| Name |
Cholesterol Cholesterin Cholest-5-en-3beta-ol |
| Formula |
C27H46O |
| Mw |
386.35486609 |
| CAS RN |
57-88-5 |
| C_ID |
C00003648
, 
|
| InChIKey |
HVYWMOMLDIMFJA-ZMWIUTBPNA-N |
| InChICode |
InChI=1S/C27H46O/c1-18(2)7-6-8-19(3)23-11-12-24-22-10-9-20-17-21(28)13-15-26(20,4)25(22)14-16-27(23,24)5/h9,18-19,21-25,28H,6-8,10-17H2,1-5H3/t19-,21+,22+,23-,24+,25+,26+,27-/m1/s1 |
| SMILES |
CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| -- | Amoebidiidae | Amoebidium parasiticum | Ref. |
| Animalia | Drepanidae | Achlya bisexualis | Ref. |
| Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
| Chromalveolata | Pelagophyceae | Aureoumbra lagunensis | Ref. |
| Fungi | Acaulosporaceae | Acaulospora laevis | Ref. |
| Fungi | Blastocladiaceae | Allomyces macrogynus | Ref. |
| Fungi | Blastocladiaceae | Allomyces spp. | Ref. |
| Fungi | Glomeraceae | Glomus mosseae | Ref. |
| Fungi | Glomeraceae | Glomus sp. | Ref. |
| Fungi | Gnomoniaceae | Gnomonia leptostyla | Ref. |
| Fungi | Hypocreaceae | Nectria galligena | Ref. |
| Fungi | Phaeosphaeriaceae | Leptosphaeria typhae | Ref. |
| Fungi | Phycomycetaceae | Phycomyces blakesleeanus | Ref. |
| Fungi | Trichocomaceae | Aspergillus oryzae | Ref. |
| Plantae | Asphodelaceae | Aloe barbadensis  | Ref. |
| Plantae | Asteraceae | Conyza aegyptica | Ref. |
| Plantae | Burseraceae | Commiphora mukul  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Brassica rapa  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Cruciferae | Erysimum carniolicum | Ref. |
| Plantae | Cymodoceaceae | Cymodocea serrulata | Ref. |
| Plantae | Cymodoceaceae | Halodule uninervis | Ref. |
| Plantae | Dioscoreaceae | Dioscorea zingiberensis | Ref. |
| Plantae | Fabaceae | Bauhinia candicans | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Prosopis spicigera  | Ref. |
| Plantae | Hydrocharitaceae | Enhalus acoroides | Ref. |
| Plantae | Hydrocharitaceae | Halophila ovalis | Ref. |
| Plantae | Hydrocharitaceae | Halophila ovata | Ref. |
| Plantae | Hydrocharitaceae | Halophila spinulosa | Ref. |
| Plantae | Hydrocharitaceae | Thalassia hemprichii | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Laminariaceae | Laminaria japonica  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Hibiscus sabdariffa L.  | Ref. |
| Plantae | Malvaceae | Malva parviflora  | Ref. |
| Plantae | Melanthiaceae | Veratrum grandiflorum | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Palmae | Phoenix dactylifera  | Ref. |
| Plantae | Plantaginaceae | Digitalis lanata Ehrh.  | Ref. |
| Plantae | Poaceae | Hordeum vulgare L.cv Mammut  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Posidoniaceae | Posidonia oceanica  | Ref. |
| Plantae | Ranunculaceae | Nigella sativa  | Ref. |
| Plantae | Rutaceae | Haplophyllum acutifolium  | Ref. |
| Plantae | Sapindaceae | Schleichera trijuga  | Ref. |
| Plantae | Solanaceae | Nicotiana benthamiana  | Ref. |
| Plantae | Solanaceae | Solanum chacoense | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Verbenaceae | Clerodendron neutens | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| - | - | Blastocladia ramosa | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Chattonella marina | Ref. |
| - | - | Chloromorum toxicum | Ref. |
| - | - | Chorisia insignis | Ref. |
| - | - | Chorisia speciosa | Ref. |
| - | - | Collectotrichum dematium | Ref. |
| - | - | Crotone hieronymi | Ref. |
| - | - | Dipsacomyces acuminosporus | Ref. |
| - | - | Dynamena pumila | Ref. |
| - | - | Furcellaria fastigiata | Ref. |
| - | - | Hyrtios gumminae | Ref. |
| - | - | Lanurocerasus officinalis | Ref. |
| - | - | Laurencia aldingensis | Ref. |
| - | - | Linderina pennispora | Ref. |
| - | - | Monoblepharella sp. | Ref. |
| - | - | Rhizophlyctis rosea | Ref. |
| - | - | Smittium sp. | Ref. |
| - | - | Ustilago maydis  | Ref. |
|
|
zoom in
| Organism | Smittium sp. | | Reference | Nes,Analysis of Sterols and Other Biologically Significant Steroids,Academic Press Inc.,New York,Ny,341 pp.(1989)
Turner,Fungal Metabolites II,Academic Press,New York,NY,631 pp.(1983) |
|---|
|