| Name |
(-)-beta-Caryophyllene epoxide beta-Caryophyllene oxide (-)-Epoxydihydrocaryophyllene beta-Caryophyllene epoxide 4beta,5alpha-Epoxycaryophyllene 6,7-Epoxy-3(15)-caryophyllene Caryophyllene 4beta,5alpha-epoxide trans-Caryophyllene oxide Betula pubescens Caryophyllene oxide |
| Formula |
C15H24O |
| Mw |
220.18271539 |
| CAS RN |
1139-30-6 |
| C_ID |
C00012483
, 
|
| InChIKey |
NVEQFIOZRFFVFW-RHYMVJRONA-N |
| InChICode |
InChI=1S/C15H24O/c1-10-5-6-13-15(4,16-13)8-7-12-11(10)9-14(12,2)3/h11-13H,1,5-9H2,2-4H3/t11-,12-,13-,15-/m1/s1 |
| SMILES |
C=C1CC[C@H]2O[C@]2(C)CC[C@@H]2[C@@H]1CC2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Acoraceae | Acorus calanus L. | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona glabra  | Ref. |
| Plantae | Annonaceae | Artabotrys stenopetalus | Ref. |
| Plantae | Annonaceae | Artabotrys uncinatus  | Ref. |
| Plantae | Annonaceae | Xylopia cayennensis  | Ref. |
| Plantae | Annonaceae | Xylopia emarginata | Ref. |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Annonaceae | Xylopia rubescens | Ref. |
| Plantae | Annonaceae | Xylopia sericea  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Prangos tschimganica  | Ref. |
| Plantae | Apocynaceae | Tabernaemontana catharinensis | Ref. |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Ajania fruticulosa  | Ref. |
| Plantae | Asteraceae | Ambrosia artemisiifolia | Ref. |
| Plantae | Asteraceae | Ambrosia trifida | Ref. |
| Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
| Plantae | Asteraceae | Artemisia annua L.cultivar Jwarharti  | Ref. |
| Plantae | Asteraceae | Artemisia vulgaris  | Ref. |
| Plantae | Asteraceae | Baccharis dracunculifolia  | Ref. |
| Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
| Plantae | Asteraceae | Cyathocline purpurea | Ref. |
| Plantae | Asteraceae | Dittrichia graveolens  | Ref. |
| Plantae | Asteraceae | Eupatorium adenophorum  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Petasites hybridus  | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Santolina corsica Jordan et Fourr | Ref. |
| Plantae | Asteraceae | Senecio chionophilus | Ref. |
| Plantae | Asteraceae | Senecio vulgaris  | Ref. |
| Plantae | Asteraceae | Serratula wolfi | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Asteraceae | Tarchonanthus camphoratus  | Ref. |
| Plantae | Betulaceae | Betula pubescens  | Ref. |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Cistaceae | Cistus albidus | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Fabaceae | Caesalpinia pulcherrima  | Ref. |
| Plantae | Fabaceae | Copaifera guianensis  | Ref. |
| Plantae | Fabaceae | Copaifera langsdorffii  | Ref. |
| Plantae | Fabaceae | Copaifera multijuga | Ref. |
| Plantae | Fabaceae | Rhynchosia minima  | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Illiciaceae | Illicium anisatum  | Ref. |
| Plantae | Jubulaceae | Frullania probosciphora | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Cunila angustifolia | Ref. |
| Plantae | Labiatae | Lavandula angustifolia  | Ref. |
| Plantae | Labiatae | Lavandula bipinnata  | Ref. |
| Plantae | Labiatae | Lavandula canarien-sis | Ref. |
| Plantae | Labiatae | Lavandula gibsoni | Ref. |
| Plantae | Labiatae | Lavandula multifida  | Ref. |
| Plantae | Labiatae | Lavandula stoechas  | Ref. |
| Plantae | Labiatae | Mentha arvensis L.  | Ref. |
| Plantae | Labiatae | Mentha piperita  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Plectranthus marrubioides | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia hydrangea | Ref. |
| Plantae | Labiatae | Salvia mirzayanii | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia santolinifolia | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Lamiaceae | Calamintha nepeta subsp. glandulosa  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Lauraceae | Cinnamomum subavenium MIQ. | Ref. |
| Plantae | Lauraceae | Litsea monopetala  | Ref. |
| Plantae | Lauraceae | Neolitsea sericea | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Meliaceae | Aglaia foveolata | Ref. |
| Plantae | Myrtaceae | Eugenia caryophyllata  | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Pinaceae | Pinus halepensis  | Ref. |
| Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Piperaceae | Piper philippinum | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Poaceae | Capillipedium parviflorum | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Rutaceae | Atalantia guillauminii | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus paradise x Poncirus trifoliata | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Clausena excavata  | Ref. |
| Plantae | Rutaceae | Murraya exotica  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Poncirus trifoliata  | Ref. |
| Plantae | Rutaceae | Zanthoxylum armatum  | Ref. |
| Plantae | Rutaceae | Zanthoxylum decaryi | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Taxaceae | Taxus wallichiana  | Ref. |
| Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Verbenaceae | Lippia javanica  | Ref. |
| Plantae | Verbenaceae | Lippia ukambensis | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
| Plantae | Zingiberaceae | Curcuma aeruginosa  | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| Plantae | Zingiberaceae | Curcuma aromatica  | Ref. |
| Plantae | Zingiberaceae | Curcuma kwangsiensis  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
| Plantae | Zingiberaceae | Curcuma phaeocaulis  | Ref. |
| Plantae | Zingiberaceae | Curcuma wenyujin  | Ref. |
| Plantae | Zingiberaceae | Curcuma xanthorrhiza  | Ref. |
| Plantae | Zingiberaceae | Zingiber cassumunar Roxb.  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| Plantae | Zingiberaceae | Zingiber zerumbet Smith  | Ref. |
| - | - | Agatis ovata | Ref. |
| - | - | Baeckea frutescens L.  | Ref. |
| - | - | Lavandin abrialis | Ref. |
|
|
zoom in
| Organism | Thymus praecos | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|