| Name |
Fumaric acid |
| Formula |
C4H4O4 |
| Mw |
116.01095862 |
| CAS RN |
110-17-8 |
| C_ID |
C00001183
, 
|
| InChIKey |
VZCYOOQTPOCHFL-OWOJBTEDSA-N |
| InChICode |
InChI=1S/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)/b2-1+ |
| SMILES |
O=C(O)/C=C/C(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Bacteria | Enterobacteriaceae | Escherichia coli | Ref. |
| Bacteria | Pseudomonadaceae | Pseudomonas putida | Ref. |
| Fungi | Cladoniaceae | Cladonia fallax | Ref. |
| Fungi | Cladoniaceae | Cladonia rangiferina  | Ref. |
| Fungi | Ganodermataceae | Ganoderma japonicum | Ref. |
| Fungi | Mucoraceae | Rhizopus nigricans | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asteraceae | Ageratina conyzoides | Ref. |
| Plantae | Asteraceae | Cirsium wallichii  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Senecio nemorensis | Ref. |
| Plantae | Boraginaceae | Lithospermum arvense  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Crassulaceae | Rhodiola crenulata | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica oleracea  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Daphniphyllaceae | Daphniphyllum calycinum  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia antiquorum  | Ref. |
| Plantae | Fabaceae | Astragalus alopecurus | Ref. |
| Plantae | Fabaceae | Cicer arietinum  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Sophora alopecuroides | Ref. |
| Plantae | Fabaceae | Vicia faba  | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Moraceae | Ficus carica  | Ref. |
| Plantae | Papaveraceae | Glaucium flavum  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Saccharum sinensis | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Polypodiaceae | Pyrrosia shearei | Ref. |
| Plantae | Rosaceae | Malus domestica  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rubiaceae | Morinda officinalis  | Ref. |
| Plantae | Sapotaceae | Sebertia acuminata | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Taxaceae | Torreya yunnanensis | Ref. |
| Plantae | Urticaceae | Urtica dioica  | Ref. |
| Plantae | Zingiberaceae | Curcuma domestica  | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Urtica dioica | | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Li, et al., Journal of Natural Products, 66, (2003), 1002.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979). |
|---|
|