| Name |
Kaempferol 5-methyl ether |
| Formula |
C16H12O6 |
| Mw |
300.06338812 |
| CAS RN |
22044-80-0 |
| C_ID |
C00004566
, 
|
| InChIKey |
ZWWRUVANJRMPKX-UHFFFAOYSA-N |
| InChICode |
InChI=1S/C16H12O6/c1-21-11-6-10(18)7-12-13(11)14(19)15(20)16(22-12)8-2-4-9(17)5-3-8/h2-7,17-18,20H,1H3 |
| SMILES |
COc1cc(O)cc2oc(-c3ccc(O)cc3)c(O)c(=O)c12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Ericaceae | Erica vagans | Ref. |
| Plantae | Ericaceae | Gaultheria veitchiana | Ref. |
| Plantae | Ericaceae | Kalmiopsis leachiana | Ref. |
| Plantae | Ericaceae | Rhododendron racemosum | Ref. |
| Plantae | Ericaceae | Rhodothamnus chamaecistus | Ref. |
|
|
zoom in
| Organism | Kalmiopsis leachiana | | Reference | Harborne, The Handbook of Natural Flavonoids, 1, (1999), 181.Flavonols
Harborne,Phytochem.,8,(1969),419 |
|---|
|