| Name |
beta-Betulinic acid Betulinic acid |
| Formula |
C30H48O3 |
| Mw |
456.3603454 |
| CAS RN |
472-15-1 |
| C_ID |
C00003741
, 
|
| InChIKey |
QGJZLNKBHJESQX-VIXGVLKJNA-N |
| InChICode |
InChI=1S/C30H48O3/c1-18(2)19-10-15-30(25(32)33)17-16-28(6)20(24(19)30)8-9-22-27(5)13-12-23(31)26(3,4)21(27)11-14-29(22,28)7/h19-24,31H,1,8-17H2,2-7H3,(H,32,33)/t19-,20+,21-,22+,23-,24+,27-,28+,29+,30-/m0/s1 |
| SMILES |
C=C(C)[C@@H]1CC[C@]2(C(=O)O)CC[C@]3(C)[C@H](CC[C@@H]4[C@@]5(C)CC[C@H](O)C(C)(C)[C@@H]5CC[C@]43C)[C@@H]12 |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Amaranthaceae | Achyranthes aspera  | Ref. |
| Plantae | Annonaceae | Goniothalamus thwaitesii | Ref. |
| Plantae | Apocynaceae | Catharanthus roseus  | Ref. |
| Plantae | Apocynaceae | Nerium oleander  | Ref. |
| Plantae | Apocynaceae | Plumeria obtusa  | Ref. |
| Plantae | Araceae | Arum maculatum L.  | Ref. |
| Plantae | Asteraceae | Cichorium intybus  | Ref. |
| Plantae | Betulaceae | Betula utilis  | Ref. |
| Plantae | Cactaceae | Stenocereus eruca | Ref. |
| Plantae | Campanulaceae | Clermontia fauriei | Ref. |
| Plantae | Caryophyllaceae | Gypsophila struthium | Ref. |
| Plantae | Chrysobalanaceae | Couepia polyandra | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Clusia nemorosa  | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia dulcis  | Ref. |
| Plantae | Clusiaceae-Guttiferae | Tovomita brasiliensis | Ref. |
| Plantae | Combretaceae | Terminalia fagifolia | Ref. |
| Plantae | Combretaceae | Terminalia superba  | Ref. |
| Plantae | Cornaceae | Camptotheca acuminata | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus florida L. | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus officinalis  | Ref. |
| Plantae | Dichapetalaceae | Dichapetalum gelonioides | Ref. |
| Plantae | Dilleniaceae | Dillenia indica  | Ref. |
| Plantae | Dilleniaceae | Dillenia serrata  | Ref. |
| Plantae | Dilleniaceae | Tetracera boiviniana  | Ref. |
| Plantae | Dipterocarpaceae | Vatica cinerea | Ref. |
| Plantae | Ebenaceae | Diospyros abyssinica  | Ref. |
| Plantae | Ebenaceae | Diospyros alboflavescens | Ref. |
| Plantae | Ebenaceae | Diospyros argentea | Ref. |
| Plantae | Ebenaceae | Diospyros bipindensis | Ref. |
| Plantae | Ebenaceae | Diospyros buxifolia  | Ref. |
| Plantae | Ebenaceae | Diospyros canaliculata | Ref. |
| Plantae | Ebenaceae | Diospyros candalleana | Ref. |
| Plantae | Ebenaceae | Diospyros castanea | Ref. |
| Plantae | Ebenaceae | Diospyros cauliflora | Ref. |
| Plantae | Ebenaceae | Diospyros chevalieri | Ref. |
| Plantae | Ebenaceae | Diospyros chloroxylon  | Ref. |
| Plantae | Ebenaceae | Diospyros cinnabarina | Ref. |
| Plantae | Ebenaceae | Diospyros consolatae | Ref. |
| Plantae | Ebenaceae | Diospyros cornii | Ref. |
| Plantae | Ebenaceae | Diospyros crassiflora | Ref. |
| Plantae | Ebenaceae | Diospyros curranii | Ref. |
| Plantae | Ebenaceae | Diospyros dendo | Ref. |
| Plantae | Ebenaceae | Diospyros diepenhorstii  | Ref. |
| Plantae | Ebenaceae | Diospyros discolor  | Ref. |
| Plantae | Ebenaceae | Diospyros ebenum  | Ref. |
| Plantae | Ebenaceae | Diospyros ehretioides | Ref. |
| Plantae | Ebenaceae | Diospyros elliptifolia | Ref. |
| Plantae | Ebenaceae | Diospyros embryopteris  | Ref. |
| Plantae | Ebenaceae | Diospyros eriantha | Ref. |
| Plantae | Ebenaceae | Diospyros evena | Ref. |
| Plantae | Ebenaceae | Diospyros exsculpta | Ref. |
| Plantae | Ebenaceae | Diospyros ferrea | Ref. |
| Plantae | Ebenaceae | Diospyros fragrans | Ref. |
| Plantae | Ebenaceae | Diospyros gabunensis | Ref. |
| Plantae | Ebenaceae | Diospyros gilleti | Ref. |
| Plantae | Ebenaceae | Diospyros gracilescens | Ref. |
| Plantae | Ebenaceae | Diospyros greeniway | Ref. |
| Plantae | Ebenaceae | Diospyros guianensis  | Ref. |
| Plantae | Ebenaceae | Diospyros hirsuta | Ref. |
| Plantae | Ebenaceae | Diospyros hoyleana | Ref. |
| Plantae | Ebenaceae | Diospyros ismailii | Ref. |
| Plantae | Ebenaceae | Diospyros iturensis | Ref. |
| Plantae | Ebenaceae | Diospyros kaki  | Ref. |
| Plantae | Ebenaceae | Diospyros kaki var.sylvestris  | Ref. |
| Plantae | Ebenaceae | Diospyros kamerunensis | Ref. |
| Plantae | Ebenaceae | Diospyros leucomelas | Ref. |
| Plantae | Ebenaceae | Diospyros longiflora | Ref. |
| Plantae | Ebenaceae | Diospyros lotus  | Ref. |
| Plantae | Ebenaceae | Diospyros mafiensis | Ref. |
| Plantae | Ebenaceae | Diospyros maingayi | Ref. |
| Plantae | Ebenaceae | Diospyros malanonilau | Ref. |
| Plantae | Ebenaceae | Diospyros mannii | Ref. |
| Plantae | Ebenaceae | Diospyros maritima  | Ref. |
| Plantae | Ebenaceae | Diospyros melanoxylon  | Ref. |
| Plantae | Ebenaceae | Diospyros mespiliformis  | Ref. |
| Plantae | Ebenaceae | Diospyros monobuttensis | Ref. |
| Plantae | Ebenaceae | Diospyros montana  | Ref. |
| Plantae | Ebenaceae | Diospyros moonii | Ref. |
| Plantae | Ebenaceae | Diospyros morrisiana | Ref. |
| Plantae | Ebenaceae | Diospyros natalensis | Ref. |
| Plantae | Ebenaceae | Diospyros obliquifolia | Ref. |
| Plantae | Ebenaceae | Diospyros palmeri | Ref. |
| Plantae | Ebenaceae | Diospyros peregrina  | Ref. |
| Plantae | Ebenaceae | Diospyros pseudo-malabarica | Ref. |
| Plantae | Ebenaceae | Diospyros quaesita | Ref. |
| Plantae | Ebenaceae | Diospyros rhodocalyx | Ref. |
| Plantae | Ebenaceae | Diospyros sanza-minika | Ref. |
| Plantae | Ebenaceae | Diospyros siamang | Ref. |
| Plantae | Ebenaceae | Diospyros siamensis | Ref. |
| Plantae | Ebenaceae | Diospyros siderophylla | Ref. |
| Plantae | Ebenaceae | Diospyros singaporensis | Ref. |
| Plantae | Ebenaceae | Diospyros spinescens | Ref. |
| Plantae | Ebenaceae | Diospyros sumatrana | Ref. |
| Plantae | Ebenaceae | Diospyros sylvatica | Ref. |
| Plantae | Ebenaceae | Diospyros thwaitesii | Ref. |
| Plantae | Ebenaceae | Diospyros tomentosa  | Ref. |
| Plantae | Ebenaceae | Diospyros verrucosa | Ref. |
| Plantae | Ebenaceae | Diospyros virginiana  | Ref. |
| Plantae | Ebenaceae | Diospyros walkeri | Ref. |
| Plantae | Ebenaceae | Diospyros wallichii | Ref. |
| Plantae | Ebenaceae | Diospyros zenkeri | Ref. |
| Plantae | Ericaceae | Enkianthus cernuus | Ref. |
| Plantae | Ericaceae | Epigaea asiatica | Ref. |
| Plantae | Ericaceae | Leucothoe grayana Max. | Ref. |
| Plantae | Ericaceae | Pieris japonica D.Don.  | Ref. |
| Plantae | Ericaceae | Rhododendron arboreum  | Ref. |
| Plantae | Euphorbiaceae | Euphorbia micractina | Ref. |
| Plantae | Fabaceae | Acacia mellifera  | Ref. |
| Plantae | Fabaceae | Bauhinia vahlii L.  | Ref. |
| Plantae | Fabaceae | Cassia spectabilis  | Ref. |
| Plantae | Fabaceae | Eysenhardtia platycarpa | Ref. |
| Plantae | Fabaceae | Glycyrrhiza glabra  | Ref. |
| Plantae | Fabaceae | Harpalyce brasiliana | Ref. |
| Plantae | Fabaceae | Hedysarum multijugum | Ref. |
| Plantae | Fabaceae | Lespedeza bicolor  | Ref. |
| Plantae | Fabaceae | Lupinus albus  | Ref. |
| Plantae | Fabaceae | Millettia pinnata | Ref. |
| Plantae | Fabaceae | Pongamia pinnata  | Ref. |
| Plantae | Hypericaceae | Harungana madagascariensis  | Ref. |
| Plantae | Hypericaceae | Psorospermum glaberrimum | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Origanum compactum  | Ref. |
| Plantae | Labiatae | Orthosiphon stamineus  | Ref. |
| Plantae | Labiatae | Rosmarinus officinalis L.  | Ref. |
| Plantae | Labiatae | Salvia nicolsoniana | Ref. |
| Plantae | Labiatae | Salvia roborowskii | Ref. |
| Plantae | Labiatae | Salvia virgata | Ref. |
| Plantae | Labiatae | Thymus caramanicus | Ref. |
| Plantae | Labiatae | Thymus persicus | Ref. |
| Plantae | Labiatae | Thymus pubescens | Ref. |
| Plantae | Labiatae | Thymus vulgaris  | Ref. |
| Plantae | Lardizabalaceae | Stauntonia hexahylla | Ref. |
| Plantae | Lauraceae | Beilschmiedia zenkeri | Ref. |
| Plantae | Lecythidaceae | Gustavia hexapetala  | Ref. |
| Plantae | Lythraceae | Lawsonia alba  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Adansonia digitata  | Ref. |
| Plantae | Malvaceae | Helicteres angustifolia  | Ref. |
| Plantae | Melastomataceae | Henriettella fascicularis | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Moraceae | Morus australis  | Ref. |
| Plantae | Myrtaceae | Eucalyptus camaldulensis var.obtusa  | Ref. |
| Plantae | Myrtaceae | Eucalyptus citriodora  | Ref. |
| Plantae | Myrtaceae | Eugenia sandwicensis | Ref. |
| Plantae | Myrtaceae | Melaleuca ericifolia | Ref. |
| Plantae | Myrtaceae | Melaleuca leucadendron  | Ref. |
| Plantae | Myrtaceae | Syzygium cumini  | Ref. |
| Plantae | Myrtaceae | Syzygium formosanum | Ref. |
| Plantae | Oleaceae | Jasminum lanceolarium | Ref. |
| Plantae | Oleaceae | Olea europaea  | Ref. |
| Plantae | Paeoniaceae | Paeonia suffruticosa  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus reticulatus  | Ref. |
| Plantae | Phyllanthaceae | Phyllanthus urinaria  | Ref. |
| Plantae | Piperaceae | Peperomia sui | Ref. |
| Plantae | Plantaginaceae | Adenosma caeruleum | Ref. |
| Plantae | Plantaginaceae | Scoparia dulcis L.  | Ref. |
| Plantae | Plantaginaceae | Stemodia foliosa | Ref. |
| Plantae | Platanaceae | Platanus occidentalis | Ref. |
| Plantae | Polygonaceae | Coccoloba excoriata | Ref. |
| Plantae | Ranunculaceae | Anemone rivularis  | Ref. |
| Plantae | Rhamnaceae | Alphitonia excelsa Boiss.  | Ref. |
| Plantae | Rhamnaceae | Alphitonia petriei Braid et White.  | Ref. |
| Plantae | Rhamnaceae | Alphitonia whitei Braid | Ref. |
| Plantae | Rhamnaceae | Alphitonia zizyphoides  | Ref. |
| Plantae | Rhamnaceae | Ziziphus cambodiana | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba  | Ref. |
| Plantae | Rhamnaceae | Ziziphus jujuba var.spinosa  | Ref. |
| Plantae | Rhamnaceae | Zizyphus joazeiro  | Ref. |
| Plantae | Rhamnaceae | Zizyphus vulgaris | Ref. |
| Plantae | Rhizophoraceae | Ceriops tagal  | Ref. |
| Plantae | Rosaceae | Chaenomeles sinensis KOEHNE  | Ref. |
| Plantae | Rosaceae | Rosa multiflora  | Ref. |
| Plantae | Rubiaceae | Coussarea paniculata | Ref. |
| Plantae | Rubiaceae | Mitragyna inermis  | Ref. |
| Plantae | Rubiaceae | Psychotria adenophylla  | Ref. |
| Plantae | Rutaceae | Aegle marmelos  | Ref. |
| Plantae | Rutaceae | Fagara tessmannii Engl. | Ref. |
| Plantae | Santalaceae | Viscum coloratum  | Ref. |
| Plantae | Sapindaceae | Schleichera oleosa  | Ref. |
| Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia cherryi | Ref. |
| Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia gymnanthera | Ref. |
| Plantae | Theaceae/Pentaphylacaceae/Ternstroemiaceae | Ternstroemia merrilliana | Ref. |
| Plantae | Trochodendraceae/Tetracentraceae | Tetracentron sinense  | Ref. |
| Plantae | Valerianaceae/Linnaeaceae/Dipsacaceae/Diervillaceae | Valeriana laxiflora | Ref. |
| - | - | Machaerocereus eruca | Ref. |
| - | - | Moldenhavera nutans | Ref. |
| - | - | Syzigium claviflorum | Ref. |
| - | - | Zizphus cambodiana | Ref. |
|
|
zoom in
| Organism | Salvia virgata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 3, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|