| Name |
Oleic acid (Z)-9-Octadecenoic acid |
| Formula |
C18H34O2 |
| Mw |
282.25588033 |
| CAS RN |
112-80-1 |
| C_ID |
C00001232
, 
|
| InChIKey |
ZQPPMHVWECSIRJ-KTKRTIGZSA-N |
| InChICode |
InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9- |
| SMILES |
CCCCCCCC/C=CCCCCCCCC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Plantae | Acanthaceae | Justicia heterocarpa T.ANDERS  | Ref. |
| Plantae | Alliaceae | Allium hirtifolium | Ref. |
| Plantae | Amaranthaceae | Celosia cristada | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Apiaceae | Daucus carota subsp. Sativus  | Ref. |
| Plantae | Apiaceae | Ferula assa-foetida  | Ref. |
| Plantae | Apiaceae | Notopterygium incisum  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Artemisia capillaris  | Ref. |
| Plantae | Asteraceae | Taraxacum officinale  | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum calaba | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum  | Ref. |
| Plantae | Caryophyllaceae | Drymaria cordata  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Combretaceae | Terminalia chebula  | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica hirta  | Ref. |
| Plantae | Cruciferae | Isatis tinctoria  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Euphorbiaceae | Jatropha curcus | Ref. |
| Plantae | Fabaceae | Bauhinia tomentosa  | Ref. |
| Plantae | Fabaceae | Clitoria ternata | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Mucuna puriens | Ref. |
| Plantae | Iridaceae | Iris soforana | Ref. |
| Plantae | Jubulaceae | Frullania incumbens | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Vitex trifolia  | Ref. |
| Plantae | Laminariaceae | Laminaria japonica  | Ref. |
| Plantae | Lauraceae | Laurus nobilis  | Ref. |
| Plantae | Linaceae | Linum scabrellum | Ref. |
| Plantae | Loranthaceae | Scurrula atropurpurea | Ref. |
| Plantae | Lythraceae | Lagerstroemia thomsonil | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Malvaceae | Tilia cordata Mill.  | Ref. |
| Plantae | Meliaceae | Aphanamixis polystachya  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
| Plantae | Pandanaceae | Pandanus conoideus Lam  | Ref. |
| Plantae | Pedaliaceae | Sesamum indicum  | Ref. |
| Plantae | Pedaliaceae | Sesamum orientale  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Ranunculaceae | Nigella sativa L  | Ref. |
| Plantae | Rosaceae | Potentilla asiatica | Ref. |
| Plantae | Rosaceae | Potentilla desertorum | Ref. |
| Plantae | Rosaceae | Potentilla orientalis | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Saxifragaceae | Saxifraga stolonifera Meerb.  | Ref. |
| Plantae | Simaroubaceae | Brucea javanica  | Ref. |
| Plantae | Solanaceae | Datura innoxial | Ref. |
| Plantae | Solanaceae | Datura metel  | Ref. |
| Plantae | Solanaceae | Hyoscyamus niger  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Zingiberaceae | Alpinia oxyphylla  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| - | - | Curcurbita pepo L. | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Poterium polygamum | Ref. |
| - | - | Scurrura atropurpurea | Ref. |
| - | - | Sebastiana sebiferum | Ref. |
|
|
zoom in
| Organism | Curcuma longa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|