Gentiana pyrenaica L. | Ref. |
| Plantae | Geraniaceae | Pelargonium graveolens  | Ref. |
| Plantae | Geraniaceae | Pelargonium radula | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Gleicheniaceae | Dicranopteris linearis | Ref. |
| Plantae | Haemodoraceae | Anigozanthos pulcherrimus | Ref. |
| Plantae | Haemodoraceae | Anigozanthos rufus | Ref. |
| Plantae | Hypericaceae | Hypericum ascyron  | Ref. |
| Plantae | Hypericaceae | Hypericum japonicum  | Ref. |
| Plantae | Hypericaceae | Hypericum perforatum  | Ref. |
| Plantae | Hypericaceae | Hypericum perforatum L.  | Ref. |
| Plantae | Hypericaceae | Hypericum sampsonii | Ref. |
| Plantae | Hypericaceae | Hypericum thasium | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Juglandaceae | Carya pecan | Ref. |
| Plantae | Labiatae | Ajuga remota  | Ref. |
| Plantae | Labiatae | Elsholtzia rugulosa Hemsl. | Ref. |
| Plantae | Labiatae | Isodon leucophyllus | Ref. |
| Plantae | Labiatae | Marrubium velutinum | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Phlomis spinidens | Ref. |
| Plantae | Labiatae | Salvia blepharophylla | Ref. |
| Plantae | Labiatae | Salvia cavaleriei | Ref. |
| Plantae | Labiatae | Salvia lavandulifolia  | Ref. |
| Plantae | Labiatae | Salvia pinnata | Ref. |
| Plantae | Lauraceae | Lindera megaphylla | Ref. |
| Plantae | Longaniaceae | Strychnos spinosa  | Ref. |
| Plantae | Loranthaceae | Taxillus levinei | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Abelmoschus manihot  | Ref. |
| Plantae | Malvaceae | Gossypium barbadense  | Ref. |
| Plantae | Malvaceae | Gossypium herbaceum  | Ref. |
| Plantae | Malvaceae | Gossypium hirsutum L.  | Ref. |
| Plantae | Malvaceae | Hibiscus mutabilis  | Ref. |
| Plantae | Malvaceae | Theobroma cacao L.  | Ref. |
| Plantae | Moraceae | Ficus ruficaulis | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus insignis | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrina  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Musaceae | Musa acuminata  | Ref. |
| Plantae | Myrsinaceae | Ardisia colorata | Ref. |
| Plantae | Myrsinaceae | Lysimachia christinae  | Ref. |
| Plantae | Myrsinaceae | Lysimachia nummularia  | Ref. |
| Plantae | Myrtaceae | Eucalyptus maideni | Ref. |
| Plantae | Myrtaceae | Eugenia involucruta | Ref. |
| Plantae | Myrtaceae | Myrciaria cauliflora  | Ref. |
| Plantae | Myrtaceae | Psidium cattleyanum | Ref. |
| Plantae | Myrtaceae | Psidium guaijava | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Myrtaceae | Syzygium cumini  | Ref. |
| Plantae | Nelumbonaceae | Nelumbo nucifera  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
| Plantae | Ochnaceae | Ochna obtusata | Ref. |
| Plantae | Oleaceae | Forsythia viridissima | Ref. |
| Plantae | Onagraceae | Heterogaura heterandra | Ref. |
| Plantae | Palmae | Phoenix hanceana var. formosana | Ref. |
| Plantae | Petrosaviaceae/Nartheciaceae | Japonolirion osense | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus acidus  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus niruri  | Ref. |
| Plantae | Pinaceae | Abies amabilis | Ref. |
| Plantae | Pinaceae | Larix decidua  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Piperaceae | Piper umbellatum  | Ref. |
| Plantae | Plantaginaceae | Veronica montana | Ref. |
| Plantae | Plantaginaceae | Veronica polita | Ref. |
| Plantae | Plantaginaceae | Veronica spuria | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Podocarpaceae | Podocarpus fasciculus | Ref. |
| Plantae | Polygonaceae | Polygonum cuspidatum  | Ref. |
| Plantae | Polygonaceae | Polygonum equiseiforme | Ref. |
| Plantae | Polygonaceae | Polygonum lapathifolium  | Ref. |
| Plantae | Polygonaceae | Polygonum persicaria  | Ref. |
| Plantae | Polygonaceae | Polygonum polystachyum | Ref. |
| Plantae | Polygonaceae | Polygonum salicifolium  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia lingua  | Ref. |
| Plantae | Rhamnaceae | Rhamnus davurica | Ref. |
| Plantae | Rosaceae | Coleogyne ramosissima Torr. | Ref. |
| Plantae | Rosaceae | Crataegus pinnatifida var major  | Ref. |
| Plantae | Rosaceae | Eriobotrya japonica  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus cerasus  | Ref. |
| Plantae | Rosaceae | Rosa luciae | Ref. |
| Plantae | Rosaceae | Rosa multiflora  | Ref. |
| Plantae | Rosaceae | Rosa rugosa  | Ref. |
| Plantae | Rosaceae | Sorbus commixta  | Ref. |
| Plantae | Rosaceae | Spiraea formosana  | Ref. |
| Plantae | Rubiaceae | Mitragyna speciosa | Ref. |
| Plantae | Rutaceae | Dictamnus angustifolius | Ref. |
| Plantae | Rutaceae | Melicope micrococca | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Salicaceae | Salix acmophylla  | Ref. |
| Plantae | Salicaceae | Salix matsudana | Ref. |
| Plantae | Salicaceae | Salix raddeana | Ref. |
| Plantae | Salicaceae | Salix viminalis  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Saururaceae | Saururus chinensis  | Ref. |
| Plantae | Saxifragaceae | Leptarrhena pyrolifolia | Ref. |
| Plantae | Saxifragaceae | Rodgersia podophylla  | Ref. |
| Plantae | Scrophulariaceae | Hebe parviflora | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Physalis alkekengi var. franchetii  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum L.  | Ref. |
| Plantae | Takakiaceae | Takakia spp. | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Thelypteridaceae | Thelypteris nipponica | Ref. |
| Plantae | Verbenaceae | Verbena bipinnatifida | Ref. |
| Plantae | Verbenaceae | Verbena hybrida | Ref. |
| Plantae | Vitaceae | Vitis vinifera var.'Trebbiano'.  | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
| Plantae | Zingiberaceae | Etlingera elatior  | Ref. |
| Plantae | Zygophyllaceae | Tribulus alatus Del.  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
| - | - | Aceraceae negundo | Ref. |
| - | - | Aganosma caryophyllata | Ref. |
| - | - | Campomanesia xanthocarpa | Ref. |
| - | - | Chamaenerion angustifolium | Ref. |
| - | - | Monochaetun multiflorum | Ref. |
| - | - | Myrcianthes pungens | Ref. |
| - | - | Peltiphyllum peltatum | Ref. |
|
|
zoom in
| Organism | Diospyros kaki | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Wu, et al., Chinese Traditional and Herbal Drugs(Zhongcaoyao), 34, (2003), add 6-7.
Zhao, et al., Acta Botanica Yunnanica(Yunnan Zhiwu Yanjiu), 25, (2003), 503.
Sun, et al., Chem Pharm Bull, 52, (2004), 1483.
Tang, et al., Journal of Natural Products, 64, (2001), 1107.
DOI, et al., Chem Pharm Bull, 49, (2001), 151.
Huang, et al., Zhiwu Xuebao, 23, (1981), 222.
Zhang, et al., Planta Med, 70, (2004), 1216.
YUAN, et al., Chem Pharm Bull, 50, (2002), 73.
ZHANG, et al., Chem Pharm Bull, 50, (2002), 841.
SUMINO, et al., Chem Pharm Bull, 50, (2002), 1484.
FURUSAWA, et al., Chem Pharm Bull, 53, (2005), 591.
XIE, et al., Chem Pharm Bull, 53, (2005), 1416.
Hou, et al., Journal of Natural Products, 66, (2003), 625.
Wu, et al., Journal of Natural Products, 66, (2003), 1207.
Chang, et al., Journal of Natural Products, 68, (2005), 11.
Kiss, et al., Planta Med, 70, (2004), 919.
Tang, et al., Phytochemistry, 58, (2001), 1251.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Yuan, et al., Chinese J of Pharm Analysis, 30, (2010), 41.
Meng, et al., Chinese J of Pharm Analysis, 30, (2010), 405 |
|---|
|