| Name |
Cyanidin 3-O-glucoside Cyanidin-3-O-glucoside Chrysanthemin |
| Formula |
C21H21O11.Cl |
| Mw |
484.07723923 |
| CAS RN |
7084-24-4 |
| C_ID |
C00002374
, 
|
| InChIKey |
RKWHWFONKJEUEF-DNLILFCWNA-O |
| InChICode |
InChI=1S/C21H20O11/c22-7-16-17(27)18(28)19(29)21(32-16)31-15-6-10-12(25)4-9(23)5-14(10)30-20(15)8-1-2-11(24)13(26)3-8/h1-6,16-19,21-22,27-29H,7H2,(H3-,23,24,25,26)/p+1/t16-,17-,18+,19-,21-/m1/s1 |
| SMILES |
OCC1O[C@@H](Oc2cc3c(O)cc(O)cc3[o+]c2-c2ccc(O)c(O)c2)C(O)C(O)[C@@H]1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | -- | Lonicera caerulea | Ref. |
| Plantae | Adoxaceae | Sambucus canadensis  | Ref. |
| Plantae | Alliaceae | Allium cepa  | Ref. |
| Plantae | Alliaceae | Allium sativum  | Ref. |
| Plantae | Alliaceae | Allium schoenoprasum  | Ref. |
| Plantae | Alliaceae | Allium spp. | Ref. |
| Plantae | Alliaceae | Allium victorialis  | Ref. |
| Plantae | Anacardiaceae | Mangifera indica  | Ref. |
| Plantae | Apiaceae | Daucus carota  | Ref. |
| Plantae | Asteraceae | Aster spp. | Ref. |
| Plantae | Asteraceae | Chrysanthemum indicum  | Ref. |
| Plantae | Asteraceae | Helianthus annuus  | Ref. |
| Plantae | Asteraceae | Rhaponticum carthamoides  | Ref. |
| Plantae | Boraginaceae | Lobostemon spp. | Ref. |
| Plantae | Calochortaceae | Tricyrtis formosana | Ref. |
| Plantae | Clusiaceae/Clusiaceae-Guttiferae | Garcinia mangostana  | Ref. |
| Plantae | Coriariaceae | Coriaria myrtifolia | Ref. |
| Plantae | Cornaceae/Aucubaceae/Garryaceae/Helwingiaceae | Cornus suecica  | Ref. |
| Plantae | Crassulaceae | Cotyledon spp. | Ref. |
| Plantae | Crassulaceae | Crassula spp. | Ref. |
| Plantae | Crassulaceae | Tylecodon spp. | Ref. |
| Plantae | Cruciferae | Raphanus sativus  | Ref. |
| Plantae | Cynomoriaceae | Cynomorium coccineum | Ref. |
| Plantae | Dioscoreaceae | Dioscorea alata  | Ref. |
| Plantae | Ericaceae | Vaccinium myrtillus L.  | Ref. |
| Plantae | Ericaceae | Vaccinium padifolium | Ref. |
| Plantae | Fabaceae | Albizia julibrissin  | Ref. |
| Plantae | Fabaceae | Amphithalea spp. | Ref. |
| Plantae | Fabaceae | Bauhinia variegata  | Ref. |
| Plantae | Fabaceae | Cassia javanica  | Ref. |
| Plantae | Fabaceae | Coelidium spp. | Ref. |
| Plantae | Fabaceae | Delonix regia  | Ref. |
| Plantae | Fabaceae | Erythrina coralloides | Ref. |
| Plantae | Fabaceae | Erythrina crista-galli  | Ref. |
| Plantae | Fabaceae | Erythrina dominguezii | Ref. |
| Plantae | Fabaceae | Erythrina falcata | Ref. |
| Plantae | Fabaceae | Erythrina herbacea | Ref. |
| Plantae | Fabaceae | Erythrina pudica | Ref. |
| Plantae | Fabaceae | Erythrina x bidwillii | Ref. |
| Plantae | Fabaceae | Glycine max  | Ref. |
| Plantae | Fabaceae | Hypocalyptus spp. | Ref. |
| Plantae | Fabaceae | Lathyrus odoratus  | Ref. |
| Plantae | Fabaceae | Liparia spp. | Ref. |
| Plantae | Fabaceae | Phaseolus vulgaris  | Ref. |
| Plantae | Fabaceae | Pisum sativum  | Ref. |
| Plantae | Fabaceae | Podalyria spp. | Ref. |
| Plantae | Fabaceae | Tamarindus indica  | Ref. |
| Plantae | Fabaceae | Vigna mungo  | Ref. |
| Plantae | Fabaceae | Vigna subterranea  | Ref. |
| Plantae | Fabaceae | Virgilia spp. | Ref. |
| Plantae | Gentianaceae | Gentiana sp. | Ref. |
| Plantae | Geraniaceae | Geranium sylvaticum | Ref. |
| Plantae | Labiatae | Ocimum basilicum  | Ref. |
| Plantae | Labiatae | Perilla frutescens  | Ref. |
| Plantae | Lardizabalaceae | Akebia trifoliata  | Ref. |
| Plantae | Lardizabalaceae | Stauntonia hexaphylla  | Ref. |
| Plantae | Lythraceae | Punica granatum  | Ref. |
| Plantae | Malvaceae | Sterculia foetida  | Ref. |
| Plantae | Moraceae | Ficus carica  | Ref. |
| Plantae | Moraceae | Morus alba  | Ref. |
| Plantae | Myrtaceae | Eugenia umbelliflora | Ref. |
| Plantae | Myrtaceae | Myrtus communis  | Ref. |
| Plantae | Orchidaceae | Dracula chimaera | Ref. |
| Plantae | Palmae | Euterpe edulis  | Ref. |
| Plantae | Palmae | Pinanga polymorpha | Ref. |
| Plantae | Passifloraceae | Passiflora edulis  | Ref. |
| Plantae | Passifloraceae | Passiflora suberosa | Ref. |
| Plantae | Phrymaceae | Mimulus cardinalis | Ref. |
| Plantae | Phrymaceae | Mimulus lewisii | Ref. |
| Plantae | Pinaceae | Abies spp. | Ref. |
| Plantae | Pinaceae | Pinus banksiana  | Ref. |
| Plantae | Pinaceae | Pseudotsuga spp. | Ref. |
| Plantae | Pinaceae | Tsuga spp. | Ref. |
| Plantae | Poaceae | Alopecurus spp. | Ref. |
| Plantae | Poaceae | Anthoxanthum spp. | Ref. |
| Plantae | Poaceae | Avenula spp. | Ref. |
| Plantae | Poaceae | Bothriochloa spp. | Ref. |
| Plantae | Poaceae | Dactylis spp. | Ref. |
| Plantae | Poaceae | Deschampsia spp. | Ref. |
| Plantae | Poaceae | Elymus spp. | Ref. |
| Plantae | Poaceae | Festuca spp. | Ref. |
| Plantae | Poaceae | Hordeum spp. | Ref. |
| Plantae | Poaceae | Miscanthus spp. | Ref. |
| Plantae | Poaceae | Molinia spp. | Ref. |
| Plantae | Poaceae | Oryza sativa  | Ref. |
| Plantae | Poaceae | Oryza spp. | Ref. |
| Plantae | Poaceae | Pennisetum setaceum | Ref. |
| Plantae | Poaceae | Phalaris arundinacea | Ref. |
| Plantae | Poaceae | Phleum spp. | Ref. |
| Plantae | Poaceae | Phragmites australis  | Ref. |
| Plantae | Poaceae | Poa spp. | Ref. |
| Plantae | Poaceae | Sinarundinaria spp. | Ref. |
| Plantae | Poaceae | Triticum aestivum  | Ref. |
| Plantae | Poaceae | Zea mays  | Ref. |
| Plantae | Rosaceae | Prunus avium  | Ref. |
| Plantae | Rosaceae | Prunus cerasus  | Ref. |
| Plantae | Rosaceae | Rosa spp. | Ref. |
| Plantae | Rosaceae | Rubus idaeus  | Ref. |
| Plantae | Rubiaceae | Cephaelis subcoriacea | Ref. |
| Plantae | Rutaceae | Citrus sinensis  | Ref. |
| Plantae | Sapindaceae | Acer platanoides  | Ref. |
| Plantae | Solanaceae | Capsicum annuum  | Ref. |
| Plantae | Solanaceae | Petunia exserta | Ref. |
| Plantae | Ternstroemiaceae | Visnea mocanera | Ref. |
| Plantae | Theaceae | Camellia sinensis  | Ref. |
| Plantae | Vitaceae | Vitis vinifera  | Ref. |
| - | - | FOOD SAKE | Ref. |
|
|
zoom in
| Organism | Chrysanthemum indicum | | Reference | Harborne, The Handbook of Natural Flavonoids, 2, (1999), 1,Anthocyanins
Willstatter,Ann.,412,(1916),136 |
|---|
|