| Name |
3,4-Dihydroxybenzoic acid Protocatechuic acid |
| Formula |
C7H6O4 |
| Mw |
154.02660868 |
| CAS RN |
99-50-3 |
| C_ID |
C00002668
, 
|
| InChIKey |
YQUVCSBJEUQKSH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C7H6O4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H,(H,10,11) |
| SMILES |
O=C(O)c1ccc(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Cicadidae | Cryptotympana sp. | Ref. |
| Bacteria | Pseudomonadaceae | Pseudomonas putida | Ref. |
| Fungi | Hymenochaetaceae | Inonotus obliquus  | Ref. |
| Fungi | Hymenochaetaceae | Phellinus igniarius  | Ref. |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | Actinidiaceae | Actinidia arguta  | Ref. |
| Plantae | Actinidiaceae | Actinidia callosa var.henryi  | Ref. |
| Plantae | Actinidiaceae | Actinidia chinensis  | Ref. |
| Plantae | Actinidiaceae | Actinidia chrysantha | Ref. |
| Plantae | Actinidiaceae | Actinidia deliciosa  | Ref. |
| Plantae | Actinidiaceae | Actinidia eriantha | Ref. |
| Plantae | Actinidiaceae | Actinidia glaucophylla | Ref. |
| Plantae | Actinidiaceae | Actinidia latifolia | Ref. |
| Plantae | Actinidiaceae | Actinidia polygama  | Ref. |
| Plantae | Actinidiaceae | Actinidia rubricaulis var.coriacea | Ref. |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Falcaria vulgaris | Ref. |
| Plantae | Apiaceae | Ligusticum chuanxiong  | Ref. |
| Plantae | Apiaceae | Ostericum koreanum | Ref. |
| Plantae | Apocynaceae | Cryptolepis sinensis | Ref. |
| Plantae | Aquifoliaceae | Ilex chinensis  | Ref. |
| Plantae | Araceae | Amorphophallus konjac K.Koch  | Ref. |
| Plantae | Araceae | Pinellia ternata  | Ref. |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe berhana | Ref. |
| Plantae | Asphodelaceae | Aloe ferox  | Ref. |
| Plantae | Asphodelaceae | Aloe harlans | Ref. |
| Plantae | Asphodelaceae | Aloe hildebrandtii | Ref. |
| Plantae | Asphodelaceae | Aloe megalacantha | Ref. |
| Plantae | Asphodelaceae | Aloe pulcherrima  | Ref. |
| Plantae | Asphodelaceae | Aloe rivae | Ref. |
| Plantae | Asteraceae | Blumea balsamifera  | Ref. |
| Plantae | Asteraceae | Centaurea bracteata Scop. | Ref. |
| Plantae | Asteraceae | Centaurea pseudoscabiosa subsp.pseudoscabiosa Boiss.et aBuhse | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Cactaceae | Opuntia dillenii HAW.  | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum polyanthum | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Cbotiaceae/Dicksoniaceae | Cibotium barometz  | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Combretaceae | Terminalia catappa  | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Combretaceae | Terminalia nigrovenulosa | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Crassulaceae | Hylotelephium mingjinianum | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Cymodoceaceae | Amphibolis antarctica | Ref. |
| Plantae | Cymodoceaceae | Amphibolis griffithii | Ref. |
| Plantae | Cymodoceaceae | Cymodocea rotundata | Ref. |
| Plantae | Cymodoceaceae | Cymodocea serrulata | Ref. |
| Plantae | Cymodoceaceae | Halodule uninervis | Ref. |
| Plantae | Cymodoceaceae | Halodule wrightii | Ref. |
| Plantae | Cymodoceaceae | Syringodium filiforme | Ref. |
| Plantae | Cymodoceaceae | Syringodium isoetifolium | Ref. |
| Plantae | Cymodoceaceae | Thalassodendron ciliatum | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus L.  | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
| Plantae | Ephedraceae | Ephedra aphylla | Ref. |
| Plantae | Ephedraceae | Ephedra equisetina  | Ref. |
| Plantae | Ericaceae | Erica australis | Ref. |
| Plantae | Ericaceae | Pyrola calliantha  | Ref. |
| Plantae | Eriocaulaceae | Eriocaulon buergerianum | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides Oliver  | Ref. |
| Plantae | Fabaceae | Acacia nilotica  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lespedeza bicolor  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Geraniaceae | Pelargonium sidoides  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Gleicheniaceae | Dicranopteris pedata | Ref. |
| Plantae | Hydrocharitaceae | Halophila engelmannii | Ref. |
| Plantae | Hydrocharitaceae | Halophila hawaiiana | Ref. |
| Plantae | Hydrocharitaceae | Thalassia ciliatum | Ref. |
| Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
| Plantae | Hydrocharitaceae | Thalassia testudinum | Ref. |
| Plantae | Hypoxidaceae | Curculigo pilosa  | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Labiatae | Salvia bowleyana | Ref. |
| Plantae | Labiatae | Salvia bulleyana  | Ref. |
| Plantae | Labiatae | Salvia castanea  | Ref. |
| Plantae | Labiatae | Salvia digitaloides  | Ref. |
| Plantae | Labiatae | Salvia flava  | Ref. |
| Plantae | Labiatae | Salvia miltiorrhiza  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia plebeia  | Ref. |
| Plantae | Labiatae | Salvia prionitis  | Ref. |
| Plantae | Labiatae | Salvia przewalskii  | Ref. |
| Plantae | Labiatae | Salvia sinica | Ref. |
| Plantae | Labiatae | Salvia sonchifolia | Ref. |
| Plantae | Labiatae | Salvia trijuga | Ref. |
| Plantae | Labiatae | Salvia yunnanensis | Ref. |
| Plantae | Lauraceae | Cinnamomum cassia  | Ref. |
| Plantae | Loranthaceae | Taxillus levinei | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Gossypium hirsutum L.  | Ref. |
| Plantae | Malvaceae | Hibiscus sabdariffa L.  | Ref. |
| Plantae | Malvaceae | Theobroma cacao L.  | Ref. |
| Plantae | Meliaceae | Toona ciliata  | Ref. |
| Plantae | Moraceae | Brosimopsis acutifolium | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Myrtaceae | Eucalyptus grandis  | Ref. |
| Plantae | Myrtaceae | Eugenia edulis  | Ref. |
| Plantae | Myrtaceae | Myrciaria cauliflora  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Orchidaceae | Bletilla formosana | Ref. |
| Plantae | Orchidaceae | Bulbophyllum vaginatum | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Palmae | Trachycarpus fortunei  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Picea ajanensis | Ref. |
| Plantae | Pinaceae | Picea koraiensis | Ref. |
| Plantae | Pinaceae | Picea obovata | Ref. |
| Plantae | Pinaceae | Pinus roxburghii  | Ref. |
| Plantae | Pinaceae | Pseudolarix kaempferi Gord.  | Ref. |
| Plantae | Plantaginaceae | Picrorhiza kurrooa | Ref. |
| Plantae | Plantaginaceae | Picrorhiza kurrosa | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Plantaginaceae | Plantago media  | Ref. |
| Plantae | Plantaginaceae | Veronica americana  | Ref. |
| Plantae | Plantaginaceae | Veronica montana | Ref. |
| Plantae | Plantaginaceae | Veronica peregrina L.  | Ref. |
| Plantae | Plantaginaceae | Veronica polita | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Plantaginaceae | Veronica spuria | Ref. |
| Plantae | Poaceae | Oryza sativa cv. Heugjinjubyeo  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Polygonaceae | Fagopyrum spp | Ref. |
| Plantae | Polygonaceae | Fagopyrum spp. | Ref. |
| Plantae | Polygonaceae | Polygonum cuspidatum  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia sheareri | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Ranunculaceae | Actaea racemosa  | Ref. |
| Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
| Plantae | Rhamnaceae | Rhamnus thymifolius | Ref. |
| Plantae | Rosaceae | Cowania mexicana  | Ref. |
| Plantae | Rosaceae | Malus doumeri varl formosana | Ref. |
| Plantae | Rosaceae | Mespilus germanica  | Ref. |
| Plantae | Rosaceae | Rosa canina  | Ref. |
| Plantae | Rubiaceae | Mitragyna rotundifolia | Ref. |
| Plantae | Rutaceae | Zanthoxylum piperitum  | Ref. |
| Plantae | Santalaceae | Viscum articulactum | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Saxifragaceae | Saxifraga stolonifera  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia frutescens | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Typhaceae | Typha angustata  | Ref. |
| Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
| Plantae | Zingiberaceae | Alpinia oxyphylla  | Ref. |
| Plantae | Zosteraceae | Phyllospadix scouleri | Ref. |
| Plantae | Zosteraceae | Zostera capricorni | Ref. |
| Plantae | Zosteraceae | Zostera marina | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Pyrola calliantha | | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Mo, et al., Journal of Natural Products, 67, (2004), 823.
Ma, et al., Journal of Natural Products, 67, (2004), 1598.
LIN, et al., Chem Pharm Bull, 53, (2005), 1111.
QIU, et al., Chem Pharm Bull, 50, (2002), 1507.
Li, et al., Journal of Natural Products, 67, (2004), 437.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Tan, et al., Acta Pharmaceutica Sinica(Yaoxue Xuebao), 29, (1994), 519.
Zhao, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 18, (1993), 226.
Li, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 21, (1996), 34. |
|---|
|