| Name |
Scutellarein 6-Hydroxyapigenin |
| Formula |
C15H10O6 |
| Mw |
286.04773805 |
| CAS RN |
529-53-3 |
| C_ID |
C00003834
, 
|
| InChIKey |
JVXZRQGOGOXCEC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)11-5-9(17)13-12(21-11)6-10(18)14(19)15(13)20/h1-6,16,18-20H |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2cc(O)c(O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Asphodeline globifera | Ref. |
| Plantae | Asteraceae | Centaurea jacea | Ref. |
| Plantae | Asteraceae | Pulicaria dysenterica  | Ref. |
| Plantae | Bignoniaceae | Millingtonia hortensis  | Ref. |
| Plantae | Bignoniaceae | Oroxylum indicum  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia andamanica | Ref. |
| Plantae | Fabaceae | Baptisia calycosa | Ref. |
| Plantae | Labiatae | Clerodendrum phlomidis  | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria barbata  | Ref. |
| Plantae | Labiatae | Scutellaria indica | Ref. |
| Plantae | Labiatae | Scutellaria rivularis  | Ref. |
| Plantae | Labiatae | Scutellaria scandens | Ref. |
| Plantae | Labiatae | Scutellaria spp. | Ref. |
| Plantae | Plantaginaceae | Scoparia dulcis  | Ref. |
| Plantae | Polygonaceae | Polygonum hydropiper L.  | Ref. |
| Plantae | Polygonaceae | Polygonum viscosum | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Verbenaceae | Clerodendron fragrans | Ref. |
| Plantae | Verbenaceae | Clerodendron phlomoides | Ref. |
| Plantae | Verbenaceae | Clerodendron serratum  | Ref. |
| Plantae | Verbenaceae | Duranta plumieri  | Ref. |
| Plantae | Verbenaceae | Duranta repens | Ref. |
| - | - | Scutettaria baicalensis | Ref. |
|
|
zoom in
| Organism | Oroxylum indicum | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 2.Flavones, John Wiley & Son
Harbone, Comparative Biochemisty of the Flavonoids,(1965),39, Academic Press
Subramanian,Phytochem.11,(1972),3095 |
|---|
|