| Name |
p-Coumaric acid p-Coumarate 4-Coumarate 4-coumaric acid |
| Formula |
C9H8O3 |
| Mw |
164.04734412 |
| CAS RN |
7400-08-0 |
| C_ID |
C00000152
, 
|
| InChIKey |
NGSWKAQJJWESNS-ZZXKWVIFSA-N |
| InChICode |
InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3+ |
| SMILES |
O=C(O)/C=C/c1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Alliaceae | Allium obliquum  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Alliaceae | Allium Sativum | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Annonaceae | Cananga latifolia | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Falcaria vulgaris | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Aquifoliaceae | Ilex paraguariensis  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia manshuriensis | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Asteraceae | Chrysanthemum boreale | Ref. |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Balanophoraceae | Balanophora abbreviata B1 | Ref. |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Berberidaceae | Epimedium sagittatum  | Ref. |
| Plantae | Bignoniaceae | Catalpa ovata  | Ref. |
| Plantae | Bignoniaceae | Stereospermum zenkeri | Ref. |
| Plantae | Boraginaceae | Lithospermum erythrorhizon  | Ref. |
| Plantae | Bromeliaceae | Ananas comosus  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris L. var. saccharifera  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Commelinaceae | Dichorisandra thyrsiflora | Ref. |
| Plantae | Convolvulaceae | Cuscuta australis  | Ref. |
| Plantae | Crassulaceae | Bryophyllum pinnatum  | Ref. |
| Plantae | Crassulaceae | Rhodiola sachalinensis  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica napus  | Ref. |
| Plantae | Cruciferae | Brassica oleracea var. gongylodes  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Citrullus colocynthis  | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Cyperaceae | Cyperus papyrus  | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus L.  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Ephedraceae | Ephedra alata | Ref. |
| Plantae | Ephedraceae | Ephedra equisetina  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lens esculenta  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Melilotus messanensis | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Trifolium alpestre | Ref. |
| Plantae | Fabaceae | Trifolium medium | Ref. |
| Plantae | Fabaceae | Trifolium pratense L.  | Ref. |
| Plantae | Fumariaceae | Fumaria capreolata  | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Haemodoraceae | Anigozanthos preissii | Ref. |
| Plantae | Hydrocharitaceae | Thalassia testudinum | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Juncaceae | Juncus inflexus | Ref. |
| Plantae | Labiatae | Melissa officinalis  | Ref. |
| Plantae | Labiatae | Mentha piperitae | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Ocimum sanctum  | Ref. |
| Plantae | Labiatae | Origanum acutidens | Ref. |
| Plantae | Labiatae | Origanum dubium | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus comosus | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Liliaceae | Notholirion hyacinthium | Ref. |
| Plantae | Lygodiaceae/Schizaeaceae | Lygodium japonicum  | Ref. |
| Plantae | Lythraceae | Lawsonia inermis  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
| Plantae | Malvaceae | Althaea nudiflora | Ref. |
| Plantae | Malvaceae | Althaea rosea  | Ref. |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
| Plantae | Malvaceae | Malva silvestris  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Myrtaceae | Eucalyptus maculata | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
| Plantae | Oleaceae | Syringa oblata | Ref. |
| Plantae | Orchidaceae | Bulbophyllum vaginatum | Ref. |
| Plantae | Orchidaceae | Gymnadenia conopsea R.BR. | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Palmae | Phoenix canariensis  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Picea ajanensis | Ref. |
| Plantae | Pinaceae | Picea obovata | Ref. |
| Plantae | Pinaceae | Pinus radiata | Ref. |
| Plantae | Pinaceae | Pinus spp.  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Plantago media  | Ref. |
| Plantae | Plantaginaceae | Veronica officinalis  | Ref. |
| Plantae | Plantaginaceae | Veronica orchidea | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Plantaginaceae | Veronica teucrium | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Poaceae | Gynerium sagittatum  | Ref. |
| Plantae | Poaceae | Maize bran | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Panicum virgatum | Ref. |
| Plantae | Poaceae | Phyllostachys edulis | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Polygonaceae | Calligonum leucocladum | Ref. |
| Plantae | Ranunculaceae | Actaea racemosa  | Ref. |
| Plantae | Ranunculaceae | Ranunculus baudotii | Ref. |
| Plantae | Restionaceae | Baloskion tetraphyllum | Ref. |
| Plantae | Restionaceae | Elegia capensis | Ref. |
| Plantae | Rhamnaceae | Colubrina faralaotra subsp.trichocarpa. | Ref. |
| Plantae | Rosaceae | Cowania mexicana  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus serotina  | Ref. |
| Plantae | Rosaceae | Spiraea formosana  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
| Plantae | Salicaceae | Populus deltoides | Ref. |
| Plantae | Salicaceae | Populus spp. | Ref. |
| Plantae | Salicaceae | Populus trichocarpa | Ref. |
| Plantae | Sarcolaenaceae | Leptolaena diospyroidea | Ref. |
| Plantae | Sarcolaenaceae | Leptolaena pauciflora | Ref. |
| Plantae | Scrophulariaceae | Scrophularia buergeriana | Ref. |
| Plantae | Simaroubaceae | Ailanthus integrifolia | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
| Plantae | Strelitziaceae | Strelitzia reginae  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Typhaceae | Typha domingensis P.  | Ref. |
| Plantae | Typhaceae | Typha orientalis  | Ref. |
| Plantae | Typhaceae/Sparganiaceae | Sparganium stoloniferum | Ref. |
| Plantae | Vitaceae | Vitis rupestris | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| Plantae | Zingiberaceae | Alpinia blepharocalyx  | Ref. |
| Plantae | Zingiberaceae | Curcuma domestica  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
| Plantae | Zingiberaceae | Hedychium gardnerianum | Ref. |
| Plantae | Zygophyllaceae | Larrea divaricata  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Ephedar aphylla | Ref. |
| - | - | Equsetum arvense | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Sarcolaeana multiflora | Ref. |
| - | - | Scrophularis sambucifolia | Ref. |
|
|
zoom in
| Organism | Fumaria capreolata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|