| Name |
Trametenolic acid 3beta-Hydroxylanosta-8,24-dien-21-oic acid (+)-Trametenolic acid B |
| Formula |
C30H48O3 |
| Mw |
456.3603454 |
| CAS RN |
24160-36-9 |
| C_ID |
C00023783
, 
|
| InChIKey |
NBSBUIQBEPROBM-HWMAWYSZNA-N |
| InChICode |
InChI=1S/C30H48O3/c1-19(2)9-8-10-20(26(32)33)21-13-17-30(7)23-11-12-24-27(3,4)25(31)15-16-28(24,5)22(23)14-18-29(21,30)6/h9,20-21,24-25,31H,8,10-18H2,1-7H3,(H,32,33)/t20-,21-,24+,25+,28-,29-,30+/m1/s1 |
| SMILES |
CC(C)=CCC[C@@H](C(=O)O)[C@H]1CC[C@@]2(C)C3=C(CC[C@]12C)[C@@]1(C)CC[C@H](O)C(C)(C)[C@@H]1CC3 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Fungi | Bondarzewiaceae | Heterobasidion tasmanica | Ref. |
| Fungi | Fomitopsidaceae | Daedalea trabea | Ref. |
| Fungi | Fomitopsidaceae | Fomitopsis pinicola  | Ref. |
| Fungi | Ganodermataceae | Ganoderma tsugae  | Ref. |
| Fungi | Gloeophyllaceae | Veluticeps angularis | Ref. |
| Fungi | Hymenochaetaceae | Inonotus obliquus  | Ref. |
| Fungi | Hymenochaetaceae | Phellinus gilvus  | Ref. |
| Fungi | Hymenochaetaceae | Phellinus gilvus TMC-1117  | Ref. |
| Fungi | Polyporaceae | Laetiporus sulphureus  | Ref. |
| Fungi | Polyporaceae | Lentinus lepideus  | Ref. |
| Fungi | Polyporaceae | Lenzites trabea | Ref. |
| Fungi | Polyporaceae | Trametes odorata | Ref. |
| Fungi | Polyporaceae | Tyromyces fissilis | Ref. |
| - | - | Fomex senex | Ref. |
| - | - | Gloephyllum abietinum | Ref. |
| - | - | Gloephyllum odoratum | Ref. |
| - | - | Gloephyllum sepiarium | Ref. |
| - | - | Gloephyllum striatum | Ref. |
| - | - | Gloephyllum trabeum | Ref. |
| - | - | Poria cocos  | Ref. |
| - | - | Spongiporus appendiculatus | Ref. |
|
|
zoom in
| Organism | Poria cocos | | Reference | Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
QUANG, et al., Chem Pharm Bull, 51, (2003), 1441 |
|---|
|