| Name |
Ficusin Psoralen |
| Formula |
C11H6O3 |
| Mw |
186.03169406 |
| CAS RN |
66-97-7 |
| C_ID |
C00000297
, 
|
| InChIKey |
ZCCUUQDIBDJBTK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C11H6O3/c12-11-2-1-7-5-8-3-4-13-9(8)6-10(7)14-11/h1-6H |
| SMILES |
O=c1ccc2cc3ccoc3cc2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Ammi majus  | Ref. |
| Plantae | Apiaceae | Angelica pubescens f.biserrata  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Arracacia xanthorrhiza  | Ref. |
| Plantae | Apiaceae | Bupleurum scorzonerifolium  | Ref. |
| Plantae | Apiaceae | Glehnia littoralis  | Ref. |
| Plantae | Apiaceae | Heracleum lanatum  | Ref. |
| Plantae | Apiaceae | Heracleum levskovii | Ref. |
| Plantae | Apiaceae | Petroselinum crispum  | Ref. |
| Plantae | Apiaceae | Peucedanum praeruptorum | Ref. |
| Plantae | Apiaceae | Prionosciadium thapsoides | Ref. |
| Plantae | Apiaceae | Saposhnikovia divaricata Schischkin | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Erythroxylaceae | Erythroxylum ulei | Ref. |
| Plantae | Fabaceae | Bituminaria bituminosa | Ref. |
| Plantae | Fabaceae | Coronilla coronata | Ref. |
| Plantae | Fabaceae | Coronilla glauca | Ref. |
| Plantae | Fabaceae | Coronilla juncea | Ref. |
| Plantae | Fabaceae | Coronilla minima | Ref. |
| Plantae | Fabaceae | Coronilla repanda  | Ref. |
| Plantae | Fabaceae | Coronilla scorpioides | Ref. |
| Plantae | Fabaceae | Coronilla valentina | Ref. |
| Plantae | Fabaceae | Coronilla viminalis | Ref. |
| Plantae | Fabaceae | Cullen corylifolium | Ref. |
| Plantae | Fabaceae | Cullen drupaceum | Ref. |
| Plantae | Fabaceae | Cullen obtusifolium  | Ref. |
| Plantae | Fabaceae | Cullen plicatum | Ref. |
| Plantae | Fabaceae | Hoita macrostachya | Ref. |
| Plantae | Fabaceae | Orbexilum pedunculatum | Ref. |
| Plantae | Fabaceae | Otholobium bolusii | Ref. |
| Plantae | Fabaceae | Otholobium candicans | Ref. |
| Plantae | Fabaceae | Otholobium foliosum | Ref. |
| Plantae | Fabaceae | Otholobium hirtum | Ref. |
| Plantae | Fabaceae | Otholobium obliquum | Ref. |
| Plantae | Fabaceae | Otholobium parviflorum | Ref. |
| Plantae | Fabaceae | Otholobium sericeum | Ref. |
| Plantae | Fabaceae | Otholobium stachyerum | Ref. |
| Plantae | Fabaceae | Otholobium zeyheri | Ref. |
| Plantae | Fabaceae | Pediomelum subacaule | Ref. |
| Plantae | Fabaceae | Psoralea affinis | Ref. |
| Plantae | Fabaceae | Psoralea arborea | Ref. |
| Plantae | Fabaceae | Psoralea cinerea | Ref. |
| Plantae | Fabaceae | Psoralea coryfolia | Ref. |
| Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
| Plantae | Fabaceae | Psoralea effusa | Ref. |
| Plantae | Fabaceae | Psoralea exile | Ref. |
| Plantae | Fabaceae | Psoralea fascicularis | Ref. |
| Plantae | Fabaceae | Psoralea glabra | Ref. |
| Plantae | Fabaceae | Psoralea lachnostachys | Ref. |
| Plantae | Fabaceae | Psoralea leucantha | Ref. |
| Plantae | Fabaceae | Psoralea martinii | Ref. |
| Plantae | Fabaceae | Psoralea oreopolum | Ref. |
| Plantae | Fabaceae | Psoralea papillosa | Ref. |
| Plantae | Fabaceae | Psoralea pinnata | Ref. |
| Plantae | Fabaceae | Psoralea plumosa | Ref. |
| Plantae | Fabaceae | Psoralea pullata | Ref. |
| Plantae | Fabaceae | Psoralea pustulata | Ref. |
| Plantae | Fabaceae | Psoralea ramulosa | Ref. |
| Plantae | Fabaceae | Psoralea repens | Ref. |
| Plantae | Fabaceae | Psoralea speciosa | Ref. |
| Plantae | Fabaceae | Psoralea verrucosa | Ref. |
| Plantae | Fabaceae | Securigera cretica | Ref. |
| Plantae | Fabaceae | Securigera orientalis | Ref. |
| Plantae | Moraceae | Dorstenia asaroides | Ref. |
| Plantae | Moraceae | Dorstenia bahiensis | Ref. |
| Plantae | Moraceae | Dorstenia barnimiana | Ref. |
| Plantae | Moraceae | Dorstenia brasiliensis  | Ref. |
| Plantae | Moraceae | Dorstenia bryonifolia | Ref. |
| Plantae | Moraceae | Dorstenia cayapiaa | Ref. |
| Plantae | Moraceae | Dorstenia contrajerva  | Ref. |
| Plantae | Moraceae | Dorstenia drakena  | Ref. |
| Plantae | Moraceae | Dorstenia excentria | Ref. |
| Plantae | Moraceae | Dorstenia heringerii | Ref. |
| Plantae | Moraceae | Dorstenia lindeniana | Ref. |
| Plantae | Moraceae | Dorstenia psilurus | Ref. |
| Plantae | Moraceae | Dorstenia turbinata | Ref. |
| Plantae | Moraceae | Ficus arica | Ref. |
| Plantae | Moraceae | Ficus carica  | Ref. |
| Plantae | Moraceae | Ficus hirta  | Ref. |
| Plantae | Moraceae | Ficus simplicissima | Ref. |
| Plantae | Moraceae | Ficus sycomorus  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Plumbaginaceae | Plumbago zeylanica  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Citrus bergamia  | Ref. |
| Plantae | Rutaceae | Dictamnus hispanicus  | Ref. |
| Plantae | Rutaceae | Fagara mayu | Ref. |
| Plantae | Rutaceae | Feronia limonia  | Ref. |
| Plantae | Rutaceae | Haplophyllum patavinum | Ref. |
| Plantae | Rutaceae | Phebalium argenteum | Ref. |
| Plantae | Rutaceae | Phebalium clavatum | Ref. |
| Plantae | Rutaceae | Ruta chalepensis L.  | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Rutaceae | Zanthoxylum flavum  | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| - | - | Sarcolobus globosus | Ref. |
|
|
zoom in
| Organism | Aegle marmelos | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|