| Name |
Palmitic acid n-Hexadecanoic acid Hexadecanoic acid |
| Formula |
C16H32O2 |
| Mw |
256.24023027 |
| CAS RN |
57-10-3 |
| C_ID |
C00001233
, 
|
| InChIKey |
IPCSVZSSVZVIGE-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16(17)18/h2-15H2,1H3,(H,17,18) |
| SMILES |
CCCCCCCCCCCCCCCC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Skin) | Ref. |
| Chromalveolata | Sargassaceae | Sargassum crassifolium J.Asgardh | Ref. |
| Plantae | Acanthaceae | Justicia heterocarpa T.ANDERS  | Ref. |
| Plantae | Acoraceae | Acorus calanus L. | Ref. |
| Plantae | Alliaceae | Allium hirtifolium | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona glabra  | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Araceae | Pinellia pedatisecta | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Anthemis aciphylla BOISS.var.discoidea BOISS | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Petasites albus  | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Asteraceae | Senecio vulgaris  | Ref. |
| Plantae | Asteraceae | Silybum marianum  | Ref. |
| Plantae | Asteraceae | Tanacetum macrophyllum | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum calaba | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllaceae | Drymaria cordata  | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica hirta  | Ref. |
| Plantae | Cruciferae | Brassica oleracea var. italica  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Cruciferae | Isatis tinctoria  | Ref. |
| Plantae | Cucurbitaceae | Citrullus colocynthis  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea opposita  | Ref. |
| Plantae | Euphorbiaceae | Aleurites moluccana  | Ref. |
| Plantae | Euphorbiaceae | Aleurites montana | Ref. |
| Plantae | Euphorbiaceae | Jatropha curcus | Ref. |
| Plantae | Fabaceae | Bauhinia tomentosa  | Ref. |
| Plantae | Fabaceae | Cassia absu | Ref. |
| Plantae | Fabaceae | Cassia alata  | Ref. |
| Plantae | Fabaceae | Clitoria ternata | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Mucuna puriens | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Tipuana tipu | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Hydrangeaceae | Hydrangea chinensis | Ref. |
| Plantae | Jubulaceae | Frullania monocera | Ref. |
| Plantae | Jubulaceae | Frullania solanderiana | Ref. |
| Plantae | Labiatae | Anisomeles indica  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Laminariaceae | Laminaria japonica  | Ref. |
| Plantae | Lauraceae | Cinnamomum subavenium MIQ. | Ref. |
| Plantae | Lauraceae | Cinnamomum tenuifolium | Ref. |
| Plantae | Lythraceae | Lagerstroemia thomsonil | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Malvaceae | Tilia cordata Mill.  | Ref. |
| Plantae | Melastomataceae | Henriettella fascicularis | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
| Plantae | Oleaceae | Jasminum auriculatum  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Piperaceae | Piper obliquum  | Ref. |
| Plantae | Poaceae | Oryza sativa cv. Heugjinjubyeo  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Haplophyllum acutifolium  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum L.  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata Thunb.  | Ref. |
| Plantae | Saxifragaceae | Saxifraga stolonifera Meerb.  | Ref. |
| Plantae | Scrophulariaceae | Diascia cordata | Ref. |
| Plantae | Scrophulariaceae | Diascia integerrima | Ref. |
| Plantae | Scrophulariaceae | Diascia megathura | Ref. |
| Plantae | Scrophulariaceae | Diascia purpurea | Ref. |
| Plantae | Scrophulariaceae | Diascia vigilis | Ref. |
| Plantae | Simaroubaceae | Ailanthus altissima  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| Plantae | Urticaceae | Boehmeria holosericea | Ref. |
| Plantae | Urticaceae | Boehmeria tricuspis | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana officinalis  | Ref. |
| Plantae | Verbenaceae | Lantana camara  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
| - | - | Bergera koenegii | Ref. |
| - | - | Chamaemalum nobile | Ref. |
| - | - | Curcurbita pepo L. | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Laurencia aldingensis | Ref. |
| - | - | Sebastiana sebiferum | Ref. |
|
|
zoom in
| Organism | Abutilon indicum | | Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|