| Name |
Linoleic acid (Z,Z)-9,12-Octadecadienoic acid |
| Formula |
C18H32O2 |
| Mw |
280.24023027 |
| CAS RN |
60-33-3 |
| C_ID |
C00001224
, 
|
| InChIKey |
OYHQOLUKZRVURQ-IXWMQOLASA-N |
| InChICode |
InChI=1S/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20)/b7-6-,10-9+ |
| SMILES |
CCCCC/C=CC/C=C/CCCCCCCC(=O)O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Animalia | Hominidae | Homo sapiens (Serum) | Ref. |
| Fungi | Elaphomycetaceae | Monascus pilosus BCRC38072 | Ref. |
| Fungi | Ganodermataceae | Ganoderma lucidum  | Ref. |
| Fungi | Trichocomaceae | Aspergillus insuetus | Ref. |
| Plantae | Acanthaceae | Justicia heterocarpa T.ANDERS  | Ref. |
| Plantae | Acoraceae | Acorus calanus L. | Ref. |
| Plantae | Alliaceae | Allium hirtifolium | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Annonaceae | Annona squamosa  | Ref. |
| Plantae | Apiaceae | Apium graveolens  | Ref. |
| Plantae | Apiaceae | Daucus carota subsp. Sativus  | Ref. |
| Plantae | Aquifoliaceae | Ilex integra | Ref. |
| Plantae | Araliaceae | Panax ginseng  | Ref. |
| Plantae | Asparagaceae | Asparagus officinalis  | Ref. |
| Plantae | Asteraceae | Matricaria chamomilla  | Ref. |
| Plantae | Asteraceae | Silybum marianum  | Ref. |
| Plantae | Boraginaceae | Echium auberianum | Ref. |
| Plantae | Boraginaceae | Echium boissieri | Ref. |
| Plantae | Boraginaceae | Echium gentianoides | Ref. |
| Plantae | Boraginaceae | Echium giganteum | Ref. |
| Plantae | Boraginaceae | Echium lusitanicum | Ref. |
| Plantae | Boraginaceae | Echium pitardii | Ref. |
| Plantae | Boraginaceae | Echium plantagineum  | Ref. |
| Plantae | Boraginaceae | Echium sabulicola | Ref. |
| Plantae | Boraginaceae | Echium strictum | Ref. |
| Plantae | Boraginaceae | Echium vulgare  | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum calaba | Ref. |
| Plantae | Calophyllaceae/Clusiaceae/Clusiaceae-Guttiferae | Calophyllum inophyllum  | Ref. |
| Plantae | Cannabaceae | Humulus lupulus  | Ref. |
| Plantae | Caryophyllaceae | Drymaria cordata  | Ref. |
| Plantae | Celastraceae | Tripterygium hypoglaucum | Ref. |
| Plantae | Cistaceae | Cistus creticus | Ref. |
| Plantae | Convolvulaceae | Erycibe expansa  | Ref. |
| Plantae | Cruciferae | Arabidopsis thaliana | Ref. |
| Plantae | Cruciferae | Brassica hirta  | Ref. |
| Plantae | Cruciferae | Capsella bursa-pastoris  | Ref. |
| Plantae | Cruciferae | Isatis tinctoria  | Ref. |
| Plantae | Cruciferae | Lepidium meyenii Maca  | Ref. |
| Plantae | Cupressaceae | Chamaecyparis formosensis | Ref. |
| Plantae | Euphorbiaceae | Aleurites moluccana  | Ref. |
| Plantae | Euphorbiaceae | Aleurites montana | Ref. |
| Plantae | Euphorbiaceae | Jatropha curcus | Ref. |
| Plantae | Fabaceae | Acacia mellifera  | Ref. |
| Plantae | Fabaceae | Bauhinia tomentosa  | Ref. |
| Plantae | Fabaceae | Cassia absu | Ref. |
| Plantae | Fabaceae | Clitoria ternata | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Mucuna puriens | Ref. |
| Plantae | Fabaceae | Psoralea corylifolia  | Ref. |
| Plantae | Ginkgoaceae | Ginkgo biloba  | Ref. |
| Plantae | Iridaceae | Iris soforana | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Labiatae | Salvia officinalis  | Ref. |
| Plantae | Labiatae | Thymus capitatus  | Ref. |
| Plantae | Laminariaceae | Laminaria japonica  | Ref. |
| Plantae | Lauraceae | Laurus nobilis  | Ref. |
| Plantae | Lythraceae | Lagerstroemia thomsonil | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Magnoliaceae | Magnolia officinalis  | Ref. |
| Plantae | Malvaceae | Durio zibethinus  | Ref. |
| Plantae | Malvaceae | Tilia cordata Mill.  | Ref. |
| Plantae | Meliaceae | Aphanamixis polystachya  | Ref. |
| Plantae | Nymphaeaceae | Nymphaea alba  | Ref. |
| Plantae | Oleaceae | Jasminum auriculatum  | Ref. |
| Plantae | Oxalidaceae | Averrhoa carambola  | Ref. |
| Plantae | Pinaceae | Pinus sibirica | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Ranunculaceae | Nigella sativa  | Ref. |
| Plantae | Rosaceae | Potentilla asiatica | Ref. |
| Plantae | Rosaceae | Potentilla desertorum | Ref. |
| Plantae | Rosaceae | Potentilla orientalis | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Ruta graveolens  | Ref. |
| Plantae | Sapindaceae | Aesculus hippocastanum L.  | Ref. |
| Plantae | Saururaceae | Houttuynia cordata  | Ref. |
| Plantae | Saxifragaceae | Saxifraga stolonifera Meerb.  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Mandragora autumnalis  | Ref. |
| Plantae | Solanaceae | Nicotiana tabacum  | Ref. |
| Plantae | Solanaceae | Solanum tuberosum  | Ref. |
| Plantae | Solanaceae | Withania somnifera  | Ref. |
| Plantae | Typhaceae | Typha domingensis P.  | Ref. |
| Plantae | Urticaceae | Boehmeria holosericea | Ref. |
| Plantae | Urticaceae | Boehmeria tricuspis | Ref. |
| Plantae | Zingiberaceae | Alpinia oxyphylla  | Ref. |
| Plantae | Zingiberaceae | Curcuma longa  | Ref. |
| - | - | Caffea sp. | Ref. |
| - | - | Chamaemalum nobile | Ref. |
| - | - | Curcurbita pepo L. | Ref. |
| - | - | FOOD SAKE | Ref. |
| - | - | Poterium polygamum | Ref. |
| - | - | Sebastiana sebiferum | Ref. |
| - | - | Spongiporus leucomallellus (Murril) | Ref. |
|
|
zoom in
| Organism | Asparagus officinalis | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 1, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|