| Name |
Daphnetin |
| Formula |
C9H6O4 |
| Mw |
178.02660868 |
| CAS RN |
486-35-1 |
| C_ID |
C00002462
, 
|
| InChIKey |
ATEFPOUAMCWAQS-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H6O4/c10-6-3-1-5-2-4-7(11)13-9(5)8(6)12/h1-4,10,12H |
| SMILES |
O=c1ccc2ccc(O)c(O)c2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Pucciniaceae | Puccinia graminis | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia lathyris | Ref. |
| Plantae | Fabaceae | Acacia pennatula | Ref. |
| Plantae | Fabaceae | Cicer arietinum | Ref. |
| Plantae | Hydrangeaceae | Pileostegia viburnoides var. glabrescens | Ref. |
| Plantae | Solanaceae | Solanum tuberosum | Ref. |
| Plantae | Thymelaeaceae | Daphne odora | Ref. |
| Plantae | Thymelaeaceae | Daphne oleoides ssp. oleoides | Ref. |
| Plantae | Thymelaeaceae | Daphne tangutica | Ref. |
| Plantae | Thymelaeaceae | Stellera chamaejasme L. | Ref. |
|
|
zoom in
| Organism | Acacia pennatula |
|---|
| Reference | Singh, B and Sharma, R. A., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|
