| Name |
4-Terpineol Terpin-1-en-4-ol Terpinen-4-ol Terpin-4-ol Terpineol-4 4-Methyl-1-(1-methylethyl)-3-cyclohexene-1-ol |
| Formula |
C10H18O |
| Mw |
154.1357652 |
| CAS RN |
562-74-3 |
| C_ID |
C00029544
, 
|
| InChIKey |
WRYLYDPHFGVWKC-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C10H18O/c1-8(2)10(11)6-4-9(3)5-7-10/h4,8,11H,5-7H2,1-3H3/t10-/m1/s1 |
| SMILES |
CC1=CCC(O)(C(C)C)CC1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Bacteria | Pseudomonadaceae | Pseudomonas aeruginosa | Ref. |
| Fungi | Ganodermataceae | Ganoderma lucidum  | Ref. |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Acoraceae | Acorus calanus L. | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona glabra  | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Annonaceae | Cananga odorata  | Ref. |
| Plantae | Annonaceae | Xylopia aethiopica  | Ref. |
| Plantae | Annonaceae | Xylopia parviflora  | Ref. |
| Plantae | Annonaceae | Xylopia sericea  | Ref. |
| Plantae | Apiaceae | Angelica dahurica  | Ref. |
| Plantae | Apiaceae | Angelica pubescentis | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Ligusticum jeholense | Ref. |
| Plantae | Apiaceae | Notopterygium forbesii  | Ref. |
| Plantae | Apiaceae | Notopterygium incisum  | Ref. |
| Plantae | Apiaceae | Peucedanum paniculatum L. | Ref. |
| Plantae | Aristolochiaceae | Asarum sieboldii  | Ref. |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Ageratina jocotepecana | Ref. |
| Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
| Plantae | Asteraceae | Artemisia anethoides | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia argyi  | Ref. |
| Plantae | Asteraceae | Centaurea atropurpurea | Ref. |
| Plantae | Asteraceae | Centaurea orientalis | Ref. |
| Plantae | Asteraceae | Chamaemelum nobile  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Asteraceae | Santolina corsica Jordan et Fourr | Ref. |
| Plantae | Asteraceae | Senecio vulgaris  | Ref. |
| Plantae | Asteraceae | Tanacetum longifolium | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Asteraceae | Tarchonanthus camphoratus  | Ref. |
| Plantae | Canellaceae | Canella winterana  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus L.  | Ref. |
| Plantae | Dipsacaceae/Diervillaceae/Linnaeaceae/Valerianaceae | Dipsacus asperoides  | Ref. |
| Plantae | Fabaceae | Rhynchosia minima  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Illiciaceae | Illicium anisatum  | Ref. |
| Plantae | Labiatae | Clinopodium nepeta | Ref. |
| Plantae | Labiatae | Lavandula angustifolia  | Ref. |
| Plantae | Labiatae | Lavandula bipinnata  | Ref. |
| Plantae | Labiatae | Lavandula dentata  | Ref. |
| Plantae | Labiatae | Lavandula stoechas  | Ref. |
| Plantae | Labiatae | Mentha arvensis L.  | Ref. |
| Plantae | Labiatae | Mentha pulegium L.  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Plectranthus marrubioides | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Tetradenia riparia  | Ref. |
| Plantae | Labiatae | Thymus broussonetti | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus maroccanus | Ref. |
| Plantae | Labiatae | Thymus piperella  | Ref. |
| Plantae | Labiatae | Thymus praecos | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Labiatae | Trichostema lanceolatum | Ref. |
| Plantae | Lamiaceae | Calamintha nepeta  | Ref. |
| Plantae | Lamiaceae | Coleus aromaticus  | Ref. |
| Plantae | Lamiaceae | Coridothymus capitatus  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Lauraceae | Cinnamomum illicioides | Ref. |
| Plantae | Lauraceae | Laurus nobilis  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Meliaceae | Azadirachta indica  | Ref. |
| Plantae | Myrtaceae | Eucalyptus deglupta  | Ref. |
| Plantae | Myrtaceae | Eucalyptus radiata | Ref. |
| Plantae | Myrtaceae | Melaleuca alternifolia  | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendra L.  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Oleaceae | Forsythia suspensa  | Ref. |
| Plantae | Pinaceae | Cedrus libani  | Ref. |
| Plantae | Pinaceae | Pinus halepensis  | Ref. |
| Plantae | Pinaceae | Pinus mugo subsp. Mugo  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Piperaceae | Piper arboreum  | Ref. |
| Plantae | Piperaceae | Piper nigrum  | Ref. |
| Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus reticulate x Citrus sinensis | Ref. |
| Plantae | Rutaceae | Citrus sinensis L.  | Ref. |
| Plantae | Rutaceae | Citrus sinki x Poncirus trifoliata | Ref. |
| Plantae | Rutaceae | Clausena excavata  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Zanthoxylum armatum  | Ref. |
| Plantae | Rutaceae | Zanthoxylum bungeanum  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Saururaceae | Houttuynia emeiensis | Ref. |
| Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Verbenaceae | Lippia javanica  | Ref. |
| Plantae | Zingiberaceae | Alpinia galanga  | Ref. |
| Plantae | Zingiberaceae | Curcuma amada  | Ref. |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| Plantae | Zingiberaceae | Curcuma kwangsiensis  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
| Plantae | Zingiberaceae | Curcuma phaeocaulis  | Ref. |
| Plantae | Zingiberaceae | Curcuma wenyujin  | Ref. |
| Plantae | Zingiberaceae | Curcuma xanthorrhiza  | Ref. |
| Plantae | Zingiberaceae | Zingiber cassumunar Roxb.  | Ref. |
| Plantae | Zingiberaceae | Zingiber corallinum | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Alphinia galanga | Ref. |
| - | - | Baeckea frutescens L.  | Ref. |
| - | - | Libanotis intermedia | Ref. |
| - | - | Melaneuca alternifolia | Ref. |
|
|
zoom in
| Organism | Thymus praecos | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|