| Name |
Tropine |
| Formula |
C8H15NO |
| Mw |
141.11536411 |
| CAS RN |
120-29-6 |
| C_ID |
C00002306
, 
|
| InChIKey |
CYHOMWAPJJPNMW-ALVKDBIINA-N |
| InChICode |
InChI=1S/C8H15NO/c1-9-6-2-3-7(9)5-8(10)4-6/h6-8,10H,2-5H2,1H3/t6-,7+,8+ |
| SMILES |
CN1C2CC[C@@H]1C[C@@H](O)C2 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Convolvulaceae | Convolvulus arvensis  | Ref. |
| Plantae | Fumariaceae | Corydalis yanhusuo  | Ref. |
| Plantae | Rhizophoraceae | Crossostylis biflora | Ref. |
| Plantae | Rhizophoraceae | Crossostylis multiflora | Ref. |
| Plantae | Rhizophoraceae | Crossostylis sebertii | Ref. |
| Plantae | Solanaceae | Anisodus acutangulus | Ref. |
| Plantae | Solanaceae | Anisodus belladonna | Ref. |
| Plantae | Solanaceae | Anisodus luridus  | Ref. |
| Plantae | Solanaceae | Anisodus tanguticus | Ref. |
| Plantae | Solanaceae | Atropa baetica | Ref. |
| Plantae | Solanaceae | Atropa belladonna  | Ref. |
| Plantae | Solanaceae | Brugmansia arborea  | Ref. |
| Plantae | Solanaceae | Cyphomandra betaceae | Ref. |
| Plantae | Solanaceae | Datura ceratocaula  | Ref. |
| Plantae | Solanaceae | Datura innoxia  | Ref. |
| Plantae | Solanaceae | Datura metel  | Ref. |
| Plantae | Solanaceae | Datura stramonium x D.discolor  | Ref. |
| Plantae | Solanaceae | Hyoscyamus muticus  | Ref. |
| Plantae | Solanaceae | Hyoscyamus niger  | Ref. |
| Plantae | Solanaceae | Physalis peruviana  | Ref. |
| Plantae | Solanaceae | Physochlaina orientalis | Ref. |
| Plantae | Solanaceae | Schizanthus hookeri | Ref. |
| Plantae | Solanaceae | Schizanthus pinnatus | Ref. |
| Plantae | Solanaceae | Scopolia carniolica  | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
| - | - | Salpichora origanifolia | Ref. |
|
|
zoom in
| Organism | Hyoscyamus muticus | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|