| Name |
Scutellarein 6-Hydroxyapigenin |
| Formula |
C15H10O6 |
| Mw |
286.04773805 |
| CAS RN |
529-53-3 |
| C_ID |
C00003834
, 
|
| InChIKey |
JVXZRQGOGOXCEC-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O6/c16-8-3-1-7(2-4-8)11-5-9(17)13-12(21-11)6-10(18)14(19)15(13)20/h1-6,16,18-20H |
| SMILES |
O=c1cc(-c2ccc(O)cc2)oc2cc(O)c(O)c(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asphodelaceae | Asphodeline globifera | Ref. |
| Plantae | Asteraceae | Centaurea jacea | Ref. |
| Plantae | Asteraceae | Pulicaria dysenterica  | Ref. |
| Plantae | Bignoniaceae | Millingtonia hortensis  | Ref. |
| Plantae | Bignoniaceae | Oroxylum indicum  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia andamanica | Ref. |
| Plantae | Fabaceae | Baptisia calycosa | Ref. |
| Plantae | Labiatae | Clerodendrum phlomidis  | Ref. |
| Plantae | Labiatae | Origanum majorana  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Scutellaria barbata  | Ref. |
| Plantae | Labiatae | Scutellaria indica | Ref. |
| Plantae | Labiatae | Scutellaria rivularis  | Ref. |
| Plantae | Labiatae | Scutellaria scandens | Ref. |
| Plantae | Labiatae | Scutellaria spp. | Ref. |
| Plantae | Plantaginaceae | Scoparia dulcis  | Ref. |
| Plantae | Polygonaceae | Polygonum hydropiper L.  | Ref. |
| Plantae | Polygonaceae | Polygonum viscosum | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Verbenaceae | Clerodendron fragrans | Ref. |
| Plantae | Verbenaceae | Clerodendron phlomoides | Ref. |
| Plantae | Verbenaceae | Clerodendron serratum  | Ref. |
| Plantae | Verbenaceae | Duranta plumieri  | Ref. |
| Plantae | Verbenaceae | Duranta repens | Ref. |
| - | - | Scutettaria baicalensis | Ref. |
|
|
zoom in
| Organism | Millingtonia hortensis | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998) |
|---|
|