| Name |
beta-Betulinic acid Betulinic acid |
| Formula |
C30H48O3 |
| Mw |
456.3603454 |
| CAS RN |
472-15-1 |
| C_ID |
C00003741
, 
|
| InChIKey |
QGJZLNKBHJESQX-VIXGVLKJNA-N |
| InChICode |
InChI=1S/C30H48O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h19-24,31H,1,8-17H2,2-7H3,(H,32,33)/t19-,20+,21-,22+,23-,24+,27-,28+,29+,30-/m0/s1 |
| SMILES |
C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaranthaceae | Achyranthes aspera  | Ref. |
| Plantae | Annonaceae | Goniothalamus thwaitesii | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Nerium oleander  | Ref. |
| Plantae | Apocynaceae | Plumeria obtusa  | Ref. |
| Plantae | Araceae | Arum maculatum L.  | Ref. |
| Plantae | Asteraceae | Cichorium intybus  | Ref. |
| Plantae | Betulaceae | Betula utilis  | Ref. |
| Plantae | Cactaceae | Stenocereus eruca | Ref. |
| Plantae | Campanulaceae | Clermontia fauriei | Ref. |
| Plantae | Caryophyllaceae | Gypsophila struthium | Ref. |
| Plantae | Chrysobalanaceae | Couepia polyandra | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Clusia nemorosa  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Clusiaceae-Guttiferae | Tovomita brasiliensis | Ref. |
| Plantae | Combretaceae | Terminalia fagifolia | Ref. |
| Plantae | Combretaceae | Terminalia superba  | Ref. |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus florida L. | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Dichapetalaceae | Dichapetalum gelonioides | Ref. |
| Plantae | Dilleniaceae | Dillenia indica  | Ref. |
| Plantae | Dilleniaceae | Dillenia serrata  | Ref. |
| Plantae | Dilleniaceae | Tetracera boiviniana  | Ref. |
| Plantae | Dipterocarpaceae | Vatica cinerea | Ref. |
| Plantae | Ebenaceae | Diospyros abyssinica  | Ref. |
| Plantae | Ebenaceae | Diospyros alboflavescens | Ref. |
| Plantae | Ebenaceae | Diospyros argentea | Ref. |
| Plantae | Ebenaceae | Diospyros bipindensis | Ref. |
| Plantae | Ebenaceae | Diospyros buxifolia  | Ref. |
| Plantae | Ebenaceae | Diospyros canaliculata | Ref. |
| Plantae | Ebenaceae | Diospyros candalleana | Ref. |
| Plantae | Ebenaceae | Diospyros castanea | Ref. |
| Plantae | Ebenaceae | Diospyros cauliflora | Ref. |
| Plantae | Ebenaceae | Diospyros chevalieri | Ref. |
| Plantae | Ebenaceae | Diospyros chloroxylon  | Ref. |
| Plantae | Ebenaceae | Diospyros cinnabarina | Ref. |
| Plantae | Ebenaceae | Diospyros consolatae | Ref. |
| Plantae | Ebenaceae | Diospyros cornii | Ref. |
| Plantae | Ebenaceae | Diospyros crassiflora | Ref. |
| Plantae | Ebenaceae | Diospyros curranii | Ref. |
| Plantae | Ebenaceae | Diospyros dendo | Ref. |
| Plantae | Ebenaceae | Diospyros diepenhorstii  | Ref. |
| Plantae | Ebenaceae | Diospyros discolor  | Ref. |
| Plantae | Ebenaceae | Diospyros ebenum  | Ref. |
| Plantae | Ebenaceae | Diospyros ehretioides | Ref. |
| Plantae | Ebenaceae | Diospyros elliptifolia | Ref. |
| Plantae | Ebenaceae | Diospyros embryopteris  | Ref. |
| Plantae | Ebenaceae | Diospyros eriantha | Ref. |
| Plantae | Ebenaceae | Diospyros evena | Ref. |
| Plantae | Ebenaceae | Diospyros exsculpta | Ref. |
| Plantae | Ebenaceae | Diospyros ferrea | Ref. |
| Plantae | Ebenaceae | Diospyros fragrans | Ref. |
| Plantae | Ebenaceae | Diospyros gabunensis | Ref. |
| Plantae | Ebenaceae | Diospyros gilleti | Ref. |
| Plantae | Ebenaceae | Diospyros gracilescens | Ref. |
| Plantae | Ebenaceae | Diospyros greeniway | Ref. |
| Plantae | Ebenaceae | Diospyros guianensis  | Ref. |
| Plantae | Ebenaceae | Diospyros hirsuta | Ref. |
| Plantae | Ebenaceae | Diospyros hoyleana | Ref. |
| Plantae | Ebenaceae | Diospyros ismailii | Ref. |
| Plantae | Ebenaceae | Diospyros iturensis | Ref. |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Ebenaceae | Diospyros kaki var.sylvestris  | Ref. |
| Plantae | Ebenaceae | Diospyros kamerunensis | Ref. |
| Plantae | Ebenaceae | Diospyros leucomelas | Ref. |
| Plantae | Ebenaceae | Diospyros longiflora | Ref. |
| Plantae | Ebenaceae | Diospyros lotus  | Ref. |
| Plantae | Ebenaceae | Diospyros mafiensis | Ref. |
| Plantae | Ebenaceae | Diospyros maingayi | Ref. |
| Plantae | Ebenaceae | Diospyros malanonilau | Ref. |
| Plantae | Ebenaceae | Diospyros mannii | Ref. |
| Plantae | Ebenaceae | Diospyros maritima  | Ref. |
| Plantae | Ebenaceae | Diospyros melanoxylon  | Ref. |
| Plantae | Ebenaceae | Diospyros mespiliformis  | Ref. |
| Plantae | Ebenaceae | Diospyros monobuttensis | Ref. |
| Plantae | Ebenaceae | Diospyros montana  | Ref. |
| Plantae | Ebenaceae | Diospyros moonii | Ref. |
| Plantae | Ebenaceae | Diospyros morrisiana | Ref. |
| Plantae | Ebenaceae | Diospyros natalensis | Ref. |
| Plantae | Ebenaceae | Diospyros obliquifolia | Ref. |
| Plantae | Ebenaceae | Diospyros palmeri | Ref. |
| Plantae | Ebenaceae | Diospyros peregrina  | Ref. |
| Plantae | Ebenaceae | Diospyros pseudo-malabarica | Ref. |
| Plantae | Ebenaceae | Diospyros quaesita | Ref. |
| Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
| Plantae | Ebenaceae | Diospyros sanza-minika | Ref. |
| Plantae | Ebenaceae | Diospyros siamang | Ref. |
| Plantae | Ebenaceae | Diospyros siamensis | Ref. |
| Plantae | Ebenaceae | Diospyros siderophylla | Ref. |
| Plantae | Ebenaceae | Diospyros singaporensis | Ref. |
| Plantae | Ebenaceae | Diospyros spinescens | Ref. |
| Plantae | Ebenaceae | Diospyros sumatrana | Ref. |
| Plantae | Ebenaceae | Diospyros sylvatica | Ref. |
| Plantae | Ebenaceae | Diospyros thwaitesii | Ref. |
| Plantae | Ebenaceae | Diospyros tomentosa  | Ref. |
| Plantae | Ebenaceae | Diospyros verrucosa | Ref. |
| Plantae | Ebenaceae | Diospyros virginiana  | Ref. |
| Plantae | Ebenaceae | Diospyros walkeri | Ref. |
| Plantae | Ebenaceae | Diospyros wallichii | Ref. |
| Plantae | Ebenaceae | Diospyros zenkeri | Ref. |
| Plantae | Ericaceae | Enkianthus cernuus | Ref. |
| Plantae | Ericaceae | Epigaea asiatica | Ref. |
| Plantae | Ericaceae | Leucothoe grayana Max. | Ref. |
| Plantae | Ericaceae | Pieris japonica D.Don.  | Ref. |
| Plantae | Ericaceae | Rhododendron arboreum  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia micractina | Ref. |
| Plantae | Fabaceae | Acacia mellifera  | Ref. |
| Plantae | Fabaceae | Bauhinia vahlii L.  | Ref. |
| Plantae | Fabaceae | Cassia spectabilis  | Ref. |
| Plantae | Fabaceae | Eysenhardtia platycarpa | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Harpalyce brasiliana | Ref. |
| Plantae | Fabaceae | Hedysarum multijugum | Ref. |
| Plantae | Fabaceae | Lespedeza bicolor  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Fabaceae | Pongamia pinnata  | Ref. |
| Plantae | Hypericaceae | Harungana madagascariensis  | Ref. |
| Plantae | Hypericaceae | Psorospermum glaberrimum | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Origanum compactum  | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis L.  | Ref. |
| Plantae | Labiatae | Salvia nicolsoniana | Ref. |
| Plantae | Labiatae | Salvia roborowskii | Ref. |
| Plantae | Labiatae | Salvia virgata | Ref. |
| Plantae | Labiatae | Thymus caramanicus | Ref. |
| Plantae | Labiatae | Thymus persicus | Ref. |
| Plantae | Labiatae | Thymus pubescens | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Lardizabalaceae | Stauntonia hexahylla | Ref. |
| Plantae | Lauraceae | Beilschmiedia zenkeri | Ref. |
| Plantae | Lecythidaceae | Gustavia hexapetala  | Ref. |
| Plantae | Lythraceae | Lawsonia alba  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Adansonia digitata  | Ref. |
| Plantae | Malvaceae | Helicteres angustifolia  | Ref. |
| Plantae | Melastomataceae | Henriettella fascicularis | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus australis  | Ref. |
| Plantae | Myrtaceae | Eucalyptus camaldulensis var.obtusa  | Ref. |
| Plantae | Myrtaceae | Eucalyptus citriodora  | Ref. |
| Plantae | Myrtaceae | Eugenia sandwicensis | Ref. |
| Plantae | Myrtaceae | Melaleuca ericifolia | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendron  | Ref. |
| Plantae | Myrtaceae | Syzygium cumini  | Ref. |
| Plantae | Myrtaceae | Syzygium formosanum | Ref. |
| Plantae | Oleaceae | Jasminum lanceolarium | Ref. |
| Plantae | Oleaceae | Olea europaea  | Ref. |
| Plantae | Paeoniaceae | Paeonia suffruticosa  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus reticulatus  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus urinaria  | Ref. |
| Plantae | Piperaceae | Peperomia sui | Ref. |
| Plantae | Plantaginaceae | Adenosma caeruleum | Ref. |
| Plantae | Plantaginaceae | Scoparia dulcis L.  | Ref. |
| Plantae | Plantaginaceae | Stemodia foliosa | Ref. |
| Plantae | Platanaceae | Platanus occidentalis | Ref. |
| Plantae | Polygonaceae | Coccoloba excoriata | Ref. |
| Plantae | Ranunculaceae | Anemone rivularis  | Ref. |
| Plantae | Rhamnaceae | Alphitonia excelsa Boiss.  | Ref. |
| Plantae | Rhamnaceae | Alphitonia petriei Braid et White.  | Ref. |
| Plantae | Rhamnaceae | Alphitonia whitei Braid | Ref. |
| Plantae | Rhamnaceae | Alphitonia zizyphoides  | Ref. |
| Plantae | Rhamnaceae | Ziziphus cambodiana | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba var.spinosa  | Ref. |
| Plantae | Rhamnaceae | Zizyphus joazeiro  | Ref. |
| Plantae | Rhamnaceae | Zizyphus vulgaris | Ref. |
| Plantae | Rhizophoraceae | Ceriops tagal  | Ref. |
| Plantae | Rosaceae | Chaenomeles sinensis KOEHNE  | Ref. |
| Plantae | Rosaceae | Rosa multiflora  | Ref. |
| Plantae | Rubiaceae | Coussarea paniculata | Ref. |
| Plantae | Rubiaceae | Mitragyna inermis  | Ref. |
| Plantae | Rubiaceae | Psychotria adenophylla  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Fagara tessmannii Engl. | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Sapindaceae | Schleichera oleosa  | Ref. |
| Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia cherryi | Ref. |
| Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia gymnanthera | Ref. |
| Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia merrilliana | Ref. |
| Plantae | Trochodendraceae/Tetracentraceae | Tetracentron sinense  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana laxiflora | Ref. |
| - | - | Machaerocereus eruca | Ref. |
| - | - | Moldenhavera nutans | Ref. |
| - | - | Syzigium claviflorum | Ref. |
| - | - | Zizphus cambodiana | Ref. |
|
|
zoom in
| Organism | Ziziphus jujuba var.spinosa | | Reference | Lee, et al., Planta Med, 69, (2003), 1051.
Chen, Liu, et al., Determination of Effective Components in Traditional Chinese medicines, People's Medical Publishing House, Beijing, (2009).
Deachathai, et al., Phytochemistry, 66, (2005), 2368.
Gu, et al., Planta Med, 70, (2004), 509.
Kinghorn, et al., Planta Med, 70, (2004), 691.
Carcache-Blanco, et al., Journal of Natural Products, 66, (2003), 1197.
Mutai, et al., Phytochemistry, 65, (2004), 1159.
SUKSAMRARN, et al., Chem Pharm Bull, 54, (2006), 535.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Xu, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 22, (1997), 679.
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993).
Wang, et al., Chinese Pharmaceutical Journal(Zhongguo Yaoxue Zazhi), 29, (1994), 268.
Xiong, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 18, (1993), 486.
Guo, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 23, (1998), 546. |
|---|
|