| Name |
(E)-geraniol Geraniol trans-Geraniol |
| Formula |
C10H18O |
| Mw |
154.1357652 |
| CAS RN |
106-24-1 |
| C_ID |
C00000845
, 
|
| InChIKey |
GLZPCOQZEFWAFX-JXMROGBWSA-N |
| InChICode |
InChI=1S/C10H18O/c1-9(2)5-4-6-10(3)7-8-11/h5,7,11H,4,6,8H2,1-3H3/b10-7+ |
| SMILES |
CC(C)=CCC/C(C)=C/CO |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Bupleurum chinense | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Chamomilla rectita | Ref. |
| Plantae | Asteraceae | Conyza newii  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Asteraceae | Phagnalon sordidum | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Codiaceae | Codium fragile  | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Crassulaceae | Rhodiola rosea L.  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Gentianaceae | Centaurium erythraea  | Ref. |
| Plantae | Geraniaceae | Erodium stephanianum | Ref. |
| Plantae | Geraniaceae | Pelargonium capitatum  | Ref. |
| Plantae | Geraniaceae | Pelargonium graveolens  | Ref. |
| Plantae | Labiatae | Dracocephalum moldavica  | Ref. |
| Plantae | Labiatae | Elsholtzia ciliata  | Ref. |
| Plantae | Labiatae | Lavandula angustifolia  | Ref. |
| Plantae | Labiatae | Melissa officinalis  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Ocimum sanctum  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus daenensis | Ref. |
| Plantae | Labiatae | Thymus pubescens | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Lauraceae | Cinnamomum camphora  | Ref. |
| Plantae | Lauraceae | Laurus nobilis  | Ref. |
| Plantae | Lauraceae | Litsea cubeba  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Myrtaceae | Acca sellowiana | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Pinaceae | Picea schrenkiana | Ref. |
| Plantae | Piperaceae | Piper fimbriulatum | Ref. |
| Plantae | Poaceae | Andropogon schoenanthus | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Poaceae | Cymbopogon distans | Ref. |
| Plantae | Poaceae | Cymbopogon martinii  | Ref. |
| Plantae | Polygonaceae | Polygonum minus | Ref. |
| Plantae | Polygonaceae | Polygonum odoratum  | Ref. |
| Plantae | Rosaceae | Prunus armeniaca L. (K604-19,K113-40,K33-81)  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Rosa damascena  | Ref. |
| Plantae | Rosaceae | Rosa gallica  | Ref. |
| Plantae | Rosaceae | Rosa rugosa  | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Rutaceae | Citrus aurantium  | Ref. |
| Plantae | Rutaceae | Citrus grandis  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus medica  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis L.  | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Poncirus trifoliate x Citrus sinensis | Ref. |
| Plantae | Santalaceae | Santalum album  | Ref. |
| Plantae | Saxifragaceae | Saxifraga stolonifera Meerb.  | Ref. |
| Plantae | Schisandraceae | Schisandra chinensis  | Ref. |
| Plantae | Scrophulariaceae | Rehmannia glutinosa  | Ref. |
| Plantae | Solanaceae | Nicotiana benthamiana  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Nicotiana tobacum | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Taxodiaceae | Taiwania cryptomerioides | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Verbenaceae | Lantana camara L.  | Ref. |
| Plantae | Zingiberaceae | Boesenbergia rotunda (LINN.) MANSF.  | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Baeckea frutescens L.  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Sertia mussotii | Ref. |
|
|
zoom in
| Organism | Thymus daenensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 4, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|