| Name |
3,4-Dihydroxybenzoic acid Protocatechuic acid |
| Formula |
C7H6O4 |
| Mw |
154.02660868 |
| CAS RN |
99-50-3 |
| C_ID |
C00002668
, 
|
| InChIKey |
YQUVCSBJEUQKSH-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C7H6O4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H,(H,10,11) |
| SMILES |
O=C(O)c1ccc(O)c(O)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Cicadidae | Cryptotympana sp. | Ref. |
| Bacteria | Pseudomonadaceae | Pseudomonas putida | Ref. |
| Fungi | Hymenochaetaceae | Inonotus obliquus  | Ref. |
| Fungi | Hymenochaetaceae | Phellinus igniarius  | Ref. |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | Actinidiaceae | Actinidia arguta  | Ref. |
| Plantae | Actinidiaceae | Actinidia callosa var.henryi  | Ref. |
| Plantae | Actinidiaceae | Actinidia chinensis  | Ref. |
| Plantae | Actinidiaceae | Actinidia chrysantha | Ref. |
| Plantae | Actinidiaceae | Actinidia deliciosa  | Ref. |
| Plantae | Actinidiaceae | Actinidia eriantha | Ref. |
| Plantae | Actinidiaceae | Actinidia glaucophylla | Ref. |
| Plantae | Actinidiaceae | Actinidia latifolia | Ref. |
| Plantae | Actinidiaceae | Actinidia polygama  | Ref. |
| Plantae | Actinidiaceae | Actinidia rubricaulis var.coriacea | Ref. |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Falcaria vulgaris | Ref. |
| Plantae | Apiaceae | Ligusticum chuanxiong  | Ref. |
| Plantae | Apiaceae | Ostericum koreanum | Ref. |
| Plantae | Apocynaceae | Cryptolepis sinensis | Ref. |
| Plantae | Aquifoliaceae | Ilex chinensis  | Ref. |
| Plantae | Araceae | Amorphophallus konjac K.Koch  | Ref. |
| Plantae | Araceae | Pinellia ternata  | Ref. |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Aloe berhana | Ref. |
| Plantae | Asphodelaceae | Aloe ferox  | Ref. |
| Plantae | Asphodelaceae | Aloe harlans | Ref. |
| Plantae | Asphodelaceae | Aloe hildebrandtii | Ref. |
| Plantae | Asphodelaceae | Aloe megalacantha | Ref. |
| Plantae | Asphodelaceae | Aloe pulcherrima  | Ref. |
| Plantae | Asphodelaceae | Aloe rivae | Ref. |
| Plantae | Asteraceae | Blumea balsamifera  | Ref. |
| Plantae | Asteraceae | Centaurea bracteata Scop. | Ref. |
| Plantae | Asteraceae | Centaurea pseudoscabiosa subsp.pseudoscabiosa Boiss.et aBuhse | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Cactaceae | Opuntia dillenii HAW.  | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum polyanthum | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Cbotiaceae/Dicksoniaceae | Cibotium barometz  | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Combretaceae | Terminalia catappa  | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Combretaceae | Terminalia nigrovenulosa | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Crassulaceae | Hylotelephium mingjinianum | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Cymodoceaceae | Amphibolis antarctica | Ref. |
| Plantae | Cymodoceaceae | Amphibolis griffithii | Ref. |
| Plantae | Cymodoceaceae | Cymodocea rotundata | Ref. |
| Plantae | Cymodoceaceae | Cymodocea serrulata | Ref. |
| Plantae | Cymodoceaceae | Halodule uninervis | Ref. |
| Plantae | Cymodoceaceae | Halodule wrightii | Ref. |
| Plantae | Cymodoceaceae | Syringodium filiforme | Ref. |
| Plantae | Cymodoceaceae | Syringodium isoetifolium | Ref. |
| Plantae | Cymodoceaceae | Thalassodendron ciliatum | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus L.  | Ref. |
| Plantae | Elaeagnaceae | Hippophae rhamnoides  | Ref. |
| Plantae | Ephedraceae | Ephedra aphylla | Ref. |
| Plantae | Ephedraceae | Ephedra equisetina  | Ref. |
| Plantae | Ericaceae | Erica australis | Ref. |
| Plantae | Ericaceae | Pyrola calliantha  | Ref. |
| Plantae | Eriocaulaceae | Eriocaulon buergerianum | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides Oliver  | Ref. |
| Plantae | Fabaceae | Acacia nilotica  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lespedeza bicolor  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Geraniaceae | Pelargonium sidoides  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Gleicheniaceae | Dicranopteris pedata | Ref. |
| Plantae | Hydrocharitaceae | Halophila engelmannii | Ref. |
| Plantae | Hydrocharitaceae | Halophila hawaiiana | Ref. |
| Plantae | Hydrocharitaceae | Thalassia ciliatum | Ref. |
| Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
| Plantae | Hydrocharitaceae | Thalassia testudinum | Ref. |
| Plantae | Hypoxidaceae | Curculigo pilosa  | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Labiatae | Salvia bowleyana | Ref. |
| Plantae | Labiatae | Salvia bulleyana  | Ref. |
| Plantae | Labiatae | Salvia castanea  | Ref. |
| Plantae | Labiatae | Salvia digitaloides  | Ref. |
| Plantae | Labiatae | Salvia flava  | Ref. |
| Plantae | Labiatae | Salvia miltiorrhiza  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia plebeia  | Ref. |
| Plantae | Labiatae | Salvia prionitis  | Ref. |
| Plantae | Labiatae | Salvia przewalskii  | Ref. |
| Plantae | Labiatae | Salvia sinica | Ref. |
| Plantae | Labiatae | Salvia sonchifolia | Ref. |
| Plantae | Labiatae | Salvia trijuga | Ref. |
| Plantae | Labiatae | Salvia yunnanensis | Ref. |
| Plantae | Lauraceae | Cinnamomum cassia  | Ref. |
| Plantae | Loranthaceae | Taxillus levinei | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Gossypium hirsutum L.  | Ref. |
| Plantae | Malvaceae | Hibiscus sabdariffa L.  | Ref. |
| Plantae | Malvaceae | Theobroma cacao L.  | Ref. |
| Plantae | Meliaceae | Toona ciliata  | Ref. |
| Plantae | Moraceae | Brosimopsis acutifolium | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Myrtaceae | Eucalyptus grandis  | Ref. |
| Plantae | Myrtaceae | Eugenia edulis  | Ref. |
| Plantae | Myrtaceae | Myrciaria cauliflora  | Ref. |
| Plantae | Myrtaceae | Psidium cattleyanum | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Myrtaceae | Syzygium cumini  | Ref. |
| Plantae | Orchidaceae | Bletilla formosana | Ref. |
| Plantae | Orchidaceae | Bulbophyllum vaginatum | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Palmae | Trachycarpus fortunei  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus emblica  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Picea ajanensis | Ref. |
| Plantae | Pinaceae | Picea koraiensis | Ref. |
| Plantae | Pinaceae | Picea obovata | Ref. |
| Plantae | Pinaceae | Pinus roxburghii  | Ref. |
| Plantae | Pinaceae | Pseudolarix kaempferi Gord.  | Ref. |
| Plantae | Plantaginaceae | Picrorhiza kurrooa | Ref. |
| Plantae | Plantaginaceae | Picrorhiza kurrosa | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Plantaginaceae | Plantago media  | Ref. |
| Plantae | Plantaginaceae | Veronica americana  | Ref. |
| Plantae | Plantaginaceae | Veronica montana | Ref. |
| Plantae | Plantaginaceae | Veronica peregrina L.  | Ref. |
| Plantae | Plantaginaceae | Veronica polita | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Plantaginaceae | Veronica spuria | Ref. |
| Plantae | Poaceae | Oryza sativa cv. Heugjinjubyeo  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Polygonaceae | Fagopyrum spp | Ref. |
| Plantae | Polygonaceae | Fagopyrum spp. | Ref. |
| Plantae | Polygonaceae | Polygonum cuspidatum  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia sheareri | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Ranunculaceae | Actaea racemosa  | Ref. |
| Plantae | Rhamnaceae | Rhamnus disperma | Ref. |
| Plantae | Rhamnaceae | Rhamnus thymifolius | Ref. |
| Plantae | Rosaceae | Cowania mexicana  | Ref. |
| Plantae | Rosaceae | Malus doumeri varl formosana | Ref. |
| Plantae | Rosaceae | Mespilus germanica  | Ref. |
| Plantae | Rosaceae | Rosa canina  | Ref. |
| Plantae | Rubiaceae | Mitragyna rotundifolia | Ref. |
| Plantae | Rutaceae | Zanthoxylum piperitum  | Ref. |
| Plantae | Santalaceae | Viscum articulactum | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Saxifragaceae | Saxifraga stolonifera  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia frutescens | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Typhaceae | Typha angustata  | Ref. |
| Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
| Plantae | Zingiberaceae | Alpinia oxyphylla  | Ref. |
| Plantae | Zosteraceae | Phyllospadix scouleri | Ref. |
| Plantae | Zosteraceae | Zostera capricorni | Ref. |
| Plantae | Zosteraceae | Zostera marina | Ref. |
| - | - | Campomanesia xanthocarpa | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Myrcianthes pungens | Ref. |
|
|
zoom in
| Organism | Terminalia nigrovenulosa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|