| Name |
Umbelliferone 7-Hydroxycoumarin Umbelliferon |
| Formula |
C9H6O3 |
| Mw |
162.03169406 |
| CAS RN |
93-35-6 |
| C_ID |
C00002503
, 
|
| InChIKey |
ORHBXUUXSCNDEV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H6O3/c10-7-3-1-6-2-4-9(11)12-8(6)5-7/h1-5,10H |
| SMILES |
O=c1ccc2ccc(O)cc2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Adoxaceae | Viburnum wrightii | Ref. |
| Plantae | Apiaceae | Angelica dahurica  | Ref. |
| Plantae | Apiaceae | Angelica furcijuga KITAGAWA | Ref. |
| Plantae | Apiaceae | Angelica gigas  | Ref. |
| Plantae | Apiaceae | Angelica pubescens f.biserrata  | Ref. |
| Plantae | Apiaceae | Angelica spp. | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Apium spp. | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Falcaria vulgaris | Ref. |
| Plantae | Apiaceae | Ferula assa-foetida  | Ref. |
| Plantae | Apiaceae | Ferula diversivittata | Ref. |
| Plantae | Apiaceae | Ferula spp. | Ref. |
| Plantae | Apiaceae | Ferula szovitsiana  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Heracleum candicans WALL.  | Ref. |
| Plantae | Apiaceae | Heracleum dissectum | Ref. |
| Plantae | Apiaceae | Heracleum granatense | Ref. |
| Plantae | Apiaceae | Heracleum spp. | Ref. |
| Plantae | Apiaceae | Ligusticum multivittatum | Ref. |
| Plantae | Apiaceae | Peucedanum bourgaei Lange in Wilk.et Lange. | Ref. |
| Plantae | Apiaceae | Peucedanum praeruptorum DUNN. | Ref. |
| Plantae | Apiaceae | Phlojodicarpus sibiricus | Ref. |
| Plantae | Apiaceae | Pimpinella spp. | Ref. |
| Plantae | Apiaceae | Seseli webbii Cosson. | Ref. |
| Plantae | Apiaceae | Tordylium apulum  | Ref. |
| Plantae | Araliaceae | Aralia fargesii | Ref. |
| Plantae | Asteraceae | Achillea biebersteinii  | Ref. |
| Plantae | Asteraceae | Artemisia minor | Ref. |
| Plantae | Asteraceae | Chamomilla rectita | Ref. |
| Plantae | Asteraceae | Inula helenium L.  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Saussurea laniceps | Ref. |
| Plantae | Biebersteiniaceae | Biebersteinia heterostemon | Ref. |
| Plantae | Biebersteiniaceae | Biebersteinia orphanidis | Ref. |
| Plantae | Crassulaceae | Rhodiola sacra | Ref. |
| Plantae | Crassulaceae | Sedum ewersii | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Euphorbiaceae | Euphorbia humifusa | Ref. |
| Plantae | Fabaceae | Acacia ehrenbergiana  | Ref. |
| Plantae | Fabaceae | Astragalus brachycarpus | Ref. |
| Plantae | Fabaceae | Copaifera langsdorffii  | Ref. |
| Plantae | Fabaceae | Coronilla valentina | Ref. |
| Plantae | Fabaceae | Coronilla varia  | Ref. |
| Plantae | Fabaceae | Melilotus alba | Ref. |
| Plantae | Fabaceae | Melilotus suaveolens  | Ref. |
| Plantae | Fabaceae | Onobrychis kemularia | Ref. |
| Plantae | Fabaceae | Onobrychis kemulariae | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Securigera elegans | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Vicia sativa  | Ref. |
| Plantae | Fabaceae | Vigna radiata  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Hydrangeaceae | Hydrangea chinensis | Ref. |
| Plantae | Hydrangeaceae | Hydrangea macrophylla Ser.var.thunbergii Makino.  | Ref. |
| Plantae | Hydrangeaceae | Hydrangea paniculata  | Ref. |
| Plantae | Hydrangeaceae | Hydrangea vestita | Ref. |
| Plantae | Hydrangeaceae | Pileostegia viburnoides var. glabrescens | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Meliaceae | Khaya ivorensis  | Ref. |
| Plantae | Moraceae | Dorstenia brasiliensis  | Ref. |
| Plantae | Moraceae | Dorstenia turbinata | Ref. |
| Plantae | Moraceae | Ficus carica  | Ref. |
| Plantae | Moraceae | Ficus cunninghamii | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus cathayana | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Picramniaceae | Picramnia antidesma  | Ref. |
| Plantae | Picramniaceae | Picramnia latifolia | Ref. |
| Plantae | Picramniaceae | Picramnia teapensis Tul. | Ref. |
| Plantae | Ranunculaceae | Adonis amurensis  | Ref. |
| Plantae | Ranunculaceae | Adonis tienschanicus | Ref. |
| Plantae | Ranunculaceae | Caltha palustris  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Citrus bergamia  | Ref. |
| Plantae | Rutaceae | Citrus grandis  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus sinensis cv.Valencia  | Ref. |
| Plantae | Rutaceae | Clausena anisata  | Ref. |
| Plantae | Rutaceae | Clausena excavata  | Ref. |
| Plantae | Rutaceae | Dictamnus angustifolius | Ref. |
| Plantae | Rutaceae | Haplophyllum patavinum | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Murraya siamensis | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
| Plantae | Rutaceae | Poncirus trifoliata  | Ref. |
| Plantae | Rutaceae | Ruta chalepensis  | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Rutaceae | Severinia buxifolia  | Ref. |
| Plantae | Rutaceae | Zanthoxylum schinifolium  | Ref. |
| Plantae | Rutaceae | Zanthoxylum wutaiense | Ref. |
| Plantae | Solanaceae | Atropa belladonna  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Thymelaeaceae | Daphne odora Thunb.  | Ref. |
| Plantae | Thymelaeaceae | Daphne oleoides ssp. oleoides  | Ref. |
| Plantae | Thymelaeaceae | Edgeworthia chrysantha | Ref. |
| Plantae | Thymelaeaceae | Stellera chamaejasme L.  | Ref. |
| Plantae | Thymelaeaceae | Wikstroemia elliptica | Ref. |
| - | - | Platytaenia dasycarpa | Ref. |
|
|
zoom in
| Organism | Trifolium pratense | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|