| Name |
Phaseolin
(-)-Phaseollin |
| Formula |
C20H18O4 |
| Mw |
322.12050906 |
| CAS RN |
13401-40-6 |
| C_ID |
C00002559
, 
|
| InChIKey |
LWTDZKXXJRRKDG-FPOITTPVNA-N |
| InChICode |
InChI=1S/C20H18O4/c1-20(2)8-7-14-16(24-20)6-5-12-15-10-22-17-9-11(21)3-4-13(17)19(15)23-18(12)14/h3-9,15,19,21H,10H2,1-2H3/t15-,19-/m0/s1 |
| SMILES |
CC1(C)C=Cc2c(ccc3c2O[C@H]2c4ccc(O)cc4OC[C@@H]32)O1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Euphorbiaceae | Ricinus communis  | Ref. |
| Plantae | Fabaceae | Canavalia ensiformis | Ref. |
| Plantae | Fabaceae | Erythrina abyssinica | Ref. |
| Plantae | Fabaceae | Erythrina burttii | Ref. |
| Plantae | Fabaceae | Erythrina sigmoidea | Ref. |
| Plantae | Fabaceae | Erythrina suberosa var. glabrescences | Ref. |
| Plantae | Fabaceae | Erythrina variegata | Ref. |
| Plantae | Fabaceae | Glycine max | Ref. |
| Plantae | Fabaceae | Glycyrrhiza inflata | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris | Ref. |
| Plantae | Fabaceae | Vigna mungo | Ref. |
| Plantae | Fabaceae | Vigna unguiculata | Ref. |
|
|
zoom in
| Organism | Erythrina abyssinica |
|---|
| Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 517,Isoflavonoids and neoflavonoids
Cruickshank,Phytopathol.Z.,70,(1971),209
Bailey,Physiol.Plant Pathol.,1,(1971),451 |
|---|
|
