| Name |
Melatonin N-Acetyl-5-methoxytryptamine |
| Formula |
C13H16N2O2 |
| Mw |
232.12117777 |
| CAS RN |
73-31-4 |
| C_ID |
C00052006
|
| InChIKey |
|
| InChICode |
InChI=1S/C13H16N2O2/c1-9(16)14-6-5-10-8-15-13-4-3-11(17-2)7-12(10)13/h3-4,7-8,15H,5-6H2,1-2H3,(H,14,16) |
| SMILES |
COc1ccc2[nH]cc(CCNC(C)=O)c2c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| -- | Bangiaceae | Porphyra umbilicalis  | Ref. |
| -- | Gigartinaceae | Chondrus crispus  | Ref. |
| -- | Gonyaulacaceae | Alexandrium lusitanicum | Ref. |
| -- | Gracilariaceae | Gracilaria tenustipitata | Ref. |
| -- | Palmariaceae | Palmaria palmata  | Ref. |
| -- | Tetrahymenidae | Tetrahymena thermophila | Ref. |
| Animalia | Bombycidae | Bombyx batryticatus | Ref. |
| Animalia | Hominidae | Homo sapiens | Ref. |
| Animalia | Scolopendridae | Scolopendra subspinipes | Ref. |
| Bacteria | Rhodospirillaceae | Rhodospirillum rubrum | Ref. |
| Bacteria | Sphingomonadaceae | Erythrobacter longus | Ref. |
| Excavata | Euglenaceae | Euglena gracilis | Ref. |
| Fungi | Saccharomycetaceae | Saccharomyces cerevisiae  | Ref. |
| Fungi | Sordariaceae | Neurospora crassa | Ref. |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | Acanthaceae | Andrographis paniculatus | Ref. |
| Plantae | Apiaceae | Angelica biserrata | Ref. |
| Plantae | Apiaceae | Angelica sinensis  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Coriandrum sativum  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Araliaceae | Panax notoginsneg | Ref. |
| Plantae | Asphodelaceae | Aloe vela | Ref. |
| Plantae | Asteraceae | Dendranthema morifolium | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Silybum marianum  | Ref. |
| Plantae | Asteraceae | Tanacetum parthenium  | Ref. |
| Plantae | Berberidaceae | Epimedium brevicornum  | Ref. |
| Plantae | Boraginaceae | Arnebia euchroma  | Ref. |
| Plantae | Campanulaceae/Lobeliaceae | Lobelia chinensis  | Ref. |
| Plantae | Caprifoliaceae | Patrinia scabiosifolia | Ref. |
| Plantae | Caryophyllales | Beta vulgaris  | Ref. |
| Plantae | Chenopodiaceae | Chenopodium rubrum | Ref. |
| Plantae | Convallariaceae | Ophiopogon japonicus  | Ref. |
| Plantae | Convallariaceae | Polygonatum sibiricum  | Ref. |
| Plantae | Convolvulaceae | Pharbitis nil  | Ref. |
| Plantae | Cruciferae | Brassica nigra  | Ref. |
| Plantae | Cruciferae | Isatis indigotica  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cruciferae | Sinapis alba  | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Eucommiaceae | Eucommia ulmoides  | Ref. |
| Plantae | Fabaceae | Desmodium styracifolium  | Ref. |
| Plantae | Fabaceae | Glycyrrhiza uralensis  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Medicago sativum | Ref. |
| Plantae | Fabaceae | Pueraria lobata  | Ref. |
| Plantae | Fabaceae | Senna tora  | Ref. |
| Plantae | Fabaceae | Sesbania glandiflora | Ref. |
| Plantae | Fabaceae | Sesbania sesban  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum  | Ref. |
| Plantae | Gentianaceae | Gentiana macrophylla  | Ref. |
| Plantae | Gentianaceae | Gentiana scabra  | Ref. |
| Plantae | Hypericaceae | Hypericum perforatum  | Ref. |
| Plantae | Juglandaceae | Juglans regia  | Ref. |
| Plantae | Labiatae | Leonurus japonicus  | Ref. |
| Plantae | Labiatae | Prunella vulgaris  | Ref. |
| Plantae | Labiatae | Salvia miltiorrhiza  | Ref. |
| Plantae | Labiatae | Scutellaria amoena | Ref. |
| Plantae | Labiatae | Scutellaria baicalensis  | Ref. |
| Plantae | Laminariaceae | Laminaria digitata  | Ref. |
| Plantae | Linaceae | Linum usitatissimum  | Ref. |
| Plantae | Loranthaceae | Taxillus chinensis  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Musaceae | Musa spp.  | Ref. |
| Plantae | Myrtaceae | Syzygium aromaticum  | Ref. |
| Plantae | Oleaceae | Forsythia suspensa  | Ref. |
| Plantae | Orobanchaceae | Cistanche deseriocola | Ref. |
| Plantae | Papaveraceae | Papaver somniferum  | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Poaceae | Avena sativa  | Ref. |
| Plantae | Poaceae | Festuca arundinacea  | Ref. |
| Plantae | Poaceae | Oryza sativa japonica  | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Polygalaceae | Polygala tenuifolia  | Ref. |
| Plantae | Polygonaceae | Polygonum multiflorum  | Ref. |
| Plantae | Polygonaceae | Rheum palmatum  | Ref. |
| Plantae | Polyphysaceae | Acetabularia acetabulum | Ref. |
| Plantae | Ranunculaceae | Coptis chinensis  | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Rosaceae | Fragaria X ananassa | Ref. |
| Plantae | Rosaceae | Prunus amygdalus  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus cerasus  | Ref. |
| Plantae | Rosaceae | Rubus chingii | Ref. |
| Plantae | Rubiaceae | Coffea arabica  | Ref. |
| Plantae | Rubiaceae | Coffea canephora  | Ref. |
| Plantae | Rubiaceae | Uncaria rhynchophylla  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Scrophulariaceae | Scrophularia ningpoensis  | Ref. |
| Plantae | Solanaceae | Datura metel  | Ref. |
| Plantae | Solanaceae | Lycium barbarum  | Ref. |
| Plantae | Solanaceae | Nicotiana tobacum | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Violaceae | Viola philipica | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| Plantae | Zingiberaceae | Curcuma aeruginosa  | Ref. |
| Plantae | Zingiberaceae | Elettaria cardamomum  | Ref. |
| Protozoa | Gymnodiniaceae | Amphidinium carterae | Ref. |
| Viridiplantae | Dunaliellaceae | Dunaliella teriolecta | Ref. |
| - | - | Agastaches rugosa | Ref. |
| - | - | Artemisis anna | Ref. |
| - | - | Babreum coscluea | Ref. |
| - | - | Baccaurea ramiflora  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Ceratium horridum | Ref. |
| - | - | Chlomydomonas spp. | Ref. |
| - | - | Coruns officinalis | Ref. |
| - | - | Didymosphaeria mori-albae | Ref. |
| - | - | Galdenia jasminoides | Ref. |
| - | - | Gekko japanicus | Ref. |
| - | - | Gonyaulax polyedra | Ref. |
| - | - | Lingulodinium polyedrum | Ref. |
| - | - | Lophartherum gracile | Ref. |
| - | - | Mahania bealei | Ref. |
| - | - | Noctiluca scintillans | Ref. |
| - | - | Patriniae scabiosaefoliae | Ref. |
| - | - | Periostracum cicadae | Ref. |
| - | - | Petalonia fascia  | Ref. |
| - | - | Pheretima aspergillum | Ref. |
| - | - | Pimpinela anisum | Ref. |
| - | - | Pirola decorata | Ref. |
| - | - | Poria cocos  | Ref. |
| - | - | Pterygophora californica | Ref. |
| - | - | Pyrocystis lunula | Ref. |
| - | - | Saposhmikovia divaricata | Ref. |
| - | - | Schisondra chinensis | Ref. |
| - | - | Trypanosoma cruzi | Ref. |
|
|
zoom in
| Organism | Datura metel | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|