| Name |
Isoscoparin Isoorientin 3'-methyl ether |
| Formula |
C22H22O11 |
| Mw |
462.11621155 |
| CAS RN |
20013-23-4 |
| C_ID |
C00001058
, 
|
| InChIKey |
KOMUHHCFAXYRPO-FPRNEBIWNA-N |
| InChICode |
InChI=1S/C22H22O11/c1-31-13-4-8(2-3-9(13)24)12-5-10(25)16-14(32-12)6-11(26)17(19(16)28)22-21(30)20(29)18(27)15(7-23)33-22/h2-6,15,18,20-24,26-30H,7H2,1H3/t15-,18-,20+,21-,22+/m1/s1 |
| SMILES |
COc1cc(-c2cc(=O)c3c(O)c([C@@H]4OC(CO)[C@@H](O)[C@H](O)C4O)c(O)cc3o2)ccc1O |
| Start Substs in Alk. Biosynthesis (Prediction) |
|
| Organism |
| Kingdom |
Family |
Species |
Reference |
| Plantae | Araceae | Lemna minor | Ref. |
| Plantae | Asteraceae | Haplopappus spp. | Ref. |
| Plantae | Caryophyllaceae | Silene spp. | Ref. |
| Plantae | Cruciferae | Isatis tinctoria  | Ref. |
| Plantae | Cucurbitaceae | Citrullus colocynthis  | Ref. |
| Plantae | Gentianaceae | Gentiana decumbens | Ref. |
| Plantae | Gentianaceae | Gentiana decumbers | Ref. |
| Plantae | Gentianaceae | Gentiana farreri | Ref. |
| Plantae | Gentianaceae | Gentiana macrophylla  | Ref. |
| Plantae | Gentianaceae | Gentiana punctata L.  | Ref. |
| Plantae | Gentianaceae | Gentiana sino-ornata | Ref. |
| Plantae | Gentianaceae | Gentiana spp. | Ref. |
| Plantae | Gentianaceae | Gentiana triflora | Ref. |
| Plantae | Poaceae | Cymbopogon citratus  | Ref. |
| Plantae | Potamogetonaceae | Potamogeton natans | Ref. |
|
|
zoom in
| Organism | Gentiana sino-ornata | | Reference | Singh, B and Sharma, R. V., Secondary Metabolites of Medicinal Plants, Vol. 2, (2020), Wiley-VCH Verlag GmbH and Co. KGaA. |
|---|
|