| Name |
Orientin 8-beta-D-Glucopyranosyl-3',4',5,7-tetrahydroxyflavone Luteolin 8-C-beta-D-glucopyranoside Lutexin |
| Formula |
C21H20O11 |
| Mw |
448.10056148 |
| CAS RN |
28608-75-5 |
| C_ID |
C00001078
, 
|
| InChIKey |
PLAPMLGJVGLZOV-RJFRUACSNA-N |
| InChICode |
InChI=1S/C21H20O11/c22-6-14-17(28)18(29)19(30)21(32-14)16-11(26)4-10(25)15-12(27)5-13(31-20(15)16)7-1-2-8(23)9(24)3-7/h1-5,14,17-19,21-26,28-30H,6H2/t14-,17+,18-,19+,21-/m0/s1 |
| SMILES |
O=c1cc(-c2ccc(O)c(O)c2)oc2c([C@@H]3OC(CO)[C@@H](O)[C@H](O)C3O)c(O)cc(O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Acanthaceae | Clinacanthus nutans | Ref. |
| Plantae | Araceae | Colocasia esculenta  | Ref. |
| Plantae | Araceae | Colocasia escultenta | Ref. |
| Plantae | Asteraceae | Centaurea gigantea | Ref. |
| Plantae | Asteraceae | Centaurea melitensis L. | Ref. |
| Plantae | Asteraceae | Centaurea solstitialis | Ref. |
| Plantae | Caryophyllaceae | Lychnis flos-cuculi L. | Ref. |
| Plantae | Caryophyllaceae | Silene spp. | Ref. |
| Plantae | Caryophyllaceae | Stellaria holostea | Ref. |
| Plantae | Caryophyllaceae | Stellaria nemorum | Ref. |
| Plantae | Chloranthaceae | Ascarina lucida | Ref. |
| Plantae | Commelinaceae | Commelina communis L  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus  | Ref. |
| Plantae | Cyatheaceae | Cyathea spp. | Ref. |
| Plantae | Cyperaceae | Cyperus alopecuroides | Ref. |
| Plantae | Euphorbiaceae | Euphorbia supina Rafin | Ref. |
| Plantae | Fabaceae | Gleditsia sinensis Lam.  | Ref. |
| Plantae | Fabaceae | Lespedeza bicolor  | Ref. |
| Plantae | Fabaceae | Lespedeza hedysaroides | Ref. |
| Plantae | Fabaceae | Retama raetam  | Ref. |
| Plantae | Fabaceae | Tamarindus indica  | Ref. |
| Plantae | Fabaceae | Trigonella foenum-graecum  | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Geraniaceae | Pelargonium sidoides  | Ref. |
| Plantae | Labiatae | Isodon rubescens var. lushanensis | Ref. |
| Plantae | Labiatae | Vitex cannabifolia Sieb.et.Zucc. | Ref. |
| Plantae | Labiatae | Vitex polygama | Ref. |
| Plantae | Linaceae | Linum usitatissimum  | Ref. |
| Plantae | Lythraceae | Lythrum salicaria  | Ref. |
| Plantae | Malvaceae | Theobroma cacao L.  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
| Plantae | Passifloraceae | Passiflora incarnata  | Ref. |
| Plantae | Passifloraceae | Passiflora serratodigitata | Ref. |
| Plantae | Petrosaviaceae/Nartheciaceae | Japonolirion osense | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Poaceae | Hordeum vulgare  | Ref. |
| Plantae | Poaceae | Pennisetum americanum  | Ref. |
| Plantae | Podocarpaceae | Podocarpus fasciculus | Ref. |
| Plantae | Polygonaceae | Fagopyrum esculentum  | Ref. |
| Plantae | Polygonaceae | Polygonum orientale  | Ref. |
| Plantae | Primulaceae | Primula veris  | Ref. |
| Plantae | Ranunculaceae | Ranunculus japonicus | Ref. |
| Plantae | Ranunculaceae | Trollius chinensis | Ref. |
| Plantae | Ranunculaceae | Trollius ledebouri | Ref. |
| Plantae | Ranunculaceae | Trollius macropetalus | Ref. |
| Plantae | Rhamnaceae | Rhamnus davurica | Ref. |
| Plantae | Taxaceae | Taxus chinensis | Ref. |
| Plantae | Turneraceae | Turnera diffusa  | Ref. |
| - | - | Siegesbeckia orientalis  | Ref. |
|
|
zoom in
| Organism | Trollius chinensis | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Liu, et al., APS, 27, (1992), 837.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
McNally, et al., JNP, 66, (2003), 1280.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009) |
|---|
|