| Name |
Linalyl acetate Linaloyl acetate |
| Formula |
C12H20O2 |
| Mw |
196.14632988 |
| CAS RN |
115-95-7 |
| C_ID |
C00003048
, 
|
| InChIKey |
UWKAYLJWKGQEPM-STGVRZAANA-N |
| InChICode |
InChI=1S/C12H20O2/c1-6-12(5,14-11(4)13)9-7-8-10(2)3/h6,8H,1,7,9H2,2-5H3/t12-/m0/s1 |
| SMILES |
C=C[C@@](C)(CCC=C(C)C)OC(C)=O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Asteraceae | Artemisia annua  | Ref. |
| Plantae | Asteraceae | Matricaria recutita  | Ref. |
| Plantae | Burseraceae | Boswellia carteri  | Ref. |
| Plantae | Cupressaceae | Juniperus phoenicea  | Ref. |
| Plantae | Cupressaceae | Juniperus thurifera var.africana | Ref. |
| Plantae | Juglandaceae | Juglans regia  | Ref. |
| Plantae | Labiatae | Lavandula angustifolia  | Ref. |
| Plantae | Labiatae | Lavandula bipinnata  | Ref. |
| Plantae | Labiatae | Lavandula dentata  | Ref. |
| Plantae | Labiatae | Lavandula officinalis  | Ref. |
| Plantae | Labiatae | Lavandula stoechas  | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Myrtaceae | Melaleuca alternifolia  | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Oleaceae | Jasminum grandiflorum  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
| Plantae | Piperaceae | Piper arboreum  | Ref. |
| Plantae | Piperaceae | Piper fimbriulatum | Ref. |
| Plantae | Piperaceae | Piper obliquum  | Ref. |
| Plantae | Rutaceae | Citrus aurantifolia  | Ref. |
| Plantae | Rutaceae | Citrus aurantium ssp.bergamia  | Ref. |
| Plantae | Rutaceae | Citrus aurantium var.amara  | Ref. |
| Plantae | Rutaceae | Citrus bergamia  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus medica  | Ref. |
| Plantae | Rutaceae | Citrus reticulata  | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Rutaceae | Citrus vulgaris  | Ref. |
| Plantae | Rutaceae | Zanthoxylum simulans | Ref. |
| Plantae | Saxifragaceae | Saxifraga stolonifera  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Zingiberaceae | Curcuma amanda Roxb | Ref. |
| Plantae | Zingiberaceae | Zingiber officinale  | Ref. |
| - | - | Lavandin abrialis | Ref. |
|
|
zoom in
| Organism | Jasminum grandiflorum | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|