| Name |
Quercetagetin 3'-methyl ether |
| Formula |
C16H12O8 |
| Mw |
332.05321736 |
| CAS RN |
57093-48-8 |
| C_ID |
C00004682
, 
|
| InChIKey |
APUSTZNOWHEAEP-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O8/c1-23-9-4-6(2-3-7(9)17)16-15(22)14(21)11-10(24-16)5-8(18)12(19)13(11)20/h2-5,17-20,22H,1H3 |
| SMILES |
COc1cc(-c2oc3cc(O)c(O)c(O)c3c(=O)c2O)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Asteraceae | Anacyclus spp. | Ref. |
| Plantae | Asteraceae | Centaurea spp. | Ref. |
| Plantae | Asteraceae | Chrysanthemum coronarium  | Ref. |
| Plantae | Asteraceae | Clibadium spp. | Ref. |
| Plantae | Asteraceae | Eupatorium tinifolium | Ref. |
| Plantae | Asteraceae | Lepidophorum spp. | Ref. |
|
|
zoom in
| Organism | Lepidophorum spp. | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Harborne,Phytochem.,9,(1970),2011 |
|---|
|