| Name |
Loganate
Loganic acid |
| Formula |
C16H24O10 |
| Mw |
376.13694699 |
| CAS RN |
22255-40-9 |
| C_ID |
C00010604
, 
|
| InChIKey |
JNNGEAWILNVFFD-MVRWXDQTNA-N |
| InChICode |
InChI=1S/C16H24O10/c1-5-8(18)2-6-7(14(22)23)4-24-15(10(5)6)26-16-13(21)12(20)11(19)9(3-17)25-16/h4-6,8-13,15-21H,2-3H2,1H3,(H,22,23)/t5-,6+,8-,9+,10-,11+,12-,13-,15-,16?/m0/s1 |
| SMILES |
C[C@@H]1[C@H]2[C@H](O[C@@H]3OC(CO)[C@@H](O)C(O)[C@@H]3O)OC=C(C(=O)O)[C@H]2C[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus | Ref. |
| Plantae | Apocynaceae | Rauwolfia serpentina | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Alangium lamarckii | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis | Ref. |
| Plantae | Gentianaceae | Centaurium erythraea | Ref. |
| Plantae | Gentianaceae | Frasera caroliniensis | Ref. |
| Plantae | Gentianaceae | Gentiana algida | Ref. |
| Plantae | Gentianaceae | Gentiana crassicaulis | Ref. |
| Plantae | Gentianaceae | Gentiana decumbers | Ref. |
| Plantae | Gentianaceae | Gentiana lawrencei | Ref. |
| Plantae | Gentianaceae | Gentiana loureirii | Ref. |
| Plantae | Gentianaceae | Gentiana lutea | Ref. |
| Plantae | Gentianaceae | Gentiana macrophylla | Ref. |
| Plantae | Gentianaceae | Gentiana manshurica | Ref. |
| Plantae | Gentianaceae | Gentiana officinalis | Ref. |
| Plantae | Gentianaceae | Gentiana rhodantha | Ref. |
| Plantae | Gentianaceae | Gentiana rigescens | Ref. |
| Plantae | Gentianaceae | Gentiana scabra | Ref. |
| Plantae | Gentianaceae | Gentiana straminea | Ref. |
| Plantae | Gentianaceae | Gentiana triflora | Ref. |
| Plantae | Gentianaceae | Swertia carolinensis | Ref. |
| Plantae | Gentianaceae | Swertia davidii | Ref. |
| Plantae | Gentianaceae | Tripterospermum japonicum | Ref. |
| Plantae | Longaniaceae | Strychnos axillaris | Ref. |
| Plantae | Longaniaceae | Strychnos lucida | Ref. |
| Plantae | Longaniaceae | Strychnos nux-vomica | Ref. |
| Plantae | Oleaceae | Fontanesia fortunei Carr. | Ref. |
| Plantae | Oleaceae | Fontanesia phillyreoides Labill. | Ref. |
| Plantae | Oleaceae | Osmanthus austrocaledonicus (Vieill.) Knobl. | Ref. |
| Plantae | Oleaceae | Picconia excelsa (Aiton) DC. | Ref. |
| Plantae | Rubiaceae | Ophiorrhiza liukiuensis | Ref. |
| Plantae | Rubiaceae | Sinoadina Racemosa | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa | Ref. |
| Plantae | Verbenaceae | Lippia graveolens | Ref. |
| - | - | Radix gentianae | Ref. |
| - | - | Sertia mussotii | Ref. |
|
|
zoom in
| Organism | Sinoadina Racemosa |
|---|
| Reference | Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Huang, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 22, (1997), 247.
Itoh, et al., Journal of Natural Products, 67, (2004), 427.
OTSUKA, et al., Chem Pharm Bull, 49, (2001), 699.
KITAJIMA, et al., Chem Pharm Bull, 53, (2005), 1355.
Peng, et al., Chinese J of Pharm Analysis, 30, (2010), 623 |
|---|
|
