| Name |
Liquiritigenin |
| Formula |
C15H12O4 |
| Mw |
256.07355887 |
| CAS RN |
578-86-9 |
| C_ID |
C00000977
, 
|
| InChIKey |
FURUXTVZLHCCNA-YQTOOIBONA-N |
| InChICode |
InChI=1S/C15H12O4/c16-10-3-1-9(2-4-10)14-8-13(18)12-6-5-11(17)7-15(12)19-14/h1-7,14,16-17H,8H2/t14-/m0/s1 |
| SMILES |
O=C1C[C@@H](c2ccc(O)cc2)Oc2cc(O)ccc21 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaryllidaceae | Crinum bulbispermum Milne | Ref. |
| Plantae | Amaryllidaceae | Pancratium maritimum L. | Ref. |
| Plantae | Berberidaceae | Epimedium koreanum  | Ref. |
| Plantae | Celastraceae | Tripterygium wilfordii  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Dracaenaceae | Dracaena draco  | Ref. |
| Plantae | Fabaceae | Baptisia lecontei | Ref. |
| Plantae | Fabaceae | Bauhinia guianensis  | Ref. |
| Plantae | Fabaceae | Centrolobium robustum | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Dalbergia ecastaphyllum  | Ref. |
| Plantae | Fabaceae | Dalbergia latifolia  | Ref. |
| Plantae | Fabaceae | Dalbergia odorifera  | Ref. |
| Plantae | Fabaceae | Dalbergia sissoides  | Ref. |
| Plantae | Fabaceae | Dalbergia stevensonii | Ref. |
| Plantae | Fabaceae | Diplotropis purpurea | Ref. |
| Plantae | Fabaceae | Echinosophora koreensis | Ref. |
| Plantae | Fabaceae | Erythrina fusca  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza echinata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza pallidiflora | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lespedeza cyrtobotrya | Ref. |
| Plantae | Fabaceae | Medicago lupulina  | Ref. |
| Plantae | Fabaceae | Medicago radiata | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Melilotus altissimus  | Ref. |
| Plantae | Fabaceae | Melilotus dentatus | Ref. |
| Plantae | Fabaceae | Melilotus elegans | Ref. |
| Plantae | Fabaceae | Melilotus infestus | Ref. |
| Plantae | Fabaceae | Melilotus italica | Ref. |
| Plantae | Fabaceae | Melilotus messanensis | Ref. |
| Plantae | Fabaceae | Melilotus neapolitanus | Ref. |
| Plantae | Fabaceae | Melilotus officinalis subsp. suaveolens  | Ref. |
| Plantae | Fabaceae | Melilotus polonicus | Ref. |
| Plantae | Fabaceae | Melilotus tauricus | Ref. |
| Plantae | Fabaceae | Melilotus wolgicus | Ref. |
| Plantae | Fabaceae | Onobrychis sp. | Ref. |
| Plantae | Fabaceae | Onobrychis viciifolia Scop.  | Ref. |
| Plantae | Fabaceae | Peltogyne paniculata | Ref. |
| Plantae | Fabaceae | Peltogyne sp. | Ref. |
| Plantae | Fabaceae | Peltogyne venosa | Ref. |
| Plantae | Fabaceae | Pericopsis elata  | Ref. |
| Plantae | Fabaceae | Pericopsis mooniana | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Pterocarpus angolensis  | Ref. |
| Plantae | Fabaceae | Pterocarpus macrocarpus | Ref. |
| Plantae | Fabaceae | Pterocarpus marsupium  | Ref. |
| Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
| Plantae | Fabaceae | Pueraria lobata  | Ref. |
| Plantae | Fabaceae | Robinia pseudoacacia  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora gypsophila | Ref. |
| Plantae | Fabaceae | Sophora secundiflora  | Ref. |
| Plantae | Fabaceae | Spatholobus suberectus Dunn  | Ref. |
| Plantae | Fabaceae | Trifolium subterraneum  | Ref. |
| Plantae | Fabaceae | Umtiza listerana | Ref. |
| Plantae | Moraceae | Brosimum acutifolium  | Ref. |
| Plantae | Rutaceae | Clausena excavata  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Datura innoxia  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| - | - | Moghania philippinensis | Ref. |
|
|
zoom in
| Organism | Onobrychis sp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 289,Flavanones and dihydroflavonols
Shinoda,J.Ber.Dtsch.Chem.Ges.,67B,(1934),434 |
|---|
|