| Name |
Espatulenol (+)-Spathulenol Spathulenol |
| Formula |
C15H24O |
| Mw |
220.18271539 |
| CAS RN |
6750-60-3 |
| C_ID |
C00000149
, 
|
| InChIKey |
FRMCCTDTYSRUBE-SRGLDTNUNA-N |
| InChICode |
InChI=1S/C15H24O/c1-9-5-6-11-13(14(11,2)3)12-10(9)7-8-15(12,4)16/h10-13,16H,1,5-8H2,2-4H3/t10-,11+,12-,13+,15-/m0/s1 |
| SMILES |
C=C1CC[C@@H]2[C@H]([C@H]3[C@H]1CC[C@]3(C)O)C2(C)C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Annonaceae | Annona glabra  | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Annonaceae | Artabotrys uncinatus  | Ref. |
| Plantae | Annonaceae | Xylopia aromatica  | Ref. |
| Plantae | Annonaceae | Xylopia brasiliensis | Ref. |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Annonaceae | Xylopia sericea  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Ligusticum chuanxiong  | Ref. |
| Plantae | Apiaceae | Ligusticum jeholense | Ref. |
| Plantae | Apiaceae | Peucedanum paniculatum L. | Ref. |
| Plantae | Apiaceae | Prangos pabularia  | Ref. |
| Plantae | Apiaceae | Prangos tschimganica  | Ref. |
| Plantae | Apocynaceae | Tabernaemontana catharinensis | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Araliaceae | Panax notoginseng  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia trilobata  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia yunnanensis | Ref. |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Ageratina jocotepecana | Ref. |
| Plantae | Asteraceae | Ajania fruticulosa  | Ref. |
| Plantae | Asteraceae | Ambrosia artemisiifolia | Ref. |
| Plantae | Asteraceae | Ambrosia trifida | Ref. |
| Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
| Plantae | Asteraceae | Artemisia anethoides | Ref. |
| Plantae | Asteraceae | Artemisia annua L.cultivar Jwarharti  | Ref. |
| Plantae | Asteraceae | Artemisia dracunculus  | Ref. |
| Plantae | Asteraceae | Artemisia monosperma | Ref. |
| Plantae | Asteraceae | Artemisia scoparia  | Ref. |
| Plantae | Asteraceae | Artemisia vulgaris  | Ref. |
| Plantae | Asteraceae | Baccharis dracunculifolia  | Ref. |
| Plantae | Asteraceae | Baccharis gaudichaudiana | Ref. |
| Plantae | Asteraceae | Centaurea armena | Ref. |
| Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
| Plantae | Asteraceae | Centaurea orientalis | Ref. |
| Plantae | Asteraceae | Centaurea sessilis | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Chamomilla rectita | Ref. |
| Plantae | Asteraceae | Chamomilla recutina | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Petasites hybridus  | Ref. |
| Plantae | Asteraceae | Santolina corsica Jordan et Fourr | Ref. |
| Plantae | Asteraceae | Santolina rosmarinifolia subsp. canescens  | Ref. |
| Plantae | Asteraceae | Senecio vulgaris  | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Asteraceae | Wollastonia biflora  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Chloranthaceae | Hedyosmum orientale | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Cupressaceae | Neocallitropsis pancheri | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus L.  | Ref. |
| Plantae | Euphorbiaceae | Croton arboreous | Ref. |
| Plantae | Euphorbiaceae | Excoecaria parvifolia | Ref. |
| Plantae | Fabaceae | Caesalpinia decapetala  | Ref. |
| Plantae | Fabaceae | Caesalpinia pulcherrima  | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Jubulaceae | Frullania lobulata | Ref. |
| Plantae | Jubulaceae | Frullania media | Ref. |
| Plantae | Labiatae | Callicarpa americana | Ref. |
| Plantae | Labiatae | Callicarpa japonica | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Cunila angustifolia | Ref. |
| Plantae | Labiatae | Lavandula angustifolia  | Ref. |
| Plantae | Labiatae | Lavandula canarien-sis | Ref. |
| Plantae | Labiatae | Lavandula dentata  | Ref. |
| Plantae | Labiatae | Lavandula multifida  | Ref. |
| Plantae | Labiatae | Melissa officinalis  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Origanum dubium | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Pogostemon cablin  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Salvia sclarea  | Ref. |
| Plantae | Labiatae | Salvia staminea | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Lauraceae | Ocotea whitei | Ref. |
| Plantae | Lepidoziaceae | Lepidozia vitrea | Ref. |
| Plantae | Meliaceae | Aglaia forbesii  | Ref. |
| Plantae | Meliaceae | Aglaia foveolata | Ref. |
| Plantae | Meliaceae | Guarea macrophylla ssp.tuberculata | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Myrtaceae | Eucalyptus spathulata | Ref. |
| Plantae | Myrtaceae | Kunzea ambigua | Ref. |
| Plantae | Myrtaceae | Leptospermum scoparium  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Pelliaceae | Pellia epiphylla | Ref. |
| Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Piperaceae | Piper arboreum  | Ref. |
| Plantae | Piperaceae | Piper fimbriulatum | Ref. |
| Plantae | Piperaceae | Piper lhotzkyanum | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Piperaceae | Piper obliquum  | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Rutaceae | Atalantia guillauminii | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Clausena excavata  | Ref. |
| Plantae | Rutaceae | Murraya exotica  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Zanthoxylum armatum  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Verbenaceae | Verbena officinalis  | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| Plantae | Zingiberaceae | Curcuma kwangsiensis  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma phaeocaulis  | Ref. |
| Plantae | Zingiberaceae | Curcuma wenyujin  | Ref. |
| Plantae | Zingiberaceae | Curcuma zedoaria  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Alphinia galanga | Ref. |
| - | - | Parerythropodium fulvum | Ref. |
|
|
zoom in
| Organism | Origanum dubium | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|