| Name |
p-Coumaric acid p-Coumarate 4-Coumarate 4-coumaric acid |
| Formula |
C9H8O3 |
| Mw |
164.04734412 |
| CAS RN |
7400-08-0 |
| C_ID |
C00000152
, 
|
| InChIKey |
NGSWKAQJJWESNS-ZZXKWVIFSA-N |
| InChICode |
InChI=1S/C9H8O3/c10-8-4-1-7(2-5-8)3-6-9(11)12/h1-6,10H,(H,11,12)/b6-3+ |
| SMILES |
O=C(O)/C=C/c1ccc(O)cc1 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera japonica  | Ref. |
| Plantae | Acoraceae | Acorus calamus  | Ref. |
| Plantae | Alliaceae | Allium obliquum  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Alliaceae | Allium Sativum | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona muricata  | Ref. |
| Plantae | Annonaceae | Cananga latifolia | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Apiaceae | Falcaria vulgaris | Ref. |
| Plantae | Apiaceae | Foeniculum vulgare  | Ref. |
| Plantae | Aquifoliaceae | Ilex paraguariensis  | Ref. |
| Plantae | Aristolochiaceae | Aristolochia manshuriensis | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asphodelaceae | Aloe vera  | Ref. |
| Plantae | Asteraceae | Chrysanthemum boreale | Ref. |
| Plantae | Asteraceae | Inula britannica  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Balanophoraceae | Balanophora abbreviata B1 | Ref. |
| Plantae | Begoniaceae | Begonia nantoensis | Ref. |
| Plantae | Berberidaceae | Epimedium sagittatum  | Ref. |
| Plantae | Bignoniaceae | Catalpa ovata  | Ref. |
| Plantae | Bignoniaceae | Stereospermum zenkeri | Ref. |
| Plantae | Boraginaceae | Lithospermum erythrorhizon  | Ref. |
| Plantae | Bromeliaceae | Ananas comosus  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caricaceae | Carica papaya  | Ref. |
| Plantae | Caryophyllaceae | Dianthus caryophyllus  | Ref. |
| Plantae | Caryophyllales | Beta vulgaris L. var. saccharifera  | Ref. |
| Plantae | Chenopodiaceae | Spinacia oleracea  | Ref. |
| Plantae | Chloranthaceae | Sarcandra glabra  | Ref. |
| Plantae | Commelinaceae | Commelina communis  | Ref. |
| Plantae | Commelinaceae | Dichorisandra thyrsiflora | Ref. |
| Plantae | Convolvulaceae | Cuscuta australis  | Ref. |
| Plantae | Crassulaceae | Bryophyllum pinnatum  | Ref. |
| Plantae | Crassulaceae | Rhodiola sachalinensis  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica napus  | Ref. |
| Plantae | Cruciferae | Brassica oleracea var. gongylodes  | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cucurbitaceae | Citrullus colocynthis  | Ref. |
| Plantae | Cucurbitaceae | Cucumis sativus  | Ref. |
| Plantae | Cucurbitaceae | Momordica charantia  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Cyperaceae | Cyperus papyrus  | Ref. |
| Plantae | Cyperaceae | Cyperus rotundus L.  | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Ephedraceae | Ephedra alata | Ref. |
| Plantae | Ephedraceae | Ephedra equisetina  | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lens esculenta  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Medicago sativa  | Ref. |
| Plantae | Fabaceae | Medicago truncatula | Ref. |
| Plantae | Fabaceae | Melilotus messanensis | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Pueraria candollei var. mirifica | Ref. |
| Plantae | Fabaceae | Sophora flavescens  | Ref. |
| Plantae | Fabaceae | Sophora japonica  | Ref. |
| Plantae | Fabaceae | Trifolium alpestre | Ref. |
| Plantae | Fabaceae | Trifolium medium | Ref. |
| Plantae | Fabaceae | Trifolium pratense L.  | Ref. |
| Plantae | Fumariaceae | Fumaria capreolata  | Ref. |
| Plantae | Fumariaceae | Fumaria officinalis  | Ref. |
| Plantae | Fumariaceae | Fumaria schleicheri | Ref. |
| Plantae | Fumariaceae | Fumaria vaillantii  | Ref. |
| Plantae | Geraniaceae | Pelargonium reniforme | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Haemodoraceae | Anigozanthos preissii | Ref. |
| Plantae | Hydrocharitaceae | Thalassia testudinum | Ref. |
| Plantae | Iridaceae | Crocus sativus  | Ref. |
| Plantae | Juncaceae | Juncus inflexus | Ref. |
| Plantae | Labiatae | Melissa officinalis  | Ref. |
| Plantae | Labiatae | Mentha piperitae | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Ocimum sanctum  | Ref. |
| Plantae | Labiatae | Origanum acutidens | Ref. |
| Plantae | Labiatae | Origanum dubium | Ref. |
| Plantae | Labiatae | Origanum vulgare  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Satureja subspicata  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Labiatae | Thymus comosus | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Liliaceae | Notholirion hyacinthium | Ref. |
| Plantae | Lygodiaceae/Schizaeaceae | Lygodium japonicum  | Ref. |
| Plantae | Lythraceae | Lawsonia inermis  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Magnolia denudata  | Ref. |
| Plantae | Magnoliaceae | Magnolia liliiflora  | Ref. |
| Plantae | Malvaceae | Althaea nudiflora | Ref. |
| Plantae | Malvaceae | Althaea rosea  | Ref. |
| Plantae | Malvaceae | Hibiscus taiwanensis | Ref. |
| Plantae | Malvaceae | Malva silvestris  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moringaceae | Moringa oleifera  | Ref. |
| Plantae | Moringaceae | Moringa peregrine | Ref. |
| Plantae | Moringaceae | Moringa stenopetala  | Ref. |
| Plantae | Myrtaceae | Eucalyptus maculata | Ref. |
| Plantae | Myrtaceae | Psidium guajava  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea caerulea | Ref. |
| Plantae | Oleaceae | Syringa oblata | Ref. |
| Plantae | Orchidaceae | Bulbophyllum vaginatum | Ref. |
| Plantae | Orchidaceae | Gymnadenia conopsea R.BR. | Ref. |
| Plantae | Palmae | Cocos nucifera  | Ref. |
| Plantae | Palmae | Phoenix canariensis  | Ref. |
| Plantae | Pinaceae | Picea abies  | Ref. |
| Plantae | Pinaceae | Picea ajanensis | Ref. |
| Plantae | Pinaceae | Picea obovata | Ref. |
| Plantae | Pinaceae | Pinus radiata | Ref. |
| Plantae | Pinaceae | Pinus spp.  | Ref. |
| Plantae | Plantaginaceae | Plantago major  | Ref. |
| Plantae | Plantaginaceae | Plantago media  | Ref. |
| Plantae | Plantaginaceae | Veronica officinalis  | Ref. |
| Plantae | Plantaginaceae | Veronica orchidea | Ref. |
| Plantae | Plantaginaceae | Veronica spicata | Ref. |
| Plantae | Plantaginaceae | Veronica teucrium | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Poaceae | Gynerium sagittatum  | Ref. |
| Plantae | Poaceae | Maize bran | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Panicum virgatum | Ref. |
| Plantae | Poaceae | Phyllostachys edulis | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Polygonaceae | Calligonum leucocladum | Ref. |
| Plantae | Ranunculaceae | Actaea racemosa  | Ref. |
| Plantae | Ranunculaceae | Ranunculus baudotii | Ref. |
| Plantae | Restionaceae | Baloskion tetraphyllum | Ref. |
| Plantae | Restionaceae | Elegia capensis | Ref. |
| Plantae | Rhamnaceae | Colubrina faralaotra subsp.trichocarpa. | Ref. |
| Plantae | Rosaceae | Cowania mexicana  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus serotina  | Ref. |
| Plantae | Rosaceae | Spiraea formosana  | Ref. |
| Plantae | Rutaceae | Citrus limon  | Ref. |
| Plantae | Rutaceae | Citrus paradisi  | Ref. |
| Plantae | Rutaceae | Phellodendron japonicum MAXIM | Ref. |
| Plantae | Salicaceae | Populus deltoides | Ref. |
| Plantae | Salicaceae | Populus spp. | Ref. |
| Plantae | Salicaceae | Populus trichocarpa | Ref. |
| Plantae | Sarcolaenaceae | Leptolaena diospyroidea | Ref. |
| Plantae | Sarcolaenaceae | Leptolaena pauciflora | Ref. |
| Plantae | Scrophulariaceae | Scrophularia buergeriana | Ref. |
| Plantae | Simaroubaceae | Ailanthus integrifolia | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum lycopersicum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Staphyleaceae | Euscaphis konishii | Ref. |
| Plantae | Strelitziaceae | Strelitzia reginae  | Ref. |
| Plantae | Taxaceae | Taxus baccata  | Ref. |
| Plantae | Typhaceae | Typha domingensis P.  | Ref. |
| Plantae | Typhaceae | Typha orientalis  | Ref. |
| Plantae | Typhaceae/Sparganiaceae | Sparganium stoloniferum | Ref. |
| Plantae | Vitaceae | Vitis rupestris | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| Plantae | Zingiberaceae | Alpinia blepharocalyx  | Ref. |
| Plantae | Zingiberaceae | Curcuma domestica  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| Plantae | Zingiberaceae | Curcuma mangga  | Ref. |
| Plantae | Zingiberaceae | Hedychium gardnerianum | Ref. |
| Plantae | Zygophyllaceae | Larrea divaricata  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Ephedar aphylla | Ref. |
| - | - | Equsetum arvense | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Sarcolaeana multiflora | Ref. |
| - | - | Scrophularis sambucifolia | Ref. |
|
|
zoom in
| Organism | Alpinia blepharocalyx | | Reference | Ou, et al., Brief Handbook of Components of Traditional Chinese Medicines, The People's Medical Publishing House, Beijing, (2003).
Kim, et al., Planta Med, 69, (2003), 274.
McNally, et al., Journal of Natural Products, 66, (2003), 1280.
Wu, et al., Journal of Natural Products, 66, (2003), 996.
CHIU, et al., Chem Pharm Bull, 53, (2005), 1118.
Kim, et al., Phytochemistry, 54, (2000), 503.
Ali, et al., Journal of Natural Products, 64, (2001), 289.
Wu, et al., Chem Pharm Bull, 53, (2005), 56.
Sun, et al., Brief Handbook of Natural Active Compounds, Medicinal Science and Technology Press of China, Beijing, (1998).
Chinese Materia Medica Editing Committee of the National Chinese Medicine and Pharmacology Bureau, Chinese Materia Medica (ZHONG HUA BEN CAO), Vol.1-Vol.30, Shanghai Science and technology Press, Shanghai, (1999).
Li, et al., China Journal of Chinese Materia Medica(Zhongguo Zhongyao Zazhi), 22, (1997), 548.
Yin, et al., Modern Study of Chinese Drugs and Clinical Applications (1), Xueyuan Press, Beijing, (1993). |
|---|
|