| Name |
Pinicolic acid A (+)-Pinicolic acid A 3-Oxo-5alpha-lanosta-8,24-dien-21-oic acid |
| Formula |
C30H46O3 |
| Mw |
454.34469533 |
| CAS RN |
466-05-7 |
| C_ID |
C00023786
, 
|
| InChIKey |
XLPAINGDLCDYQV-BPIPOFKQNA-N |
| InChICode |
InChI=1S/C30H46O3/c1-19(2)9-8-10-20(26(32)33)21-13-17-30(7)23-11-12-24-27(3,4)25(31)15-16-28(24,5)22(23)14-18-29(21,30)6/h9,20-21,24H,8,10-18H2,1-7H3,(H,32,33)/t20-,21-,24+,28-,29-,30+/m1/s1 |
| SMILES |
CC(C)=CCC[C@@H](C(=O)O)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CCC(=O)C(C)(C)[C@@H]1CC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Bondarzewiaceae | Heterobasidion tasmanica | Ref. |
| Fungi | Fomitopsidaceae | Fomitopsis pinicola  | Ref. |
| Fungi | Ganodermataceae | Ganoderma sugae | Ref. |
| Fungi | Ganodermataceae | Ganoderma tsugae  | Ref. |
| Fungi | Hymenochaetaceae | Phellinus gilvus  | Ref. |
| Fungi | Polyporaceae | Fomes senex | Ref. |
| - | - | Poria cocos  | Ref. |
|
|
zoom in
| Organism | Poria cocos | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993) |
|---|
|