| Name |
Ethyl 4-hydroxy-3-methoxycinnamate Ethyl ferulate |
| Formula |
C12H14O4 |
| Mw |
222.08920894 |
| CAS RN |
4046-02-0 |
| C_ID |
C00031779
, 
|
| InChIKey |
ATJVZXXHKSYELS-FNORWQNLSA-N |
| InChICode |
InChI=1S/C12H14O4/c1-3-16-12(14)7-5-9-4-6-10(13)11(8-9)15-2/h4-8,13H,3H2,1-2H3/b7-5+ |
| SMILES |
CCOC(=O)/C=C/c1ccc(O)c(OC)c1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Rosaceae | Spiraea formosana  | Ref. |
| Plantae | Solanaceae | Solanum nigrum  | Ref. |
|
|
zoom in
| Organism | Solanum nigrum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|