| Name |
Alpinumisoflavone |
| Formula |
C20H16O5 |
| Mw |
336.09977362 |
| CAS RN |
34086-50-5 |
| C_ID |
C00009492
, 
|
| InChIKey |
RQAMSFTXEFSBPK-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C20H16O5/c1-20(2)8-7-13-15(25-20)9-16-17(18(13)22)19(23)14(10-24-16)11-3-5-12(21)6-4-11/h3-10,21-22H,1-2H3 |
| SMILES |
CC1(C)C=Cc2c(cc3occ(-c4ccc(O)cc4)c(=O)c3c2O)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Fabaceae | Calopogonium mucunoides | Ref. |
| Plantae | Fabaceae | Erythrina indica  | Ref. |
| Plantae | Fabaceae | Erythrina lysistemon  | Ref. |
| Plantae | Fabaceae | Erythrina poeppigiana  | Ref. |
| Plantae | Fabaceae | Erythrina senegalensis  | Ref. |
| Plantae | Fabaceae | Erythrina suberosa var. glabrescences  | Ref. |
| Plantae | Fabaceae | Erythrina variegata  | Ref. |
| Plantae | Fabaceae | Genista ephedroides | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata  | Ref. |
| Plantae | Fabaceae | Laburnum alpinum | Ref. |
| Plantae | Fabaceae | Laburnum anagyroides  | Ref. |
| Plantae | Fabaceae | Millettia taiwaniana | Ref. |
| Plantae | Fabaceae | Millettia thonningii  | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Ulex airensis | Ref. |
| Plantae | Fabaceae | Ulex europaeus subsp. europaeus  | Ref. |
| Plantae | Moraceae | Cudrania cochinchinensis  | Ref. |
| Plantae | Moraceae | Ficus cordata | Ref. |
| Plantae | Moraceae | Ficus nymphaeifolia  | Ref. |
|
|
zoom in
| Organism | Erythrina variegata | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Jackson,J.Chem.Soc.C,(1971),3389
Deshpande,Indian J.Chem.Sect.B,15,(1977),205 |
|---|
|