| Name |
Aesculetin dimethyl ether 6,7-Dimethoxycoumarin Scoparone |
| Formula |
C11H10O4 |
| Mw |
206.05790881 |
| CAS RN |
120-08-1 |
| C_ID |
C00002498
, 
|
| InChIKey |
GUAFOGOEJLSQBT-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C11H10O4/c1-13-9-5-7-3-4-11(12)15-8(7)6-10(9)14-2/h3-6H,1-2H3 |
| SMILES |
COc1cc2ccc(=O)oc2cc1OC |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Apiaceae | Bupleurum fruticescens | Ref. |
| Plantae | Apiaceae | Ferula oopoda  | Ref. |
| Plantae | Araliaceae | Aralia chinensis | Ref. |
| Plantae | Araliaceae | Aralia fargesii | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Artemisia capillaris  | Ref. |
| Plantae | Asteraceae | Artemisia granatensis  | Ref. |
| Plantae | Asteraceae | Artemisia scoparia  | Ref. |
| Plantae | Asteraceae | Gonospermum fruticosum | Ref. |
| Plantae | Asteraceae | Gonospermum gomerae | Ref. |
| Plantae | Celastraceae | Microtropis japonica | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia multiflora  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Fabaceae | Echinosophora koreensis | Ref. |
| Plantae | Fabaceae | Pueraria lobata  | Ref. |
| Plantae | Gentianaceae | Gentiana kuroo | Ref. |
| Plantae | Gentianaceae | Gentiana kurroo  | Ref. |
| Plantae | Magnoliaceae | Liriodendron tulipifera  | Ref. |
| Plantae | Malvaceae | Abutilon indicum  | Ref. |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
| Plantae | Malvaceae | Sida galheirensis | Ref. |
| Plantae | Meliaceae | Cedrelopsis grevei | Ref. |
| Plantae | Meliaceae | Cedrelopsis grevei Baill | Ref. |
| Plantae | Meliaceae | Khaya ivorensis  | Ref. |
| Plantae | Meliaceae | Khaya senegalensis L.  | Ref. |
| Plantae | Oleaceae | Forsythia suspensa  | Ref. |
| Plantae | Orchidaceae | Dendrobium aurantiacum var.denneanum | Ref. |
| Plantae | Orchidaceae | Dendrobium capillipes | Ref. |
| Plantae | Orchidaceae | Dendrobium densiflorum | Ref. |
| Plantae | Orchidaceae | Dendrobium thyrsiflorum | Ref. |
| Plantae | Rubiaceae | Rubia wallichiana DECNE  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Boronella koniambiensis | Ref. |
| Plantae | Rutaceae | Citrus sinensis cv.Valencia  | Ref. |
| Plantae | Rutaceae | Dictamnus angustifolius | Ref. |
| Plantae | Rutaceae | Fagara macrophylla  | Ref. |
| Plantae | Rutaceae | Phellodendron amurense  | Ref. |
| Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
| Plantae | Rutaceae | Zanthoxylum acanthopodium  | Ref. |
| Plantae | Rutaceae | Zanthoxylum ailanthoides | Ref. |
| Plantae | Rutaceae | Zanthoxylum integrifoliolum | Ref. |
| Plantae | Rutaceae | Zanthoxylum nitidum  | Ref. |
| Plantae | Rutaceae | Zanthoxylum schinifolium  | Ref. |
| Plantae | Rutaceae | Zanthoxylum simulans | Ref. |
| Plantae | Verbenaceae | Duranta repens | Ref. |
|
|
zoom in
| Organism | Sida galheirensis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|