| Name |
Rutacridone |
| Formula |
C19H17NO3 |
| Mw |
307.12084342 |
| CAS RN |
17948-33-3 |
| C_ID |
C00002196
, 
|
| InChIKey |
FHAGACMCMQYSNX-UHFFFAOYNA-N |
| InChICode |
InChI=1S/C19H17NO3/c1-10(2)15-8-12-16(23-15)9-14(21)17-18(12)20(3)13-7-5-4-6-11(13)19(17)22/h4-7,9,15,21H,1,8H2,2-3H3/t15-/m0/s1 |
| SMILES |
C=C(C)C1Cc2c(cc(O)c3c(=O)c4ccccc4n(C)c23)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
Anthranilate |
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Rutaceae | Boenninghausenia albiflora  | Ref. |
| Plantae | Rutaceae | Ruta callus cultures | Ref. |
| Plantae | Rutaceae | Ruta chalepensis | Ref. |
| Plantae | Rutaceae | Ruta graveolens | Ref. |
| Plantae | Rutaceae | Ruta graveolensis | Ref. |
| Plantae | Rutaceae | Ruta macrophylla | Ref. |
| Plantae | Rutaceae | Thamnosma montana | Ref. |
| Plantae | Rutaceae | Thamnosma rhodesica | Ref. |
|
|
zoom in
| Organism | Ruta graveolens |
|---|
| Reference | Edited by Jiangsu New Medicinal College, Chinese Medicine Dictionary, Shanghai Science and technology Press, Shanghai, (1979).
Ahua, et al., Phytochemistry, 65, (2004), 963.
Meepagala, et al., Phytochemistry, 66, (2005), 2689
Harborne,Phytochemical Dictionary Second Edition,Taylor and Francis,(1999),Chapter27 |
|---|
|
