| Name |
Isopimpinellin |
| Formula |
C13H10O5 |
| Mw |
246.05282343 |
| CAS RN |
482-27-9 |
| C_ID |
C00000583
, 
|
| InChIKey |
DFMAXQKDIGCMTL-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C13H10O5/c1-15-10-7-3-4-9(14)18-12(7)13(16-2)11-8(10)5-6-17-11/h3-6H,1-2H3 |
| SMILES |
COc1c2ccoc2c(OC)c2oc(=O)ccc12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Angelica archangelica  | Ref. |
| Plantae | Apiaceae | Angelica keiskei  | Ref. |
| Plantae | Apiaceae | Angelica pubescens f.biserrata  | Ref. |
| Plantae | Apiaceae | Angelica spp. | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Cnidium monnieri  | Ref. |
| Plantae | Apiaceae | Ferula spp. | Ref. |
| Plantae | Apiaceae | Heracleum asperum | Ref. |
| Plantae | Apiaceae | Heracleum dissectum | Ref. |
| Plantae | Apiaceae | Heracleum granatense | Ref. |
| Plantae | Apiaceae | Heracleum grandiflorum | Ref. |
| Plantae | Apiaceae | Heracleum lehmannianum | Ref. |
| Plantae | Apiaceae | Heracleum moellendorffii Hance | Ref. |
| Plantae | Apiaceae | Heracleum moellendorffii Hance var.paucivitatum | Ref. |
| Plantae | Apiaceae | Heracleum nepalense  | Ref. |
| Plantae | Apiaceae | Heracleum ponticum | Ref. |
| Plantae | Apiaceae | Heracleum pyrenaicum | Ref. |
| Plantae | Apiaceae | Heracleum sphondylium  | Ref. |
| Plantae | Apiaceae | Heracleum spp. | Ref. |
| Plantae | Apiaceae | Heracleum wallichii | Ref. |
| Plantae | Apiaceae | Heracleum woroschiklowii | Ref. |
| Plantae | Apiaceae | Heracleum yungningense | Ref. |
| Plantae | Apiaceae | Ligusticum multivittatum | Ref. |
| Plantae | Apiaceae | Niphogeton ternata | Ref. |
| Plantae | Apiaceae | Pastinaca sativa  | Ref. |
| Plantae | Apiaceae | Pastinaca spp. | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Apiaceae | Pimpinella spp. | Ref. |
| Plantae | Apiaceae | Pleurospermum angelicoides | Ref. |
| Plantae | Apiaceae | Seseli spp. | Ref. |
| Plantae | Apiaceae | Tordylium apulum  | Ref. |
| Plantae | Asteraceae | Trichocline incana | Ref. |
| Plantae | Fabaceae | Campylotropis hirtella (FRANCH.) SCHNDL | Ref. |
| Plantae | Moraceae | Dorstenia asaroides | Ref. |
| Plantae | Moraceae | Dorstenia bahiensis | Ref. |
| Plantae | Moraceae | Dorstenia barnimiana | Ref. |
| Plantae | Moraceae | Dorstenia brasiliensis  | Ref. |
| Plantae | Moraceae | Dorstenia bryonifolia | Ref. |
| Plantae | Moraceae | Dorstenia cayapiaa | Ref. |
| Plantae | Moraceae | Dorstenia contrajerva  | Ref. |
| Plantae | Moraceae | Dorstenia drakena  | Ref. |
| Plantae | Moraceae | Dorstenia excentria | Ref. |
| Plantae | Moraceae | Dorstenia heringerii | Ref. |
| Plantae | Moraceae | Dorstenia lindeniana | Ref. |
| Plantae | Moraceae | Dorstenia psilurus | Ref. |
| Plantae | Moraceae | Ficus cunninghamii | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Rutaceae | Citrus bergamia  | Ref. |
| Plantae | Rutaceae | Citrus clementina | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus maxima  | Ref. |
| Plantae | Rutaceae | Citrus medica  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Fagara mayu | Ref. |
| Plantae | Rutaceae | Feronia limonia  | Ref. |
| Plantae | Rutaceae | Flindersia bennettiana | Ref. |
| Plantae | Rutaceae | Luvunga sp. | Ref. |
| Plantae | Rutaceae | Ruta chalepensis L.  | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Rutaceae | Skimmia laureola | Ref. |
| Plantae | Rutaceae | Toddalia asiatica  | Ref. |
| Plantae | Rutaceae | Zanthoxylum belizense | Ref. |
| Plantae | Thymelaeaceae | Stellera chamaejasme  | Ref. |
|
|
zoom in
| Organism | Angelica pubescens f.biserrata | | Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Rao, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 18, (1993), 681.
Buckingham(Executive Editor), Dictionary of Natural Products, Chapman & Hall, 1994, Vol1-7
1995, Vol8
1996, Vol9
1997, Vol10
1998, Vol11.
Gawron, et al., Planta Med, 53, (1987), 526.
Ahua, et al., Phytochemistry, 65, (2004), 963.
DUAN, et al., Chem Pharm Bull, 50, (2002), 115.
Yang, et al., Planta Med, 69, (2003), 1091.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|