| Name |
Umbelliferone 7-Hydroxycoumarin Umbelliferon |
| Formula |
C9H6O3 |
| Mw |
162.03169406 |
| CAS RN |
93-35-6 |
| C_ID |
C00002503
, 
|
| InChIKey |
ORHBXUUXSCNDEV-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C9H6O3/c10-7-3-1-6-2-4-9(11)12-8(6)5-7/h1-5,10H |
| SMILES |
O=c1ccc2ccc(O)cc2o1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Adoxaceae | Viburnum wrightii | Ref. |
| Plantae | Apiaceae | Angelica dahurica  | Ref. |
| Plantae | Apiaceae | Angelica furcijuga KITAGAWA | Ref. |
| Plantae | Apiaceae | Angelica gigas  | Ref. |
| Plantae | Apiaceae | Angelica pubescens f.biserrata  | Ref. |
| Plantae | Apiaceae | Angelica spp. | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Apium spp. | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Falcaria vulgaris | Ref. |
| Plantae | Apiaceae | Ferula assa-foetida  | Ref. |
| Plantae | Apiaceae | Ferula diversivittata | Ref. |
| Plantae | Apiaceae | Ferula spp. | Ref. |
| Plantae | Apiaceae | Ferula szovitsiana  | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Apiaceae | Heracleum candicans WALL.  | Ref. |
| Plantae | Apiaceae | Heracleum dissectum | Ref. |
| Plantae | Apiaceae | Heracleum granatense | Ref. |
| Plantae | Apiaceae | Heracleum spp. | Ref. |
| Plantae | Apiaceae | Ligusticum multivittatum | Ref. |
| Plantae | Apiaceae | Peucedanum bourgaei Lange in Wilk.et Lange. | Ref. |
| Plantae | Apiaceae | Peucedanum praeruptorum DUNN. | Ref. |
| Plantae | Apiaceae | Phlojodicarpus sibiricus | Ref. |
| Plantae | Apiaceae | Pimpinella spp. | Ref. |
| Plantae | Apiaceae | Seseli webbii Cosson. | Ref. |
| Plantae | Apiaceae | Tordylium apulum  | Ref. |
| Plantae | Araliaceae | Aralia fargesii | Ref. |
| Plantae | Asteraceae | Achillea biebersteinii  | Ref. |
| Plantae | Asteraceae | Artemisia minor | Ref. |
| Plantae | Asteraceae | Chamomilla rectita | Ref. |
| Plantae | Asteraceae | Inula helenium L.  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Saussurea laniceps | Ref. |
| Plantae | Biebersteiniaceae | Biebersteinia heterostemon | Ref. |
| Plantae | Biebersteiniaceae | Biebersteinia orphanidis | Ref. |
| Plantae | Crassulaceae | Rhodiola sacra | Ref. |
| Plantae | Crassulaceae | Sedum ewersii | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Euphorbiaceae | Euphorbia humifusa | Ref. |
| Plantae | Fabaceae | Acacia ehrenbergiana  | Ref. |
| Plantae | Fabaceae | Astragalus brachycarpus | Ref. |
| Plantae | Fabaceae | Copaifera langsdorffii  | Ref. |
| Plantae | Fabaceae | Coronilla valentina | Ref. |
| Plantae | Fabaceae | Coronilla varia  | Ref. |
| Plantae | Fabaceae | Melilotus alba | Ref. |
| Plantae | Fabaceae | Melilotus suaveolens  | Ref. |
| Plantae | Fabaceae | Onobrychis kemularia | Ref. |
| Plantae | Fabaceae | Onobrychis kemulariae | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Securigera elegans | Ref. |
| Plantae | Fabaceae | Trifolium pratense  | Ref. |
| Plantae | Fabaceae | Vicia sativa  | Ref. |
| Plantae | Fabaceae | Vigna radiata  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Hydrangeaceae | Hydrangea chinensis | Ref. |
| Plantae | Hydrangeaceae | Hydrangea macrophylla Ser.var.thunbergii Makino.  | Ref. |
| Plantae | Hydrangeaceae | Hydrangea paniculata  | Ref. |
| Plantae | Hydrangeaceae | Hydrangea vestita | Ref. |
| Plantae | Hydrangeaceae | Pileostegia viburnoides var. glabrescens | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Meliaceae | Khaya ivorensis  | Ref. |
| Plantae | Moraceae | Dorstenia brasiliensis  | Ref. |
| Plantae | Moraceae | Dorstenia turbinata | Ref. |
| Plantae | Moraceae | Ficus carica  | Ref. |
| Plantae | Moraceae | Ficus cunninghamii | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus cathayana | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Picramniaceae | Picramnia antidesma  | Ref. |
| Plantae | Picramniaceae | Picramnia latifolia | Ref. |
| Plantae | Picramniaceae | Picramnia teapensis Tul. | Ref. |
| Plantae | Ranunculaceae | Adonis amurensis  | Ref. |
| Plantae | Ranunculaceae | Adonis tienschanicus | Ref. |
| Plantae | Ranunculaceae | Caltha palustris  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Citrus bergamia  | Ref. |
| Plantae | Rutaceae | Citrus grandis  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Citrus sinensis cv.Valencia  | Ref. |
| Plantae | Rutaceae | Clausena anisata  | Ref. |
| Plantae | Rutaceae | Clausena excavata  | Ref. |
| Plantae | Rutaceae | Dictamnus angustifolius | Ref. |
| Plantae | Rutaceae | Haplophyllum patavinum | Ref. |
| Plantae | Rutaceae | Murraya paniculata  | Ref. |
| Plantae | Rutaceae | Murraya siamensis | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
| Plantae | Rutaceae | Poncirus trifoliata  | Ref. |
| Plantae | Rutaceae | Ruta chalepensis  | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Rutaceae | Severinia buxifolia  | Ref. |
| Plantae | Rutaceae | Zanthoxylum schinifolium  | Ref. |
| Plantae | Rutaceae | Zanthoxylum wutaiense | Ref. |
| Plantae | Solanaceae | Atropa belladonna  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Thymelaeaceae | Daphne odora Thunb.  | Ref. |
| Plantae | Thymelaeaceae | Daphne oleoides ssp. oleoides  | Ref. |
| Plantae | Thymelaeaceae | Edgeworthia chrysantha | Ref. |
| Plantae | Thymelaeaceae | Stellera chamaejasme L.  | Ref. |
| Plantae | Thymelaeaceae | Wikstroemia elliptica | Ref. |
| - | - | Platytaenia dasycarpa | Ref. |
|
|
zoom in
| Organism | Aralia fargesii | | Reference | Ji, et al., Pharmacological Action and Application of Available Composition of Traditional Chinese Medicine, Heilongjiang Science and technology Press, Heilongjiang, (1995).
Liu, et al., APS, 26, (1991), 836.
Zhang, et al., APS, 30, (1995), 211.
Liu, et al., CCMM, 20, (1995), 738.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Kang, et al., JNP, 64, (2001), 683.
Patnam, et al., JNP, 64, (2001), 948.
MATSUDA, et al., Chem Pharm Bull, 53, (2005), 387.
CHIU, et al., Chem Pharm Bull, 53, (2005), 1118.
Wu, et al., JNP, 66, (2003), 1207.
Ito, et al., Planta Med, 71, (2005), 84.
Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003) |
|---|
|