| Name |
Ferulic acid 3-(4-Hydroxy-3-methoxyphenyl)-2-propenoic acid Ferulate |
| Formula |
C10H10O4 |
| Mw |
194.05790881 |
| CAS RN |
1135-24-6 |
| C_ID |
C00002743
, 
|
| InChIKey |
KSEBMYQBYZTDHS-HWKANZROSA-N |
| InChICode |
InChI=1S/C10H10O4/c1-14-9-6-7(2-4-8(9)11)3-5-10(12)13/h2-6,11H,1H3,(H,12,13)/b5-3+ |
| SMILES |
COc1cc(/C=C/C(=O)O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Pseudomonadaceae | Pseudomonas pseudoalcaligenes | Ref. |
| Plantae | Acanthaceae | Andrographis paniculata  | Ref. |
| Plantae | Acanthaceae | Strobilanthes crispus  | Ref. |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Alliaceae | Allium obliquum  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Alliaceae | Allium Sativum | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Angelica acutiloba (Hokkado)  | Ref. |
| Plantae | Apiaceae | Angelica acutiloba (Toyama)  | Ref. |
| Plantae | Apiaceae | Angelica furcijuga KITAGAWA | Ref. |
| Plantae | Apiaceae | Angelica gigas  | Ref. |
| Plantae | Apiaceae | Angelica sinensis  | Ref. |
| Plantae | Apiaceae | Falcaria vulgaris | Ref. |
| Plantae | Apiaceae | Ferula assa-foetida  | Ref. |
| Plantae | Apiaceae | Ferula assafoetida  | Ref. |
| Plantae | Apiaceae | Ferula foetida  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Glehnia littoralis  | Ref. |
| Plantae | Apiaceae | Levisticum officinale  | Ref. |
| Plantae | Apiaceae | Ligusticum brachylobum  | Ref. |
| Plantae | Apiaceae | Ligusticum chuanxiong HORT.  | Ref. |
| Plantae | Apiaceae | Ligusticum jeholense | Ref. |
| Plantae | Apiaceae | Ligusticum multivittatum | Ref. |
| Plantae | Apiaceae | Ligusticum sinense  | Ref. |
| Plantae | Apiaceae | Ligusticum sinense cv.chaxiong  | Ref. |
| Plantae | Apiaceae | Notopterygium incisum  | Ref. |
| Plantae | Apiaceae | Opopanax chironicum | Ref. |
| Plantae | Apocynaceae | Cynanchum thesioides  | Ref. |
| Plantae | Apocynaceae | Periploca graeca  | Ref. |
| Plantae | Aquifoliaceae | Ilex paraguariensis  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia heterophylla Hemsl  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia manshuriensis | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Anthemis nobilis  | Ref. |
| Plantae | Asteraceae | Conyza schimperi | Ref. |
| Plantae | Asteraceae | Eupatorium adenophorum  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Petasites formosanus  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Taraxacum officinale  | Ref. |
| Plantae | Bignoniaceae | Catalpa ovata  | Ref. |
| Plantae | Boraginaceae | Cordia macleodii | Ref. |
| Plantae | Bromeliaceae | Ananas comosus  | Ref. |
| Plantae | Cactaceae | Opuntia dellenii | Ref. |
| Plantae | Cactaceae | Opuntia ficus-indica var.saboten  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Codonopsis pilosula  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Capparaceae | Capparis spinosa  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllaceae | Arenaria kansuensis var.ovatipeatala | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Combretaceae | Terminalia catappa  | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Combretaceae | Terminalia nigrovenulosa | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Commelinaceae | Dichorisandra thyrsiflora | Ref. |
| Plantae | Crassulaceae | Sedum takesimense Nakai | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea L. ssp. Botrytis  | Ref. |
| Plantae | Cruciferae | Isatis tinctoria  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Citrullus colocynthis  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Cymodoceaceae | Amphibolis antarctica | Ref. |
| Plantae | Cymodoceaceae | Amphibolis griffithii | Ref. |
| Plantae | Cymodoceaceae | Cymodocea rotundata | Ref. |
| Plantae | Cymodoceaceae | Cymodocea serrulata | Ref. |
| Plantae | Cymodoceaceae | Halodule uninervis | Ref. |
| Plantae | Cymodoceaceae | Halodule wrightii | Ref. |
| Plantae | Cymodoceaceae | Syringodium filiforme | Ref. |
| Plantae | Cymodoceaceae | Syringodium isoetifolium | Ref. |
| Plantae | Cymodoceaceae | Thalassodendron ciliatum | Ref. |
| Plantae | Cyperaceae | Cyperus papyrus  | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus L.  | Ref. |
| Plantae | Equisetaceae | Equisetum hiemale | Ref. |
| Plantae | Eriocaulaceae | Eriocaulon buergerianum | Ref. |
| Plantae | Euphorbiaceae | Macaranga triloba | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lens esculenta  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fumariaceae | Corydalis decumbens  | Ref. |
| Plantae | Fumariaceae | Fumaria capreolata  | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Gesneriaceae | Aeschynanthus bracteatus  | Ref. |
| Plantae | Haemodoraceae | Anigozanthos preissii | Ref. |
| Plantae | Hydrocharitaceae | Halophila engelmannii | Ref. |
| Plantae | Hydrocharitaceae | Thalassia ciliatum | Ref. |
| Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
| Plantae | Hydrocharitaceae | Thalassia testudinum | Ref. |
| Plantae | Juncaceae | Juncus inflexus | Ref. |
| Plantae | Labiatae | Ajuga iva  | Ref. |
| Plantae | Labiatae | Ocimum sanctum  | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus comosus | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Lauraceae | Cinnamomum subavenium | Ref. |
| Plantae | Lauraceae | Cinnamomum tenuifolium | Ref. |
| Plantae | Liliaceae | Notholirion hyacinthinum | Ref. |
| Plantae | Linaceae | Linum austriacum subsp.glaucescens | Ref. |
| Plantae | Linaceae | Linum hirsutum subsp.anatolicum | Ref. |
| Plantae | Linaceae | Linum tenuifolium  | Ref. |
| Plantae | Lycopodiaceae | Huperzia selago | Ref. |
| Plantae | Lycopodiaceae | Lycopodium japonicum | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
| Plantae | Malvaceae | Malva silvestris  | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Meliaceae | Toona ciliata  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Orchidaceae | Gymnadenia conopsea R.BR. | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Palmae | Phoenix canariensis  | Ref. |
| Plantae | Pinaceae | Picea ajanensis | Ref. |
| Plantae | Pinaceae | Picea obovata | Ref. |
| Plantae | Pinaceae | Pinus laricio | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Pinaceae | Pinus spp.  | Ref. |
| Plantae | Pinaceae | Tsuga heterophylla  | Ref. |
| Plantae | Plantaginaceae | Picrorhiza kurrooa | Ref. |
| Plantae | Plantaginaceae | Picrorhiza scrophulariiflora  | Ref. |
| Plantae | Plantaginaceae | Plantago lanceolata  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Plantago media  | Ref. |
| Plantae | Plantaginaceae | Veronica officinalis  | Ref. |
| Plantae | Plantaginaceae | Veronica orchidea | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Plantaginaceae | Veronica teucrium | Ref. |
| Plantae | Poaceae | Gynerium sagittatum  | Ref. |
| Plantae | Poaceae | Maize bran | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Phleum pratense  | Ref. |
| Plantae | Poaceae | Phyllostachys edulis | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Polygonaceae | Calligonum leucocladum | Ref. |
| Plantae | Posidoniaceae | Posidonia australis | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Ranunculaceae | Actaea racemosa  | Ref. |
| Plantae | Ranunculaceae | Cimicifuga dahurica  | Ref. |
| Plantae | Ranunculaceae | Cimicifuga foetida  | Ref. |
| Plantae | Ranunculaceae | Cimicifuga heracleifolia  | Ref. |
| Plantae | Ranunculaceae | Cimicifuga racemosa  | Ref. |
| Plantae | Ranunculaceae | Coptis chinensis  | Ref. |
| Plantae | Ranunculaceae | Ranunculus baudotii | Ref. |
| Plantae | Resedaceae | Reseda muricata C.Presl. | Ref. |
| Plantae | Restionaceae | Baloskion tetraphyllum | Ref. |
| Plantae | Restionaceae | Elegia capensis | Ref. |
| Plantae | Rhamnaceae | Colubrina faralaotra subsp.trichocarpa. | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba var.spinosa  | Ref. |
| Plantae | Rosaceae | Aruncus diocus | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus limonia  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Citrus sudachi  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Salicaceae | Populus pseudosimonii | Ref. |
| Plantae | Salicaceae | Populus spp. | Ref. |
| Plantae | Salicaceae | Populus trichocarpa | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia buergeriana | Ref. |
| Plantae | Simaroubaceae | Ailanthus integrifolia | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum acaule | Ref. |
| Plantae | Solanaceae | Solanum bulbocastanum | Ref. |
| Plantae | Solanaceae | Solanum canasense | Ref. |
| Plantae | Solanaceae | Solanum cardiophyllum | Ref. |
| Plantae | Solanaceae | Solanum chacoense | Ref. |
| Plantae | Solanaceae | Solanum commersonii  | Ref. |
| Plantae | Solanaceae | Solanum fendleri  | Ref. |
| Plantae | Solanaceae | Solanum hougasii | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum multidissectum | Ref. |
| Plantae | Solanaceae | Solanum pinnacritisectum | Ref. |
| Plantae | Solanaceae | Solanum stoloniferum | Ref. |
| Plantae | Solanaceae | Solanum tarijense | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Strelitziaceae | Strelitzia reginae  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Typhaceae | Typha orientalis  | Ref. |
| Plantae | Typhaceae/Sparganiaceae | Sparganium stoloniferum | Ref. |
| Plantae | Urticaceae | Urtica dioica  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana laxiflora | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Vittariaceae | Vittaria anguste-elongata | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Hedychium gardnerianum | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| Plantae | Zosteraceae | Phyllospadix scouleri | Ref. |
| Plantae | Zosteraceae | Phyllospadix torreyi | Ref. |
| Plantae | Zosteraceae | Zostera capricorni | Ref. |
| Plantae | Zosteraceae | Zostera marina | Ref. |
| Plantae | Zygophyllaceae | Larrea divaricata  | Ref. |
| Plantae | Zygophyllaceae | Tribulus terrestris  | Ref. |
| - | - | Aganosma caryophyllata | Ref. |
| - | - | Antitoxicum scanden | Ref. |
| - | - | Bergera koenegii | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Conioselium vaginatum | Ref. |
| - | - | Equsetum arvense | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Scrophularis sambucifolia | Ref. |
| - | - | Siegesbeckia orientalis var.glabrescens  | Ref. |
| - | - | Wachendorfa thyrsiflora | Ref. |
|
|
zoom in
| Organism | Ligusticum sinense cv.chaxiong | | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Gu, et al., Planta Med, 70, (2004), 509.
Kinghorn, et al., Planta Med, 70, (2004), 691.
Wu, et al., Journal of Natural Products, 66, (2003), 996.
MATSUDA, et al., Chem Pharm Bull, 53, (2005), 387.
QIU, et al., Chem Pharm Bull, 50, (2002), 1507.
YUAN, et al., Chem Pharm Bull, 50, (2002), 73.
Kim, et al., Phytochemistry, 54, (2000), 503.
Wu, et al., Chem Pharm Bull, 53, (2005), 56.
Wu, et al., Phytochemistry, 52, (1999), 901.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Tu, et al., Acta Pharmaceutica Sinica(Yaoxue Xuebao), 34, (1999), 39.
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Luo, et al., Chinese Pharmaceutical Journal(Zhongguo Yaoxue Zazhi), 29, (1994), 714.
Fu, et al., Chinese Pharmaceutical Journal(Zhongguo Yaoxue Zazhi), 33, (1998), 140.
Sun, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 19, (1994), 99.
Xiao, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 19, (1994), 421.
Liao, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 19, (1994), 612.
Wang, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 23, (1998), 167.
Ling, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 23, (1998), 232. |
|---|
|