| Name |
Morin 3,5,7,2',4'-Pentahydroxyflavonol 2-(2,4-Dihydroxyphenyl)-3,5,7-trihydroxy-4H-1-benzopyran-4-one |
| Formula |
C15H10O7 |
| Mw |
302.04265268 |
| CAS RN |
480-16-0 |
| C_ID |
C00004624
, 
|
| InChIKey |
YXOLAZRVSSWPPT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C15H10O7/c16-6-1-2-8(9(18)3-6)15-14(21)13(20)12-10(19)4-7(17)5-11(12)22-15/h1-5,16-19,21H |
| SMILES |
O=c1c(O)c(-c2ccc(O)cc2O)oc2cc(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Lannea coromandelica  | Ref. |
| Plantae | Fabaceae | Crotalaria assamica | Ref. |
| Plantae | Fabaceae | Crotalaria pallida  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Millettia racemosa  | Ref. |
| Plantae | Lauraceae | Machilus bombycina | Ref. |
| Plantae | Moraceae | Artocarpus integrifolia  | Ref. |
| Plantae | Moraceae | Chlorophora tinctoria | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus serrata  | Ref. |
| Plantae | Moraceae | Morus tinctoria | Ref. |
| Plantae | Moraceae | Treculia africana  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
|
|
zoom in
| Organism | Artocarpus integrifolia | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Perkin,J.Chem.Soc.,69,(1896),792
Robinson,J.Chem.Soc.,(1929),61 |
|---|
|