| Name |
(-)-Butyrospermol Butyrospermol |
| Formula |
C30H50O |
| Mw |
426.38616622 |
| CAS RN |
472-28-6 |
| C_ID |
C00011163
, 
|
| InChIKey |
DICCPNLDOZNSML-ZADQKWDXNA-N |
| InChICode |
InChI=1S/C30H50O/c1-20(2)10-9-11-21(3)22-14-18-30(8)24-12-13-25-27(4,5)26(31)16-17-28(25,6)23(24)15-19-29(22,30)7/h10,12,21-23,25-26,31H,9,11,13-19H2,1-8H3/t21-,22+,23+,25+,26+,28-,29+,30-/m1/s1 |
| SMILES |
CC(C)=CCC[C@@H](C)[C@@H]1CC[C@]2(C)C3=CC[C@H]4C(C)(C)[C@@H](O)CC[C@]4(C)[C@H]3CC[C@@]12C |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Ligularia dentata Hara | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Euphorbiaceae | Euphorbia guyoniana | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lathyris  | Ref. |
| Plantae | Moraceae | Dorstenia poinsettifolia | Ref. |
| Plantae | Ranunculaceae | Nigella sativa  | Ref. |
| Plantae | Salicaceae | Populus tremula L.  | Ref. |
|
|
zoom in
| Organism | Nigella sativa | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|