| Name |
Citroside A (-)-Citroside A |
| Formula |
C19H30O8 |
| Mw |
386.19406794 |
| CAS RN |
120330-44-1 |
| C_ID |
C00029980
, 
|
| InChIKey |
XTODSGVDHGMKSN-TYTSJZHHNA-N |
| InChICode |
InChI=1S/C19H30O8/c1-10(21)5-6-13-18(2,3)7-11(22)8-19(13,4)27-17-16(25)15(24)14(23)12(9-20)26-17/h5,11-12,14-17,20,22-25H,7-9H2,1-4H3/t6-,11-,12+,14+,15-,16+,17-,19+/m0/s1 |
| SMILES |
CC(=O)C=C=C1C(C)(C)C[C@H](O)C[C@@]1(C)O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Cruciferae | Brassica rapa  | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum cuneatum | Ref. |
| Plantae | Euphorbiaceae | Euphorbia helioscopia  | Ref. |
| Plantae | Fabaceae | Derris trifoliata Lour.  | Ref. |
| Plantae | Labiatae | Phlomis spinidens | Ref. |
| Plantae | Labiatae | Stachys lanata | Ref. |
| Plantae | Lauraceae | Laurus nobilis  | Ref. |
| Plantae | Leeaceae | Leea thorelii Gagnep | Ref. |
| Plantae | Rosaceae | Eriobotrya japonica  | Ref. |
| Plantae | Rubiaceae | Lasianthus wallichii | Ref. |
| Plantae | Rutaceae | Citrus unshiu  | Ref. |
| Plantae | Sabiaceae | Meliosma sp. | Ref. |
| Plantae | Zygophyllaceae | Tribulus parvispinus Presl | Ref. |
|
|
zoom in
| Organism | Erythroxylum cuneatum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|