| Name |
Campesterol 24alpha-Methylcholesterol (24R)24-Methylcholest-5-en-3beta-ol |
| Formula |
C28H48O |
| Mw |
400.37051615 |
| CAS RN |
474-62-4 |
| C_ID |
C00003647
, 
|
| InChIKey |
SGNBVLSWZMBQTH-RWVZYBNDNA-N |
| InChICode |
InChI=1S/C28H48O/c1-18(2)19(3)7-8-20(4)24-11-12-25-23-10-9-21-17-22(29)13-15-27(21,5)26(23)14-16-28(24,25)6/h9,18-20,22-26,29H,7-8,10-17H2,1-6H3/t19-,20-,22+,23+,24-,25+,26+,27+,28-/m1/s1 |
| SMILES |
CC(C)[C@H](C)CC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Amoebozoa | Physaridae | Physarum polycephalum | Ref. |
| Fungi | Acaulosporaceae | Acaulospora laevis | Ref. |
| Fungi | Blastocladiaceae | Allomyces macrogynus | Ref. |
| Fungi | Glomeraceae | Glomus mosseae | Ref. |
| Fungi | Nectriaceae | Fusarium sporotrichioides | Ref. |
| Plantae | Acanthaceae | Ruellia tuberosa  | Ref. |
| Plantae | Adoxaceae | Sambucus canadensis  | Ref. |
| Plantae | Adoxaceae | Sambucus nigra  | Ref. |
| Plantae | Alliaceae | Allium obliquum  | Ref. |
| Plantae | Amaranthaceae | Blutaparon portulacoides | Ref. |
| Plantae | Amaranthaceae | Gomphrena celosioides | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asphodelaceae | Asphodelus albus  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Senecio viravira | Ref. |
| Plantae | Asteraceae | Xanthium strumarium  | Ref. |
| Plantae | Betulaceae | Corylus avellana  | Ref. |
| Plantae | Betulaceae | Corylus maxima  | Ref. |
| Plantae | Boraginaceae | Heliotropium indicum  | Ref. |
| Plantae | Clusiaceae | Pentaphalangium solomonse Warb. | Ref. |
| Plantae | Crassulaceae | Kalanchoe spathulata | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica campestris L.  | Ref. |
| Plantae | Cruciferae | Brassica napa | Ref. |
| Plantae | Cruciferae | Brassica napus  | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Brassica rapa L.  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Cruciferae | Erysimum carniolicum | Ref. |
| Plantae | Cucurbitaceae | Cucurbita sp.  | Ref. |
| Plantae | Cucurbitaceae | Trichosanthes kirilowii  | Ref. |
| Plantae | Cymodoceaceae | Cymodocea serrulata | Ref. |
| Plantae | Cymodoceaceae | Halodule uninervis | Ref. |
| Plantae | Dioscoreaceae | Dioscorea cyphocarpa | Ref. |
| Plantae | Dioscoreaceae | Tamus communis L.  | Ref. |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Euphorbiaceae | Aleurites fordii Hemsl. | Ref. |
| Plantae | Euphorbiaceae | Croton urucurana Baill. | Ref. |
| Plantae | Euphorbiaceae | Euphorbia indica  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lathyris  | Ref. |
| Plantae | Fabaceae | Astragalus glycyphyllos  | Ref. |
| Plantae | Fabaceae | Bauhinia candicans | Ref. |
| Plantae | Fabaceae | Bauhinia vahlii L.  | Ref. |
| Plantae | Fabaceae | Erythrina arborescens Roxb. | Ref. |
| Plantae | Fabaceae | Glycine ma | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Prosopis spicigera  | Ref. |
| Plantae | Gentianaceae | Gentiana lutea L.  | Ref. |
| Plantae | Hydrocharitaceae | Enhalus acoroides | Ref. |
| Plantae | Hydrocharitaceae | Halophila ovalis | Ref. |
| Plantae | Hydrocharitaceae | Halophila ovata | Ref. |
| Plantae | Hydrocharitaceae | Halophila spinulosa | Ref. |
| Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
| Plantae | Hypericaceae | Hypericum carinatum | Ref. |
| Plantae | Jubulaceae | Frullania monocera | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Labiatae | Sideritis argosphacelus var. spicata | Ref. |
| Plantae | Labiatae | Sideritis candicans var.eriocephala | Ref. |
| Plantae | Labiatae | Sideritis discolor | Ref. |
| Plantae | Labiatae | Sideritis kuegleriana | Ref. |
| Plantae | Labiatae | Sideritis lotsyi | Ref. |
| Plantae | Labiatae | Sideritis lotsyi var. mascaensis | Ref. |
| Plantae | Labiatae | Sideritis soluta | Ref. |
| Plantae | Labiatae | Sideritis tenoi | Ref. |
| Plantae | Lauraceae | Litsea japonica | Ref. |
| Plantae | Lauraceae | Neolitsea aciculata | Ref. |
| Plantae | Longaniaceae | Strychnos dolychothyrsa | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Malva parviflora  | Ref. |
| Plantae | Malvaceae | Sida rhombifolia  | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Meliaceae | Khaya ivorensis  | Ref. |
| Plantae | Meliaceae | Khaya senegalensis L.  | Ref. |
| Plantae | Myrtaceae | Syzygium aromaticum  | Ref. |
| Plantae | Orchidaceae | Sarcophyton crassocaule | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Plantaginaceae | Adenosma caeruleum | Ref. |
| Plantae | Plantaginaceae | Digitalis lanata Ehrh.  | Ref. |
| Plantae | Plantaginaceae | Veronica officinalis  | Ref. |
| Plantae | Plantaginaceae | Veronica orchidea | Ref. |
| Plantae | Plantaginaceae | Veronica teucrium | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Triticum spp | Ref. |
| Plantae | Poaceae | Triticum spp. | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Rubiaceae | Paederia foetida  | Ref. |
| Plantae | Ruppiaceae | Ruppia maritima | Ref. |
| Plantae | Rutaceae | Fagara tessmannii Engl. | Ref. |
| Plantae | Rutaceae | Melicope semecarpifolia | Ref. |
| Plantae | Rutaceae | Zanthoxylum wutaiense | Ref. |
| Plantae | Sapindaceae | Schleichera trijuga  | Ref. |
| Plantae | Solanaceae | Nicotiana benthamiana  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum chacoense Bitt. | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Solanaceae | Solanum xanthocarpum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Taxaceae | Taxus cuspidata  | Ref. |
| Plantae | Urticaceae | Boehmeria holosericea | Ref. |
| Plantae | Urticaceae | Boehmeria tricuspis | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Chorisia insignis | Ref. |
| - | - | Chorisia speciosa | Ref. |
| - | - | Crotone hieronymi | Ref. |
| - | - | Hyphochytrium catenoides | Ref. |
| - | - | Libanotis intermedia | Ref. |
| - | - | Monoblepharella sp. | Ref. |
| - | - | Placopecten magellanicus  | Ref. |
| - | - | Rhizidiomyces apophysatus | Ref. |
| - | - | Spizellomyces punctatum | Ref. |
| - | - | Strachybotrys alternans | Ref. |
|
|
zoom in
| Organism | Allomyces macrogynus | | Reference | Lenfant,Phytochem.,9,(1970),2529-2535
Nes,Analysis of Sterols and Other Biologically Significant Steroids,Academic Press Inc.,New York,Ny,341 pp.(1989)
Turner,Fungal Metabolites II,Academic Press,New York,NY,631 pp.(1983)
Weete,Structure and Function |
|---|
|