| Name |
Suberic acid |
| Formula |
C8H14O4 |
| Mw |
174.08920894 |
| CAS RN |
505-48-6 |
| C_ID |
C00001204
, 
|
| InChIKey |
TYFQFVWCELRYAO-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C8H14O4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-6H2,(H,9,10)(H,11,12) |
| SMILES |
O=C(O)CCCCCCC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Bufonidae | Bufo bufo gargarizans | Ref. |
| Animalia | Hominidae | Homo sapiens (Urine) | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Euphorbiaceae | Ricinus communis  | Ref. |
| Plantae | Malvaceae | Hibiscus syriacus  | Ref. |
|
|
zoom in
| Organism | Hibiscus syriacus | | Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Zhang, et al., CCMM, 18, (1993), 37 |
|---|
|